Consider this equilibrium reaction at 400 K.Br, (g) + Cl, (g) = 2 BrCI(g)Ke = 7.0If the composition of the reaction mixture at 400 K is [BrCI]what is the reaction quotient, Q?= 0.00684 M, [Br,] = 0.00193 M, and [Cl,] = 0.000354 M,%3DHow is the reaction quotient related to the equilibrium constant, K, for this reaction?O0 < K,O 0 > K,0 = K,

The equilibrium reaction taking place is given as, => Br2 (g) + Cl2 (g) ------> 2 BrCl (g)…

Consider this equilibrium reaction at 400 K. Br, (g) + Cl, (g) = 2 BrCl(g) K. = 7.0 If the composition of the reaction mixture at 400 K is [BrCl] = 0.00684 M, [Br,] = 0.00193 M, and [Cl,] = 0.000354 M, %3D %3D what is the reaction quotient, Q? How is the reaction quotient related to the equilibrium constant, K, for this reaction? Oe < K, O e > K. O 0 = K,

Consider this equilibrium reaction at 400 K. Br, (g) + Cl, (g) = 2 BrCl(g) K. = 7.0 If the composition of the reaction mixture at 400 K is [BrCl] = 0.00684 M, [Br,] = 0.00193 M, and [Cl,] = 0.000354 M, %3D %3D what is the reaction quotient, Q? How is the reaction quotient related to the equilibrium constant, K, for this reaction? Oe < K, O e > K. O 0 = K,

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 12.FCP

See similar textbooks

Similar questions

Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
For the given chemical equilibrium, these data are determined experimentally: T K 350K 3.76102 450K 1.86101 Determine H for this reaction.
For the decomposition of Ag2O: 2Ag2O(s)4Ag(s)+O2(g)(a) Obtain an expression for G as a function of temperature. Prepare a table of G values at 100 K intervals between 100 K and 500 K. b) Calculate the temperature at which G =0.
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
The equilibrium constant for a certain reaction decreases from 8.84 to 3.25 102 when the temperature increases from 25C to 75C. Estimate the temperature where K = 1.00 for this reaction. Estimate the value of S for this reaction. (Hint: Manipulate the equation in Exercise 79.)
Consider the system A(g)+2B(g)+C(g)2D(g)at 25C. At zero time, only A, B, and C are present. The reaction reaches equilibrium 10 min after the reaction is initiated. Partial pressures of A, B, and D are written as PA, PB, and PD. Answer the questions below, using LT (for is less than), GT (for is greater than), EQ (for is equal to), or MI (for more information required). (a) PD at 11 min PD at 12 min. (b) PA at 5 min PA at 7 min. (c) K for the forward reaction K for the reverse reaction. (d) At equilibrium, K Q. (e) After the system is at equilibrium, more of gas B is added. After the system returns to equilibrium, K before the addition of B K after the addition of B. (f) The same reaction is initiated, this time with a catalyst K for the system without a catalyst the system with a catalyst. (g) K for the formation of one mole of D K for the formation of two moles of D. (h) The temperature of the system is increased to 35C. PB at equilibrium at 25C PB at equilibrium at 35C. (i) Ten more grams of C are added to the system. PB before the addition of C PB after the addition of C.
The reaction, 3 H2(g) + N2(g) (g), has the fol lowing equilibrium constants at the temperatures given: atT=25°C,K= 2.8 X 104 at T = 500°C, A = 2.4 X IO"7 At which temperature are reactants favored? At which temperature are products favored? YVhat can you say about the reaction if the equilibrium constant is 1.2 at 127°C?
For the reaction C(s)+CO2(g)2CO(g) K=168 at 1273 K. If one starts with 0.3 atm of CO2 and 12.0 g of C at 1273 K, will the equilibrium mixture contain (a) mostly CO2? (b) mostly CO? (c) roughly equal amounts of CO2 and CO? (d) only C?
5.22. True or false: If for a gas-phase reaction, then all equilibrium partial pressures of reactants and products must equal . Explain your choice.
Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the interconversion reaction?
A student studies the equilibrium I2(g)2I(g)at a high temperature. She finds that the total pressure at equilibrium is 40% greater than it was originally, when only I2 was present. What is K for this reaction at that temperature?
12.42 The following reaction is in equilibrium in lake water: HCO,_(aq) + H+(aq)«=*H,CO,(aq) Predict the change in the reaction quotient, Q, for each disturbance below and use that prediction to explain how the equilibrium is shifted by the stress. NaHCOj is added to the lake. H,CO}is added. NaOH is added.