Calculate the standard enthalpy of formation of NaHCO3(s) given the following information:ΔfH°[ CO2(g) ] = −393.41 kJ mol-1, ΔfH° [ NaOH(s) ] = −425.61 kJ mol-1ΔrxnH°[NaOH(s) + CO2(g) ⟶ NaHCO3(s) ] = −127.5 kJ mol-1Construct a diagram depicting ΔrxnH° of the above reaction and the standard enthalpies of formation of the associated products and reactants.

Answered: Image /qna-images/answer/07c77f0e-bb86-4778-9b80-b1082528db31.jpg

Answered: Construct a diagram depicting ΔrxnH° of…

Construct a diagram depicting ΔrxnH° of the above reaction and the standard enthalpies of formation of the associated products and reactants.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section: Chapter Questions

Problem 103QRT

See similar textbooks

Related questions

Q: Calculate the enthalpy of combustion per mole when 4.10 g of methane burns in oxygen and 236 kJ of…

A: Enthalpy of combustion means the heat energy is given out when one moles of any substance completely…

Q: Using thermodynamic data from the Thermodynamic Data table, calculate AG° at 25°C for the process 2…

Q: The change in internal energy of the combustion of solid naphthalene (C10H8) was determined to be…

Q: The standard enthalpy change for the following reaction is 804 kJ at 298 K. TiCl4(l) Ti(s) + 2…

A: The "enthalpy change" always reflects the heat energy which gets out (absorbed) or gets absorbed…

Q: Write the balanced chemical equation for the dissolution of Epsom salts in water showing heat on the…

Q: How much heat is produced by burning 4.00 moles of acetylene under standard state conditions?

A: Moles of acetylene= 4

Q: Calculate the quantity of heat in kJ, associated with a 33.5oC decrease in temperature in: 1. A…

A: Given . Mass of aluminum ( m) = 5.85 Kg = 5.85 × 103…

Q: The standard enthalpy change for the following reaction is -340 kJ at 298 K. AH° -340 kJ 4 Cu(s) +…

A: We know that for a reaction Enthalpy change for a reaction depends on the stoichiometry of a…

Q: Calculate the standard enthalpy of the reaction for the process 3RO(g) → R20(g) + RO2(g) using the…

Q: Calculate the enthalpy of reaction (AH,xn) for the following reaction: P+Q X+Y Given: X-P+RAH=88,1…

A: Hess’s law states that when chemical equations are combined algebraically, their enthalpies can be…

Q: Gibbs Free Energy for Nonspontaneous Reactions and Reactions at Equilibrium Consider the given…

A: Ellingham diagram is graph of standard free energy change versus temperature. More is the negative…

Q: Under certain nonstandard conditions, oxidation by O2(g) of 1 mol of SO;(g) to SO-(3) absorbs 89.5…

A: The oxidation reaction is defined as the reaction in which a chemical species loses electrons.…

Q: Calculate the standard enthalpy change for this reaction: Mg(s) + 2H2O(l) -> Mg(OH)2(s) + 2H2(g)

A: ∆H°=∆Hproduct=∆Hreactant

Q: Given the following heat of formation values, calculate the heat of reaction for the following:…

Q: FeO(s) + 1/4 O2(g) → 1/2 Fe2O3(s) The standard enthalpy of formation of FeO(s) 269 kJ/mole whereas…

A: The given reaction is : FeO(s) + 14O2(g) → 12Fe2O3(s) The standard enthalpy of formation of…

Q: The standard enthalpy change for the following reaction is -763 kJ at 298 K. Ti(s) + 2 Cl2(g)…

A: The enthalpy change for the backward process the equal in magnitude but opposite in sign to the…

Q: The thermochemical equation describing the reaction of HI and Cl₂ at 1000 K is: 2HI (g) + Cl2 (g) →…

A: "To get remaining sub-parts solved please repost the complete question and mention the sub-parts to…

Q: Calculate the standard enthalpy for the reaction: 4NH3(g) + 5O2(g) → 4NO(g) + 6H2O(g), given the…

A: Given;

Q: Calculate the standard enthalpy for the reaction: 4NH3(g) + 5O2(g) → 4NO(g) + 6H2O(g)

A: Let us denote the given reactions by reaction 1,2,3, and 4 from up to down respectively. Now we have…

Q: In terms of bond energies and thermodynamics, why do we (as a society) make so much CO2?

A: Carbon dioxide (CO2) is a greenhouse gas. It is mostly released through human activities. It is…

Q: The standard enthalpy change for the following reaction is -581 kJ at 298 K. Sn(s, white) + O2(g)…

Q: Calculate ∆G (in kJ) at 35.4oC for a reaction that has Keq = 105

A: Given: Temperature = 35.4 oC And Keq = 105

Q: Using the thermodynamic tables and the enthalpy of formation for one mole of potassium chlorate…

Q: Calculate the standard enthalpy for the reaction: 4NH3(g) + 5O2(g) → 4NO(g) + 6H2O(g), given the…

A: Hess's law states that the enthalpy change for an overall reaction is the sum of enthalpy changes of…

Q: Which substance has zero Gibbs free energy of formation? CO2(g) MgO(s)…

A: Gibbs free energy is used to measure the greatest amount of work done in a thermodynamic system when…

Q: Given the enthalpy changes for the following reactions, calculate H0f for CO(g). C (graphite) +…

Q: Calculate the amount of heat transferred when 27.0 g of CH3OH(g) is decomposed by this by 2CH3OH(g)…

A: The balanced chemical reaction is given below.

Q: How does enthalpy relate to the isomerisation process?

