Consider the hypothetical bimetallic titanium dinitrogen complexes (N2C, (μ-N2) [TiCl2L312. neutral 2e donor) a. Draw reasonable structures for A, B, and C assuming that the oxidation state of titanium in these three compounds is the same. b. Which compound would have the highest v(N-N) ? c. Which compound would have the longest N - N bond? J C A 2. Consider the hypothetical bimetallic titanium dinitrogen complexes A (U-N₂) [TiCl4L]2, B (μ- N2)[TiCl3L2]2, and C, (μ-N2) [TiCl2L3]2. (L = neutral 2 e donor) a. Draw reasonable structures for A, B, and C assuming that the oxidation state of titanium in these three compounds is the same. B b. Which compound would have the highest v(N-N)? c. Which compound would have the longest N-N bond?

Consider the hypothetical bimetallic titanium dinitrogen complexes (N2C, (μ-N2) [TiCl2L312. neutral 2e donor) a. Draw reasonable structures for A, B, and C assuming that the oxidation state of titanium in these three compounds is the same. b. Which compound would have the highest v(N-N) ? c. Which compound would have the longest N - N bond? J C A 2. Consider the hypothetical bimetallic titanium dinitrogen complexes A (U-N₂) [TiCl4L]2, B (μ- N2)[TiCl3L2]2, and C, (μ-N2) [TiCl2L3]2. (L = neutral 2 e donor) a. Draw reasonable structures for A, B, and C assuming that the oxidation state of titanium in these three compounds is the same. B b. Which compound would have the highest v(N-N)? c. Which compound would have the longest N-N bond?

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter19: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 27E: Give the coordination numbers and write the formulas for each of the following, including all...

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
A 3.03-g petroleum specimen was decomposed by wet ashing and subsequently diluted to 500 mL in a volumetric flask. Cobalt was determined by treating 25.00-mL aliquots of this diluted solution as follows: Assume that the Co(II)-ligand chelate obeys Beer’s law, and calculate the percentage of cobalt in the original sample.
Give the coordination numbers and write the formulas for each of the following, including all isomers where appropriate: (a) tetrahydroxozincate(ll) ion (tetrahedral). (b) hexacyanopalladate(IV) ion. (c) dichlomaurate(I) ion (note that aurum is Latin for "gold"). (d) diamminedichloroplatinum(Il). (e) potassium diamminetetrachlorochromate(III). (f) hexaamminecobalt(III) hexacyanochromate(III). (g) dibromobis(ethylenediamine) cobalt(III) nitrate
Amines, NR3, are usually only weakly coordinating toward low valent metals. why is this so?Do you think that NF3would be abetter ligand for these metals? Discuss the factors involved.
1.Show how a Fischer carbene complex can be prepared starting from Mo(CO)6 . 2.How would you explain the experimental observations that the SeF6 unit in Cs2[SeF6] is C2v and looks like six of the seven vertices of a capped trigonal prism are occupied by F, but the SeCl6 unit in Cs2[SeCl6] has Oh symmetry ?
Strong-field ligands (such as CN-) stabilise the M2* oxidation state. Reflect on the reason.
what about this answer ? Is this also correct? Isn't it contradict? " However, the back-donation from the metal center to CO's empty 2π* orbital is less extensive than with NO. This is because CO's 2π* orbital is higher in energy compared to NO's 2π* orbital. In summary, both NO and CO are pi-acceptor ligands due to their empty 2π* orbitals. However, NO is expected to be a stronger pi-acceptor ligand than CO because of the presence of the unpaired electron in its 2π* orbital and the lower energy of this orbital. The stronger pi-acceptor ability of NO can lead to a more stable metal-ligand bond, as well as greater electron density redistribution between the metal center and the ligand." I'm so confused NO is weaker or stronger pi-acceptor ligands
W, X, Y, and Z are different monodentate ligands.a. Is the square planar [NiWXYZ]2+ optically active?b. Is the tetrahedral [ZnWXYZ]2+ optically active?
(a) What coordination geometries could [AuI4]− take and how might it differ from the [AuCl4]− ion? (b) Which of Ag(NO3) and Ag2S would be expected to be more effective at removing bromide, Br−, from solution? Explain your reasoning.
. Explain why compounds of Sc3+ are colorless, but compounds ofTi3+ are colored?
For each of the following polydentate ligands, determine (i)the maximum number of coordination sites that the ligandcan occupy on a single metal ion and (ii) the number andtype of donor atoms in the ligand: (a) ethylenediamine(en), (b) bipyridine (bipy), (c) the oxalate anion (C2O42-),(d) the 2- ion of the porphine molecule (Figure ),(e) [EDTA4]-.
Are bipyridines (bipy) and analogous amines, phenanthroline (phen) and terpyridine (terpy) chelate ligands?Is there the possibility of the formation of complexes of these ligands with metals in a low oxidation state? Why?