Copper(II) ions form a complex ion in the presence of ammonia [Cu(NH3)4 2+] [Cu2*(ag)][NH3]4 Cu²*(aq) + 4NH3(aq) = Cu(NH3)4²*(aq) Kc = 5.0x 1013 If 0.010 mol Cu2+ is added to 1.00 L of a solution that is 1.00 M NH3 what are the concentrations when the system comes to equilibrium?

Q: Which statement regarding the complex given below with M = Co is incorrect? (27Co) A. Two ions are…

A:

Q: (a) In early studies it was observed that when the complex [Co(NH3)4Br2]Br was placed in water, the…

A: Isomerism in coordination complexes in which one of ligand molecule is replaced by a solvent…

Q: What is the name of the complex ion Fe(C,04)?

A: We are to write the IUPAC name for complex ion Fe(C2O4)3–3

Q: Determine whether the complex ion [Fe(H2O)4Br2]+ can form geometric isomers.

A: Metal complexes that differ only in which ligand are adjacent to one another(cis) or directly across…

Q: 3. Assuming that each of the following compounds contains an octahedral complex ion, which compound…

A: (A) Co(NH3)Cl3

Q: Consider the coordination compound [Fe(NH3)2(en)2]Cl3 and select the FALSE statement below. a) the…

A: Complex is the one which contain the central metal atom surrounded by definite number of ligands…

Q: Given the complex, [Rh(en)2(NO2)2]NO2 1) Name it. 2) What is the oxidation state of the metal? 3)…

A:

Q: Which of the following complex ions is paramagnetic? A) [ZnCl.] B) [Fe(H2O)s]2- (H2O is weak field…

A: ANS. Option B) [Fe(H2O)6]+2

Q: Consider the complex ion [Co(en)2(SCN)Cl]+     (a) identify the ligands and their charges   (b)…

A: Ligands are those species that bind with Central metal atom to form a coordination complex.…

Q: The following questions refer to the following system: 500.0 mL of 0.020 M Mn(NO3)2 are mixed with…

A:

Q: Pt(II) can occur in the complex ion [PtCl4]2¯.   a. What is the geometry of this ion? b. What is…

A: Note: According to the rules we can answer only first three parts. Pls repost others. Given:…

Q: R CH, CHa NH H,C NH CH, CH, HN CHa "CHa HC он

A: This structure is of Coenzyme Vit B12. Vitamin B12 is the most chemically complex of all the…

Q: What is the formula for the complex ion pentaammineaquaruthenium(III) ?

A: The given complex ion is = pentaammineaquaruthenium(III) The formula of the complex ion =?

Q: What is the charge of Cu in the complex [Cu(H2O)2(CO3)CI] ?

A:

Q: 1. The complexes ions of [Cu(H20)6]²+ and [Cu(NH3)4]2+ appear a pale shade of blue and a darker…

A: At the point when ligands append to a transition metal to shape a coordination complex, electrons in…

Q: Of the following complex ions, the one with probably the highest formation constant will be: (a)…

A: Given complexes,              a. [Co(en)3]3+(en represents ethylenediamine)              b.…

Q: How can you distinguish cis- and trans- form of K [Cr(C,O,)2(H,O);] complex by experimentally.

A: Cis- and trans- form of K[Cr(C2O4)2(H2O)2] complex can be distinguishes experimentally, by following…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which there is a metal ion that forms coordinate bonds with…

Q: Iron (III) ions and thiocyanate ions react to form a complex ion according to the following…

A: The equilibrium reaction taking place is given as, => Fe3+ (aq) + SCN- (aq) -----> FeSCN2+…

Q: Crystals of hydrated chromium(III) chloride are green,have an empirical formula of CrCl3 . 6 H2O,…

A: In the compound, the complex ion is shown below.

Q: Which of the following pairs of complex ions are examples of linkage isomers?   [Fe(CO)5NO2]2+ and…

A: We have to choose the following given pairs of complex ions are examples of linkage isomers among…

Q: Determine whether the complex ion [Ti(CO)3(NH3)3]2+ can form geometric isomers.   On your work…

A: Since it is of the the type Ma3b3 where M is the metal and a and b are ligands, this can form both…

Q: Une way in which the stoichiometry of a complex ion can be determined is by measuring the color…

A:

Q: Identify the ligands in the following complex ions.   [AlCl4] -          [Cu (NH3)4]2+…

A: From given  Ligand calculation is done for all the given complexes and free ion of AlF4- is…

Q: 2) Using the stepwise formation constants given, calculate the net formation constant for the…

A: The stepwise complexation of Cu2+ and en (H2NCH2CH2NH2) are -                                 Cu2+ +…

Q: The equilibrium constant Ka for the reaction Co(H2O)63+ (aq) + H2O (l) ---> Co(H2O)5(OH)2+ (aq) +…