A: The explanation is given below

Q: Write a balanced equation for the formation of CO2(g) from C(s) and O2(g). Calculate the enthalpy…

A: Basic concepts: Balanced chemical equation: Balanced chemical equation may be stated as the number…

Q: Calculate the standard enthalpy change for the following reaction at 25 °C. MgCl, (s) + H,O(1)…

Q: Calculate the enthalpy change that occurs when 4.63 g of SnC14 (1) reacts with excess H₂O(l) to form…

A: Here, we have to calculate the enthalpy change that occurs when 4.63 g of SnCl4(l) reacts with…

Q: calculate the reaction enthalpy of this reaction under standard conditions:2HNO2(g)+O2(g)→2HNO3(g)

A: The enthaply of the reaction is calculated as follows,

Q: write the balanced chemical equation for the dissolution of Epsom salts in water showing heat on the…

A: Chemical reactions occur when there is any chemical change. They are written in the form of chemical…

Q: b) Calculate the enthalpy of formation of copper (II) sulphate from the following data: 2Cu(s) +…

A: 1) Cu(s) + O2(g) → 2CuO(s) ∆H° =325 KJ ×122) 2S(s) + 3O2(g) → 2SO3(g) ∆H° = -800 KJ ×123)…

Q: Will the following reaction take place? Explain. NaBr(aq) F20jà

A: Given that : We have to identify whether the following reaction will take place or not :

Q: The standard enthalpy change for the following reaction is 940 kJ at 298 K. TiO,(s) Ti(s) +02(g) AH°…

Q: standard enthalpy

Q: Calculate the standard enthalpy change for the following reaction conducted at 25°C: 2MGO(s)→ 2Mg(s)…

Q: enthalpy

Q: Gibbs free energy of the formation of one mole of pure TiO2 (s) from pure Ti (s) and pure oxygen gas…

A: Solution Gibbs free energy, additionally referred to as the Josiah Willard Gibbs operate, Josiah…

Q: 1. What is the enthalpy of reaction per mole of HCl (g) in the following reaction.( Don't have to…

Q: Heptane (C7H16)(C7H16) is a component of gasoline that burns according to the following balanced…

Q: Given the thermodynamic data in the table below, calculate the equilibrium constant (at 298 K) for…

Q: Calculate the amount of heat absorbed when 100 gaf NO, deomposeit 0 r), N2O3 = 136.02 g/mol 2N,Os…

A: Interpretation- To determine the amount of heat absorbed when 10.0 g of N2O5 decomposes into NO2…

Q: Using a table of thermodynamic data, calculate ΔH rxn for 2SO(g) + 2/3 O_3(g) → 2SO_2(g)

A: The enthalpy change for a reaction is calculated by using following formula.

Q: A thermodynamic equation shows the enthalpy change of a reaction as a reactant or product. True…

A: Given statement is false ∆H means enthalpy change for reaction, it is difference in Enthalpies of…

Concept explainers

Group 14 Elements

The following elements come under group 14 of the periodic table.

Question

Calculate the standard enthalpy of formation of NaHCO3(s) given the following
information:
Δ_fH°[ CO₂(g) ] = −393.41 kJ mol^-1, Δ_fH° [ NaOH(s) ] = −425.61 kJ mol^-1
Δ_r_xnH°[NaOH(s) + CO₂(g) ⟶ NaHCO₃(s) ] = −127.5 kJ mol^-1

Construct a diagram depicting Δ_r_xnH° of the above reaction and the standard
enthalpies of formation of the associated products and reactants.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Data are given in Appendix 1 for white phosphorus, P4(s). P4(g) has the following thermodynamic values: Hf=58.9kJ/mol , S=280.0J/kmol . What is the temperature at which white phosphorus sublimes at 1 atm pressure?
From the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)
Given the thermodynamic data below, calculate the value of the equilibrium constant for the reaction shown at 25.0ºCN₂ (g) + 3 H₂ (g) ⇄ 2 NH₃ (g)ΔHº = -92.22 kJΔSº = -198.59 J/KK = _____ at 25.0ºC
Use the thermodynamic data below to determine the standard free energy change, delta G, at 25C for the reaction: 2O3(g) >>> 3O2(g) Delta H formation O3(g) = 142.7 kj/mol S for O3(g) = 238.93 j/mol.k S for O2(g) = 205.14 j/mol.k Answer is -326kj but I don't know how to work this problem
If the change in enthalpy, ∆Horxn for Cd (CN)2 (s) is -162.2 kJ and the Change in Entropy, ∆Sorxn is 104.2 J/K, at what temperature will this reaction be exactly at equilibrium? (hint: What does ∆Gorxn equal at equilibrium?)
Give G°rxn for the give. reactions at 25 degree celsius.
The standard enthalpy change for the following reaction is 804 kJ at 298 K. TiCl4(l) Ti(s) + 2 Cl2(g) ΔH° = 804 kJ What is the standard enthalpy change for this reaction at 298 K?Ti(s) + 2 Cl2(g) TiCl4(l) kJ_____________
Calculate the standard enthalpy change (in kJ) for the following reaction
Calculate ∆G (in kJ) at 35.4oC for a reaction that has Keq = 119
A reaction has a standard free‑energy change of −18.20 kJ (−4.350 kcal mol−1). Calculate the equilibrium constant for the reaction at 25 °C. Keq =
Acetylene gas, C2H21g2, is used in welding. What is the maximum amount of useful work that can be accomplished under standard conditions by this reaction?
Calcium carbonate is insoluble in water. Yet, it dissolves in an acidic solution. Calculate the standard enthalpy, entropy, and Gibbs free energy change for the reaction between solid calcium carbonate and hydrochloric acid. What drives the reaction, the enthalpy change, or the entropy change?