Consider the reaction: 2NH3 (g) + 202(g) → N₂O(g) + 3H₂O(1) Using standard thermodynamic data at 298 K, calculate the entropy change for the surroundings when 2.45 moles of NH3 (9) rea standard conditions. AS⁰⁰ Substance AH (kJ/mol) NH3 (9) 02 (9) N₂O(g) H₂O(1) surroundings -46.1 0.0 82.1 -285.8 J/K

Consider the reaction: 2NH3 (g) + 202(g) → N₂O(g) + 3H₂O(1) Using standard thermodynamic data at 298 K, calculate the entropy change for the surroundings when 2.45 moles of NH3 (9) rea standard conditions. AS⁰⁰ Substance AH (kJ/mol) NH3 (9) 02 (9) N₂O(g) H₂O(1) surroundings -46.1 0.0 82.1 -285.8 J/K

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter13: Spontaneous Processes And Thermodynamic Equilibrium

Section: Chapter Questions

Problem 46AP

See similar textbooks

Similar questions

Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
Determine the standard Gibbs free energy change, rG, for the reactions of liquid methanol, of CO(g), and ofethyne, C2H2(g), with oxygen gas to form gaseous carbondioxide and (if hydrogen is present) liquid water at298 K. Use your calculations to decide which of thesesubstances are kinetically stable and which are thermodynamically stable: CH3OH(), CO(g), C2H9(g), CO2(g),H2O().
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
Billions of pounds of acetic acid are made each year, much of it by the reaction of methanol with carbon monoxide. (AssumeT= 298 K.) CH3OH() + CO(g) CH3COOH() (a) By calculating the standard Gibbs free energy change, rG, for this reaction, show that it is product-favored. (b) Determine the standard Gibbs free energy change, rG,for the reaction of acetic acid with oxygen to form gaseous carbon dioxide and liquid water. (c) Based on this result, is acetic acid thermodynamicallystable compared with CO2(g) and H2O()? (d) Is acetic acid kinetically stable compared with CO2(g)and H2O()?
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.
The synthesis of glucose directly from CO2 and H2O and the synthesis of proteins directly from amino acids are both non-spontaneous processes under standard conditions. Yet it is necessary for these to occur for life to exist. In light of the second law of thermodynamics, how can life exist?
2. Which of the following is true for a spontaneous process but not for a nonspontaneous process? Energy in the universe is concentrated conserved dispersed not conserved
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
In the thermodynamic definition of a spontaneous process, why is it important that the phrase “continuous intervention” be used rather than just “intervention?”
Explain why absolute entropies can be measured.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)