A: The pH of the solution can be calculated as follows-

Q: Which of the following complex ions is paramagnetic? A) [ZnCl4]? B) [Fe(H2O)6]²* (H2O is weak field…

A: FeCH2O62+   Fe2+=3d6   E of Fe2+=(2g4 eg2)    (paramagnetic)

Q: Which statement regarding the complex given below with M = Co is incorrect? (27Co) A. Two ions are…

A: Given Complex is [ M (en)2 Cl (ONO) ] Cl, where M = Co, and atomic Number of Cobalt, Co is 27.   (A)…

Q: Like many other complex ions, the formation of complexes between tin (II) cation and hydroxide…

A: We need to find the concentration of Sn2+ at equilibrium

Q: In 2001, chemists at SUNY-Stony Brook succeeded in syn-thesizing the complex trans-[Fe(CN)4(CO)2]2-,…

A: Co-ordination compounds are formed when the metal ion is bonded to the ligand which donates its…

Q: 1.) What are the oxidation states of the atoms in the following complex ions: (a) CO, (b) Cd(OH),,…

A:

Q: The oxidation state of cobalt in the complex Mg2[COF6] is: 1 a. +4 b. +1 C. +2 d. +3 If the specific…

A: 1. Each Mg and F has +2 and -1 charge respectively.  That's why : 2(+2)+x+6(-1) = 0  Or, x = +2…

Q: Which of the following complex ions has geometric isomers? explain a) [Co(NH3)6]³+ b) [Co(en)3]³+ c)…

A: For geometrical isomerism all the ligand should not be same.

Q: a) Calculate the concentration of Zn+2 in a 0.01 M solution of Zn(NO3)2 and containing an added NH3…

A: Zn2+ + 4NH3 ⇌ [Zn(NH3)42+] It is the overall reaction equation.Now, moles of Zn = 0.01As per the…

Q: 2. Pt* forms a complex with two ammonia molecules, one SCN and a Cl ion. a) What is the formula and…

A: Answer: To form a complex, ligands donate their lone pairs in the vacant orbitals of central metal…

Q: What is the name of the complex ion Fe(C,04);?

A: Naming of complex ions

Q: When oxalate (chemical formula: C₂04²; ligand abbreviation: ox) is added to an aqueous solution of…

A: Oxalate C2O42- is a bidentate ligand whereas H2O is a monodentate ligand. Therefore during reaction…

Q: Reacting Cr(CO)6 with a 2 molar equivalent of PPh; produces a disubstituted chromium complex…

A: Cr(CO)6 +2 PPh3 ---> [Cr(CO)4(PPh3)2] [Cr(CO)4(PPh3)2] this compound can exist as cis and trans…

Q: The formation constant of a silver cyano complex is 5.6 x 1018 Ag+ + 2 CN' Ag(CN)2 If a certain…

A: Given- Concentration of Ag+=5.0×10-3M Concentration of CN-=0.20M  The formation constant of silver…

Q: chain theory, the complex compound K2[CrCO(CN)5] is an electrolyte by releasing A. 2 K+ ions B. 1…

A: We have to tell which option is correct from given choices of options by telling how given compound…

Q: A ligand, [2,4-ditert-butyl-6-{[(2-pyridyl)ethyl](2-hydroxybenzyl)- new aminomethyl}-phenol, was…

A:

Q: Consider the complex ion [Co(en)2(SCN)Cl]+ a. Identify the ligands and their charges. b. What is the…

A: The complex is  [Co(en)2(SCN)Cl]+ . a. Ligands : 1. en (ethylenediamine)  , Charge is 0. 2.SCN…

Q: Determine the equilibrium concentration of the complex ion formed by a solution with 10.0 mL of…

A: Each FeCl3 forms 1 Fe3+(aq). mmoles of FeCl3 or Fe3+(aq) ions initially taken = C*V = 0.100 molL *…

Q: Answer the following questions about the following coordination complex: [Co(en)2Cl2]Cl a) Provide…

A: Answer - Coordination  complex - A coordination complex is the product of a Lewis acid-base…

Q: REASsighment/takeCovalentActivity.do?locator=assignment-take [References) Cu ions from copper(II)…

A: On heating, blue colour turns to yellow. This means tetra aquacopper complex(blue) transfered to…

Q: Given [Cu(CN)4]3-   What is the name of the complex ion and its coordination number?

A: Complex = [Cu(CN)4]3-  In this complex, Cu is present in +1 oxidation state. It is anionic complex

Q: What is the concentration of Cu2+ in a solution of the complex ion Cu(NH3)42+ formed by reaction of…

A:

Q: How is a complex ion a Lewis adduct?

A: Solution -   A Lewis acid is that can accept a pair of electrons,any species .and a Lewis base is…

Q: The coordination complex, [Fe(CN)5(NO)]2", displays linkage isomerism. Draw the structural formula…

A: Given as  The complex [Fe(CN)5(NO]2- shows linkage isomerism. The structural formula of the complex…