Consider the reaction 2Co3+ (aq)+2CI-(aq)-2Co2+(aq)+Cl2(g) EOcell=0.71 V What is the cell potential at 298 K if the concentrations are: [Co3+]=0.258 M, [Co2+]=0.249 M, and [CI-]=0.523 M and the pressure of Cl2 is 2.55 bar. Express your answer to two decimal places. Ecell = x V %3D

Consider the reaction 2Co3+ (aq)+2CI-(aq)-2Co2+(aq)+Cl2(g) EOcell=0.71 V What is the cell potential at 298 K if the concentrations are: [Co3+]=0.258 M, [Co2+]=0.249 M, and [CI-]=0.523 M and the pressure of Cl2 is 2.55 bar. Express your answer to two decimal places. Ecell = x V %3D

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter19: Applications Of Standard Electrode Potentials

Section: Chapter Questions

Problem 19.8QAP

See similar textbooks

Related questions

Q: Calculate (in milligrams) how much CaCl2 is required to make up 7.5mL of a 33mM solution (the MW of…

A: Given : Molar concentration of solution = 33mM Volume of solution = 7.5 mL MW of CaCl2 = 110.98…

Q: Which of the following is a characteristic property of a complete combustion flame, as compared to…

A: Complete combustion takes place in the presence of a sufficient amount of oxygen while an incomplete…

Q: In an atomic absorption study, an unknown sample of Me+ had an absorbance of 0.355. The mixture was…

A: A question based on concentration terms that is to be accomplished.

Q: Which of the following explains why distillation curve is not linear? i. due to inverse relationship…

A: A question based on analytical separations that is to be accomplished.

Q: Write an introduction for the titration of acetic acid with NaOH and for the titration of Polyprotic…

Q: Jse the Excel spread sheet and plot : pH ( Y-axis ) ---- volume ( X-axis ) Determine the equivalence…

A: Given data: Volume pH 0 2.45 5 2.95 10 3.92 15 4.05 20 4.35 25 8.1 35 12.01 40…

Q: Identify the species oxidized, the species reduced, the oxidizing agent and the reducing agent in…

A: The reaction given is,

Q: What is the wavelength of light that has a frequency of 3 x 104 Hz in a vacuum? What is the energy…

Q: ionic equation

Q: State the Chemical Properties of Ascorbic Acid

A: Ascorbic acid chemical formulaC6H8O6 Ascorbic acid molecular weight / ascorbic acid molar mass176.12…

Q: Question 10 R2 R? ОН all are correct O glycerophospholipid O yields fatty acids, glycerol, and…

A: The systematic name of the above enzyme class is phospholipid:1,2-diacyl-sn-glycerol…

Q: structure

A: 70% of our earth being ocean water and 65% of our bodies being water, it is hard to not be aware of…

Q: IDENTIFY IF IOCANT, CHAIN LENGTH, PREFIX, SUBSTITUENT 1. 2,2-diethylheptane 2. 3-methyl-3-butene…

Q: 10 grams of methane and 10 grams of ethane are burned completely. Which will produce more carbon…

A: In this question, we have to calculate which will produce more CO2 on combustion.

Q: How can we make acetone? Give the reaction

A: Acetone

Q: 3.

A: Since you have posted a question with multiple sub-parts, we will solve the first three subparts for…

Q: 2) Solid ammonium sulfide is slowly added to 175 mL of a 0.326 M iron(III) sulfate solution until…

A: Here solid ammonium sulfide is slowly added to 175 ml of a 0.326M iron (III) sulfate until sulfide…

Q: 1 example for organic substitution reaction show: a. the overall reaction (reactants --> products)…

A: Please find your solution below : Substitution reactions of organic compounds are the reactions in…

Q: t oxidation number?

Q: What is the pH of a 0.2 M HI aqueous solution? HI(aq)+H2O(l)⇌H3O+(aq)+I−(aq) Ka=3.2×10^9

A: The dissociation reaction of HI is given as, => HI (aq) + H2O (l) ⇌ H3O+ (aq) + I- (aq)…

Q: Draw the major product of this reaction. Ignore inorganic byproducts. 1. KCN 2. H3O*

A: In conjugated ketone, electrophilic nature of carbon in carbonyl is decrease due to resonance.

Q: What volume (in microlitres) of a stock solution of 25% KCl would you need to generate 12.5mL of a…

A: Given that - Percentage concentration of stock KCl Solution = 25% Percentage concentration of new…

Q: Commercial ammonia generally has a mass percent concentration of 25% NH3, which translates to 14.7 M…

A: 25 % NH3 solution has a concentration of 14.7 M . We have to calculate the pH and pOH of a quarter…

Q: 3. A student constructs a galvanic cell that has a strip of iron metal immersed in a solution of…

A: Given: The cell potential is -ve when the positive terminal is attached to the Zn strip and negative…

Q: Based on their respective van der Waals constants, which of these two gases: Xe (a = 4.137 L2 atm…

Q: Chemistry When acetone is used as a mobile phase, a compound is eliminated too quickly from an…

A: The Elimination of compounds Depends upon the solubility of compounds in polar solvents .

