Consider the reaction 2CO(g) + 2NO(g)2CO₂(g) + N₂(g) for which AH = -746.6 kJ and AS°= -198.0 J/K at 298.15 K. (1) Calculate the entropy change of the UNIVERSE when 1.514 moles of CO(g) react under standard conditions at 298.15 K. AS universe (2) Is this reaction reactant or product favored under standard conditions? reactant product J/K (3) If the reaction is product favored, is it enthalpy favored, entropy favored, or favored by both enthalpy and entropy? If the reaction is reactant favored choose 'reactant favored'.

Consider the reaction 2CO(g) + 2NO(g)2CO₂(g) + N₂(g) for which AH = -746.6 kJ and AS°= -198.0 J/K at 298.15 K. (1) Calculate the entropy change of the UNIVERSE when 1.514 moles of CO(g) react under standard conditions at 298.15 K. AS universe (2) Is this reaction reactant or product favored under standard conditions? reactant product J/K (3) If the reaction is product favored, is it enthalpy favored, entropy favored, or favored by both enthalpy and entropy? If the reaction is reactant favored choose 'reactant favored'.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section16.3: Measuring Dispersal Of Energy: Entropy

Problem 16.3CE

See similar textbooks

Similar questions

What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
2. Which of the following is true for a spontaneous process but not for a nonspontaneous process? Energy in the universe is concentrated conserved dispersed not conserved
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
What is the second law of thermodynamics? For any process, there are four possible sign combinations for Ssys and Ssurr. Which sign combination(s) always give a spontaneous process? Which sign combination(s) always give a non-spontaneous process? Which sign combination(s) may or may not give a spontaneous process?
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.
10.69 If a sample of air were separated into nitrogen and oxygen molecules (ignoring other gases present), what would be the sign of for this process? Explain your answer. The next four questions relate to the following paragraph [Frank L. Lambert, Journal of Chemical Education, 76(10), 1999, 1385]. "The movement of macro objects from one location to another by an external agent involves no change in the objects' physical (thermodynamic) entropy. The agent of movement undergoes a thermodynamic entropy increase in the process."
Explain why absolute entropies can be measured.
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
It takes 2260 J to vaporize a gram of liquid water to steam at its normal boiling point of 100C. What is H for this process?What is the work, given that the water vaporexpands against a pressure of 0.988atm? What is U for thisprocess?
A 220-ft3 sample of gas at standard temperature and pressure is compressed into a cylinder, where it exerts pressure of 2000 psi. Calculate the work (in J) performed when this gas expands isothermally against an opposing pressure of 1.0 atm. (The amount of work that can be done is equivalent to the destructive force of about 1/4 lb of dynamite, giving you an idea of how potentially destructive compressed gas cylinders can be if improperly handled!)