Construct the expression for Kp for the following reaction. CC:(g) = C(s) + 2 Cl(g) 1 Drag the tiles into the numerator or denominator to form the expression. Each reaction participant must be represented by one tile. Do not combine terms. Kp %3D 5 RESET PC. 2(Рсс.) (PCCı)? Pc 2(Pc) (Pc)? PCh 2(Рсь) (PCL)?

Construct the expression for Kp for the following reaction. CC:(g) = C(s) + 2 Cl(g) 1 Drag the tiles into the numerator or denominator to form the expression. Each reaction participant must be represented by one tile. Do not combine terms. Kp %3D 5 RESET PC. 2(Рсс.) (PCCı)? Pc 2(Pc) (Pc)? PCh 2(Рсь) (PCL)?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section12.5: Using Equilibrium Constants

Problem 12.7CE

See similar textbooks

Similar questions

Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the interconversion reaction?
Write the mathematical expression for the reaction quotient, QC, for each of the following reactions (a) N2(g)+3H2(g)2NH3(g) (b) 4NH3(g)+5O2(g)4NO(g)+6H2O(g) (C) N2O2(g)2NO2(g) (d) CO2(g)+H2CO(g)+H2O(g) (e) NH4CI(s)NH3(g)+HCI(g) (f) 2Pb( NO3)2(s)2PbO(s)+4NO2(g)+O2(g) (g) 2H2(g)+O2(g)2H2O(g) (h) S8(g)8S(g)
What are homogeneous equilibria? Heterogeneous equilibria? What is the difference in writing K expressions for homogeneous versus heterogeneous reactions? Summarize which species are included in the K expression and which species are not included.
Kc = 5.6 1012 at 500 K for the dissociation of iodine molecules to iodine atoms. I2(g) 2 I(g) A mixture has [I2] = 0.020 mol/Land [I] = 2.0 108 mol/L. Is the reaction at equilibrium (at 500 K)? If not, which way must the reaction proceed to reach equilibrium?
An experimenter places the following concentrations of gases in a closed container: [NOBr] = 7.13 102 M, [NO] = 1.58 102 M. [Br2] = 1.29 102 M. These gases then react: 2NOBr(g)2NO(g)+Br2(g) At the temperature of the reaction, the equilibrium constant Kc is 3.07 104. Calculate the reaction quotient, Qc, from the initial concentrations and determine whether the concentration of NOBr increases or decreases as the reaction approaches equilibrium. a Qc = 6.33 104; the concentration of NOBr decreases b Qc = 6.33 104; the concentration of NOBr increases c Qc = 1.58 104; the concentration of NOBr increases d Qc = 4.65 104; the concentration of NOBr decreases e Qc = 4.65 104; the concentration of NOBr increases
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
For the reaction N2(g)+3H2(g)2NH3(g) show that Kc = Kp(RT)2 Do not use the formula Kp = Kc(RT)5n given in the text. Start from the fact that Pi = [i]RT, where Pi is the partial pressure of substance i and [i] is its molar concentration. Substitute into Kc.
For which reactions in Exercise 34 is Kp equal to K?
Write the mathematical expression for the reaction quotient, QC, for each of the following reactions: (a) CH4(g)+CI2CH3CI(g)+HCI(g) (b) N2(g)+O2(g)2NO(g) (c) 2SO2(g)+O2(g)2SO3(g) (d) BaSO3(s)BaO(s)+SO2(g) (e) P4(g)+5O2(g)P4O10(s) (f) Br2(g)2Br(g) (g) CH4(g)+2O2(g)CO2(g)+2H2O(l) (h) CuSO45H2O(s)CuSO4(s)+5H2O(g)
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
Fluorine, F2, dissociates into atoms on heating. 12F2(g)F(g) The value of Kp at 842C is 7.55 102 What is the value of Kc at this temperature?
The atmosphere consists of about 80% N2 and 20% O2, yet there are many oxides of nitrogen that are stable and can be isolated in the laboratory. (a) Is the atmosphere at chemical equilibrium with respect to forming NO? (b) If not, why doesnt NO form? If so, how is it that NO can be made and kept in the laboratory for long periods?