Q: 6 CH3(CH2)9CHCH2 7 CH3(CH2)9CCH 1 CH3 H3C-C-0-CH3 8 Straight chain C6H10 CH3 CH3CCH(CH2)16CH3 10…

A: Given compounds are : Identify Alkene, alkyne, alcohol or ether = ?

Q: Q4.Plot equilibrium thermal diagram of Ni-Cu binary alloy complete solubility phase diagram.

A: The complete phase diagram of binary component of Ni-Cu is drawn below.

Q: The theoretical yield of a reaction is 75.0 grams of product and the actual yield is 42.0 g. what is…

A: Given as The theoretical yield of a reaction is 75.0 gram and actual yield is 42.0 g % yield has to…

Q: Identify if the statement is true or false. Show calculations to support your answer. Suppose that…

A: Given :- Molarity of KClO2 (ClO2-) = 0.753 M Ka of KClO2 = 1.1 x 10-2 Molarity of HClO2 = 0.659…

Q: 1. Alcohols may be soluble in water or not 2. Ethers can be explosive when oxygenated 3. In order…

A: We are authorised to solve only first three subparts of a question. Please post rest of the subparts…

Q: For a solution of an indicator (e.g., a weak acid HIn), the color of the solution is determined by…

A: To determine the condition that is valid at Isosbestic point.

Q: Upon successful bromination of an alkene, what is the molecular weight increase of the compound?

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: How many grams of methionine (MW = 149.21) are needed to make 20 mL of a 150 mM solution? What is…

A: a) Given, Molarity of the solution = 150 mM = 0.150 M = 0.150 mol/L Volume of the solution = 20 mL =…

Q: How many grams of potassium permanganate contain 5.48 x 1020 atoms of oxygen?

A: Given: Number of atoms of oxygen in KMnO4 sample = 5.48 × 1020 atoms.

Q: A decrease in pH by 5 implies which of the following? A) The H* concentration increases by a factor…

A: A decrease in pH by 5.

Q: DATA TABLE Calculate the concentration of NH, for each of the unknown samples. Sample #1 Sample #2…

A: Value of Kw = 10-14 Value of Kb = 1.8 × 10-5

Q: OH но NH2 O Ceramide Sphingosine Globoside Sphingomyelin

A: First of all we will draw the structure of all given compound.

Q: HO HOʻ II II IV

Q: Whicj of the following statements are true? which are false? Why is each true or false? a. If a…

A: We are authorised to solve only first three subparts of a question. Please post rest of the subparts…

Q: Hydrogen was collected over water at 21.0°C on a day when the atmosphere pressure was 748.0 Torr.…

A: Given that - Temperature = 21°C = 294 K Atmospheric pressure = 748.0 torr Vapour pressure of…

Q: What causes deficiency of norepinephrine and what happens when norepinephrine levels are low? 2.…

A: Causes deficiency of norepinephrine What happens when norepinephrine levels are The difference…

Q: How much heat (kJ) is released by a 200-gram piece of silver as it cools from 1023°C to 300°C?

A: Given :- Mass of piece of silver (m) = 200 g Initial temperature (T1) = 1023°C Final temperature…

Q: Identify the functional groups of the different organic molecules. Indicate classification is there…

A: f. Alkene functional group is present. (Double bond is present)

Q: 2. Which of the following is a (are) concern(s) related to incomplete combustion? (A) Incomplete…

Q: a) For an ionized He* atom (that is, without one of its electrons), calculate the binding energy…

A: The ion given is He+.

Q: Balance

Q: Calculate the standard enthalpy of vaporization of methylbenzene (see question 1) at the standard…

A: Ans. The standard enthalpy of vaporization is given by rearranging the Claperon equation…

Q: Which of the following statements about a p* antibonding molecular orbital is true? A pi*…

Q: pH

Question

100%

Consider the reaction
2Co3+(aq)+2CII-(aq)→2C02+(aq)+Cl2(g) E°cell=0.71 V
What is the cell potential at 298 K if the concentrations are:
[Co3+]=0.258 M, [Co2+]=0.249 M , and [CI-]=0.523 M
and the pressure of Cl2 is 2.55 bar.
Express your answer to two decimal places.
Ecell
x V
%3D

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1 Electrochemistry

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
From the standard potentials Tl++eTl(s)E0=0.336V TlCl(s)+eTl(s)+ClE0=0.557V calculate the solubility product constant for TlCl.
Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.