determine the chemical formula created when calcium (20) bonds with the polyatomic ion hydrogen phosphate.

Q: what is the chemical formula created when sodium (11) bonds with the polyatomic ion chromate?

A: The chemical formula for a compound consisting of a cation Am+ and an anion Bn- can be written like…

Q: What solid would form when phosphoric acid (H:PO4) is added to milk of magnesia (Mg(OH):)? A) MgO B)…

A: Consider the given reaction of phosphoric acid with milk of magnesia is as follows; H3PO4    +…

Q: Identify the molecule that is the source of oxygenatoms for O 2 production during photosynthesis.

A: Identify the molecule that is the source of oxygen atoms for O2 production during photosynthesis.

Q: plain why the mobility on an ion might increase with ionic radius even though the mobility is…

A:

Q: What kind of chemical reaction occurs when lime and carbon dioxide lead to the formation of calcium…

A: When lime react with carbon dioxide the reaction occurs as., CaO + CO2 ---> CaCO3

Q: What type of chemical bond is present in the Cl2 molecule

A: There is covalent bond in Cl2 molecule.

Q: What forms when the oxides of pollution react with water? O acid rain O carbon dioxide O kerogen

A: The sulphur oxides and nitrogen oxides are common oxides which causes pollution.

Q: Write chemical equations for the following singlereplacementreactions that might occur in water. If…

A: Single replacement reaction: In this reaction, one of element which is more reactive then other…

Q: A new salt is made with the element Hampshrium (Hp 2+) and the polyatomic ion Whippurate (WhOH 3-).…

A: We have a salt having cation Hp+2 and anion WhOH3- . We have to predict the formula for the salt.

Q: Calculate the percent of water in Ca3(PO4)2 x 22 H2O

A: We calculate molar mass of Ca3(PO4)2x 22 H2O and also for 22H2O then find the percentage .

Q: compare the reaction of barium hydroxide and sulfuric acid with the reaction of potassium hydroxide…

A: The reaction of barium hydroxide and sulfuric acid is:

Q: What is the balanced equation of NAOH neutralizes nitric acid to form water and sodium nitrate

A: Acid reacts with base to form salt and water. This reaction is known as neutralization reaction.…

Q: 1. Based on the balanced chemical equation for the preparation of malachite, what is the composition…

A: The balanced chemical equation for the formation of malachite given is:…

Q: what is the chemical formula created when aluminum (13) bonds with the polyatomic ion hypochlorite?

A: Aluminium has an atomic number 13 which reacts with polyatomic ion such as hypochlorite ion ClO- to…

Q: Write equations showing the stepwise ionization of phosphorous acid.

A:

Q: K/U Under what two conditions car an ionic compound conduct an electric curren ?

A: Ionic compounds : These are the compounds which are made up of ions in which are positively charged…

Q: Dissolved oxygen in water is in the form of O a. Uncombined O2 molecules O b. Oxygen in carbon…

A:

Q: What is the energy change when the temperature of 10.7 grams of solid chromium is decreased from…

A: Solution:- Given data => mass of solid Chromium = 10.7 g Initial temperature = 37.2 0C  Final…

Q: What is the maximum wavelength of light, in nanometers, that has enough energy per photon to…

A: Bond dissociation energy: The energy required to break the chemical bond in a molecule is called…

Q: What is the expected electrical conductivity of the following solutions?(a) NaOH(aq)(b) HCl(aq)(c)…

A: A good electrolyte solution is when the substance dissolved in water to form its respective ions…

Q: How does calcium chloride remove water vapor?

A: Calcium chloride compound is used to absorb the water vapours and remove the water molecules from…

Q: How many grams of lithium oxide must be carried on board to remove 80.0 kg of water?

A: Given, The amount of water = 80 Kg The chemical reaction of lithium oxide and water is; Li2O(s) +…

Q: how many grams of oxygen are required to react with 10.0 g of C2H6

A:

Q: n/takeAssignment/takeCovalentActivity.do?locator=assignment-take Review Topica) [References) Use the…

A:

Q: What mass of water can be produced from 10.0 g of hydrogen gas? O 10.0 g 18.0 g O 45.0 g 90.0 g None…

A: This problem can be solved via Stoichiometry and finding  out moles of Hydrogen .

Q: How many ammonia molecules must react to produce 1.25 kg of ammonium sulfate?

A: The formation of ammonium sulfate will take place when 2 moles of ammonia will react with 1 mole of…

Q: what is the chemical formula for sodium astatide

A: The existence of atoms of a compound and its proportions is represented as its chemical formula. In…

Q: what is the chemical formula created when thallium (81) bonds with the polyatomic ion silicate?

A: We know that silicate is  SiO4-4 and thallium is Tl+3 In formation of compound charge is it transfer…

Q: Is iodine monochloride in solid form conductive with respect to electrical conductivity? Why or why…

A: Iodine monochloride is a Black solid. Iodine monochloride is polar in nature due to…

Q: Van der Waals bonds occur in many molecules, but hydrogen bonds occur only with materials that…

A: Atoms are held together in a molecule because of some attractive and repulsive forces. These forces…

Q: 4. The chemical formula for sodium nitride is

A:

Q: The ionic radi of calcium and sodium ions are similar. Which compound has weaker ionic attractions,…

A: Lattice energy :-  The amount of energy released when one mole of an ionic solid is formed from its…

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: Whare are the aluminum oxide and magnesium oxide used?

A: The major uses of specialty aluminium oxides are in refractories, ceramics, polishing and abrasive…

Q: Which of the following has the largest covalent radius ?   Mg Ca Sr Ba

A: Covalent radius of an element is defined as the half of the internuclear distance between two atom…

Q: determine the chemical formula created when magnesium (12) bonds with the polyatomic ion phosphite.

A:

Q: Which ions are responsible for making water hard?

A: There are two types of water, based on the minerals present in the water. Hard water: Hard water…

Q: At 300 k the lattice constant for germaninum a is 3.11å.Calculate the number of Germanium atoms per…

A: Given:  The lattice constant, a= 3.11å The molar mass of Ge, M = 72.64 g/mol Avogadro's number, NA =…

Q: Write balanced chemical equations to show the reactions of the following elements with cold water.…

A: The answer to.the following question is-

Q: Write a balanced equation for the fusion of KI ,NaBr and CaCl2

A: In this question we have to write down the balanced chemical equation of given species by the help…

Q: Write chemical equations for each of the following chemical and physical processes: (a)…

A: When an acid reacts with a base to form salt and water, known as neutralization reaction.

Q: What makes diamond one of the strongest materials known by scientists

A: Diamond is one of the hardest and strongest element present on earth . It is just because of…

Q: H2O 2. HCHO 12)__ Evaporate

A: When aqueous Solution of formaldehyde is evaporated to dryness following product is formed

Q: >Magnesium ions are removed in water treatment by the addition of slaked lime, Ca(OH)2. Write a…

A: Presence of magnesium ions in water is responsible for the hardness of water. So, during water…

Q: Which of the following compounds has the highest boiling point? Не Li Be B. Ne 14 17 Na Mg Al Si ci…

A: Answer:- This question is answered by using the simple concept of boiling point which depends on the…

Q: What are the products of the reaction between solid copper and aqueous magnesium sulfate (MgSO4)?

A: ANSWER

Q: What is the theoretical mole ratio of sodium carbonate deca-hydrate to sodium chloride? O 1:2 O 1:1…

A: Sodium carbonate is a white solid which crystallizes as sodium carbonate deca-hydrate Na2CO3·10H2O.