correct IUPAC name for Cr₂O₃?

Q: What is the IUPAC name of C4H3? Provide brief explanation.

A: Given        Formula    =  C4H8 IUPAC Name   =   ?

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: What is the correct IUPAC name for Na₂CrO₄ · 5H₂O?

A: The compound given is Na2CrO4·5H2O.

Q: What is the correct IUPAC name for P4S3?

A: The IUPAC nomenclature is defined as the method that involves the naming of the organic compound…

Q: What is the IUPAC name of C4H8? Provide brief explanation.

A: It is a hydrocarbon and follow formula CnH2n+2 which is general formula for alkane

Q: What is the correct IUPAC name for K₂O

A: The given compound is an ionic (formed by ionic bonds) binary compound because it is formed of two…

Q: Give the IUPAC name of the unknown compound CH3 H3C CH3

A: See below

Q: What is the correct IUPAC name for CsHSO₃?

A: Ionic compounds are formed when cations (positively charged ion ) combines with anion ( negatively…

Q: Al(C2H3O2)3

A: The compound contains aluminium metal in 3+ state, that is Al3+ and three acetates (CH3COO- ) group.…

Q: ID

A:

Q: Find the common name and IUPAC name 1. C3H8O 2. C2H5OH

A: IUPAC names follow an internationally accepted set of rules, and all the chemical compounds get a…

Q: IUPAC name

A: The given compound can be numbered as follows, Parent carbon chain         -             octane…

Q: what is the IUPAC name of this molecule?

A: To find: The IUPAC name of the molecule

Q: IUPAC name o

A:

Q: Provide the correct IUPAC name for S2Cls.

A: Write IUPAC name of S2Cl8 ?

Q: What are the IUPAC names of the following?

A:

Q: What is the IUPAC name and type of isomer of the compound given below?

A: The above compound can be represented as :

Q: correct IUPAC name

A: A question about nomenclature, which is to be accomplished.

Q: What is the IUPAC name of the following substance? CH3C=CCH3

A:

Q: Provide the correct IUPAC name for S2Cl8

A:

Q: What is the IUPAC name of this molecule? но H3C CH3 CH3

A:

Q: What is the IUPAC name of (C2H5)2O:

A:

Q: what is the IUPAC name of the picture below

A:

Q: What is the IUPAC name of the following molecule?

A: Organic compounds are the compounds which are mainly composed C and H atoms. The branch of chemistry…

Q: What is the IUPAC name of this molecule?

A:

Q: What is the correct IUPAC name for S2F8?

A: The compound given is S2F8 which is formed between non metal S and non metal F. Hence the compound…

Q: What is the correct IUPAC name for ClF₃?

A: Given molecular formula,        ClF3

Q: What is the correct IUPAC name for V(NO₂)₂?

A: The given compound isNon-ionic coordination compoundV(NO2-)2 where     V→Central metal…

Q: 10b. Label the functional groups (there are only 3 different functional groups - no need to repeat…

A: Common or trivial name of some unique molecules are given as per it's alike shape. It might be…

Q: Give the IUPAC name for attached compound

A: IUPAC name is a systematic approach taken for the nomenclature of compounds as per the…

Q: The IUPAC name of the compound below is

A: 9

Q: IUPAC NAME.

A:

Q: он CH2 CI

A: Numbering will be anticlockwise becuase Cl is near to OH  it is given by prority order of…

Q: Name the following using IUPAC nomenclature. CI

A: IuPAC name should be assigned by following some rules.

Q: IUPAC name is

A:

Q: CH3 -NH2

A:

Q: IUPAC name fo

A:

Q: IUPAC name of

A: IUPAC name of the compound can be shown in below

Q: What is the correct IUPAC name for MnF₃?

A: MnF3 is an ionic compound with cation Mn3+ and anion F-  Mn is in 3+ oxidation state because there…

Q: What is the correct IUPAC name for SiCl4?

A: The compound given is covalent compound SiCl4  Covalent because the both atoms in the compound are…

Q: a) what is the IUPAC name for Cr2CO3 b) what is the IUPAC name for CuF2 . 2H2O

A: The name of an ionic compound is written as follows: First, write the name of the cation, if the…

Q: 13 CH3

A:

Q: What is the correct IUPAC name for Cl₂O₇?

A: The most accepted name of a chemical compound is governed by IUPAC. The IUPAC name is governed by a…

Q: What is the correct IUPAC name for Pb(CN)₄?

A: What is the correct IUPAC name for Pb(CN)₄?

Q: O

A:

Q: IUPAC name of the following

A: The IUPAC name of first compound is 2,2-dimethylpropane and the IUPAC name of second compound is…

Q: ect IUPAC name fo

A:

Q: What is the correct IUPAC name for IrF₃?

A: To write the correct IUPAC name for IrF3

Q: O2N. NO2

A:

Q: name the following molecule with the correct IUPAC name

A: In nomenclature, the IUPAC nomenclature of chemistry is a method of naming organic chemical…