What is the IUPAC name of C4H8? Provide brief explanation.

Q: What is the IUPAC name of C4H3? Provide brief explanation.

A: Given        Formula    =  C4H8 IUPAC Name   =   ?

Q: What is the correct IUPAC name for Na₂CrO₄ · 5H₂O?

A: The compound given is Na2CrO4·5H2O.

Q: What is the correct IUPAC name for P4S3?

A: The IUPAC nomenclature is defined as the method that involves the naming of the organic compound…

Q: C2H5CHCHCN

A:

Q: What is the IUPAC name for the compound shown in the image?

A: The given compound is saturated hydrocarbon and has a ring structure with 5 carbon atoms. Since it…

Q: Provide the IUPAC name of the compound shown below. OCH,CH, OCH,CH, Spell out the full name of the…

A:

Q: Draw all isomers of C4H9Br and name them using IUPAC convention.

A: Isomers  Isomers can be defined as the compound having the same molecular formula but different…

Q: ID

A:

Q: 3. o Q CH3CO CCH3 + НОН

A: Hydrolysis of anhydrides gives carboxylic acids.

Q: Give the different isomers formed by C5H8 along with their IUPAC name.

A: Isomers of any chemical compound are the molecules which have the same molecular formula but a…

Q: IUPAC name o

A:

Q: A. SUPPLY THE MISSING DATA.WRITE THE CORRECT CONDENSED STRUCTURAL FORMULA AND GIVE THE IUPAC…

A: The given reaction is a famous one and is called sodalime decarboxylation in this the -COOH group is…

Q: IUPACC NAMES

A: The IUPAC names of the given compounds are as follows:

Q: What is the IUPAC name of the following substance? CH3C=CCH3

A:

Q: CO7T01Q5547 Give the IUPAC name for the following compound:

A: Organic compounds are the compounds which are mainly composed C and H atoms. The branch of chemistry…

Q: Give complete iupac name 2&3

A:

Q: IUPAC Nomenclature. IUPAC name of the following compounds

A: Since you have posted a  question with sub-parts , we are entitled to answer the first three…

Q: What is the IUPAC name of this molecule? но H3C CH3 CH3

A:

Q: Provide the correct IUPAC name for SnS₂

A: The IUPAC name for SnS₂   = Tin (IV) Sulfide

Q: What is the IUPAC name of (C2H5)2O:

A:

Q: what is the IUPAC name of the picture below

A:

Q: Give the IUPAC name of the following compound: CH3CH2CHBrCHClC(CH3)2CH2CH3

A: There are certain rules to find out IUPAC name: Assigning parent chain for the compound. Longest…

Q: NH2 CH, CH,

A: IUPAC rules have been worldwide used for the nomenclature of organic and inorganic compounds.

Q: What is the correct IUPAC name for S2F8?

A: The compound given is S2F8 which is formed between non metal S and non metal F. Hence the compound…

Q: IUPAC name c

A:

Q: What is the correct IUPAC name for ClF₃?

A: Given molecular formula,        ClF3

Q: CH3

A: IUPAC stands for International Union of Pure and Applied Chemistry. IUPAC nomenclature follows a…

Q: Give the IUPAC name for attached compound

A: IUPAC name is a systematic approach taken for the nomenclature of compounds as per the…

Q: с. Name: H3CO-= =OCH3

A:

Q: Provide the IUPAC name for (CH3)2CHC=CCH2C(CH3)3.

A: To write the IUPAC name of an unsaturated hydrocarbons, we have to select the longest chain. Longest…

Q: 2. What is the IUPAC name of this molecule? H3C CH3

A: In given compound,  a ring of 5 carbon is present. -C=O functional group is present which is known…

Q: correct IUPAC name for Cr₂O₃?

A: IUPAC put forth some guidelines that must be followed while naming the compounds. It is an…

Q: What is the correct IUPAC name for SiCl4?

A: The compound given is covalent compound SiCl4  Covalent because the both atoms in the compound are…

Q: OH но е. OCH3

A: Interpretation-  To write the IUPAC name of the given compound -    Concept -  When we write the…

Q: Give the IUPAC name for the following compound. CH3C = CCH2C(CH3)3

A: The name of the given compound is

Q: a) what is the IUPAC name for Cr2CO3 b) what is the IUPAC name for CuF2 . 2H2O

A: The name of an ionic compound is written as follows: First, write the name of the cation, if the…

Q: Write IUPAC name of the following compound: (CH3CH2)2NCH3

A: The given compound is an example of amine. Generally, there are three kinds of amines. Primary…

Q: IUPAC name and name of the structure (CH33)CH(CH33)CH22C≡CH

A: IUPAC nomenclature of organic chemistry is a method of naming organic chemical compounds as…

Q: What is the correct IUPAC name for Cl₂O₇?

A: The most accepted name of a chemical compound is governed by IUPAC. The IUPAC name is governed by a…

Q: ne IUPAC name

A:

Q: Write the IUPAC name of the following compound: (CH3)2N-CH2CH3

A: Given compound: (CH3)2N-CH2CH3 To find: The IUPAC name of the given compound

Q: O

A:

Q: Give the IUPAC name for the following molecule. CH2 CH2

A: The given compound can be numbered as follows,

Q: (C2H5)2CHNO2

A: IUPAC ( international union of pure and applied chemistry) nomenclature is a method for naming of…

Q: Write the IUPAC name of the molecule shown below.

A: The IUPAC name of the given molecule has to be provided. The given molecule is,

Q: Me Me

A: Write IUPAC name of the given above structure--

Q: Provide the correct IUPAC name for As2S5

A:

Q: IUPAC Naming Instructions: Name: CH3

A: