what is chemical formula created when calcium (20) bonds with the polyatomic ion hydrogen phosphate.

Q: what is the chemical formula created when sodium (11) bonds with the polyatomic ion chromate?

A: The chemical formula for a compound consisting of a cation Am+ and an anion Bn- can be written like…

Q: Identify the molecule that is the source of oxygenatoms for O 2 production during photosynthesis.

A: Identify the molecule that is the source of oxygen atoms for O2 production during photosynthesis.

Q: Draw 3 molecules of CH3CH2OH (ethyl alcohol) using Lewis Structure/Kekule Formula. Identify the…

A: Given,  Draw 3 molecules of CH3CH2OH (ethyl alcohol) using Lewis Structure/Kekule Formula. Identify…

Q: heat of vaporization

A: The heat of vaporization is defined as the amount of heat needed to turn 1g of a liquid into a…

Q: Evaluate the effects of nitrogen and phosphorus from agricultural activities to the water bodies

A: The substance (natural/synthetic) that is supplied to the plants externally in order to provide an…

Q: How many grams of O2 are produced in the decomposition of 54 g of water?  Start with a balanced…

A: Water is decomposed into oxygen and hydrogen. The equation for the balanced chemical reaction is as…

Q: Select all intermolecular forces that contribute to creating a solution of HCI in CH3CN. O H-bonding…

A: What intermolecular forces acting a solution of HCl in CH3CN ?

Q: Nature of particle,type of particle and type of intermolecular or interatomic force between the…

A: Given,  Particles  of water, ethanol, methylated spirit,sodium  chloride, Iodine  and potassium…

Q: Calculate the percent of water in Ca3(PO4)2 x 22 H2O

A: We calculate molar mass of Ca3(PO4)2x 22 H2O and also for 22H2O then find the percentage .

Q: What types of intermolecular forces are occurring between sodium dodecyl sulfate and water ?

A: sodium dodecyl sulfate structure is  CH3(CH2)11OSO3- Na+

Q: What is the balanced equation of NAOH neutralizes nitric acid to form water and sodium nitrate

A: Acid reacts with base to form salt and water. This reaction is known as neutralization reaction.…

Q: 9. Which of the following interactions are the strongest? * O ion-ion interactions O hydrogen…

A:

Q: 1. Based on the balanced chemical equation for the preparation of malachite, what is the composition…

A: The balanced chemical equation for the formation of malachite given is:…

Q: 18. How do you determine the molecular shape of the portion of the molecule where carbon, whose…

A:

Q: what is the chemical formula for disodium ammonium phosphate ?

A: SOLUTION Valency of sodium (Na) is +1. Valency of ammonium ion (NH4 + ) is +1. Valency of phosphate…

Q: Write equations showing the stepwise ionization of phosphorous acid.

A:

Q: Dissolved oxygen in water is in the form of O a. Uncombined O2 molecules O b. Oxygen in carbon…

A:

Q: Which of the following is a covalent compound ? A 4.22 mol sample of Ar has a pressure of 1.21 atm…

A: Using ideal gas equation, volume of the argon gas can be calculated. PV=nRT here P = pressure of the…

Q: .Identify the type of intermolecular force of attraction described in each of the following numbers:…

A: The forces of attraction or repulsion that operate between the particles are known as intermolecular…

Q: How does calcium chloride remove water vapor?

A: Calcium chloride compound is used to absorb the water vapours and remove the water molecules from…

Q: Sodium carbonate (Na2CO3Na2CO3) is used to neutralize the sulfuric acid spill. How many kilograms of…

A: Since here the reaction taking place will be, Na2CO3 + H2SO4 ----> Na2SO4 + H2O + CO2 Hence we…

Q: 1. SO2 2. СО2 3. Н,О

A: Since you have asked multiparts questions, we will solve the first three sub parts questions for…

Q: Join In, Question When KCl dissolves in water, what types of intermolecular bonds are formed?…

A: KCl is an ionic compound, it easily dissolve in water. Since water is a polar molecule, it has…

Q: How many grams of lithium oxide must be carried on board to remove 80.0 kg of water?

A: Given, The amount of water = 80 Kg The chemical reaction of lithium oxide and water is; Li2O(s) +…

Q: What is the mass percent of water in NiSO₄･4 H₂O?

A: Mass of water= 18×4=72gm Total mass of compund= 226gm Mass percent= mass of H2O×100÷total mass of…

Q: Bromine ( Br₂ ) is a liquid at room temperature . What is the attractive force that exists among Br2…

A: Very few elements are present in liquid state at room temperature. Br is one of those elements.

Q: Why is MgSO4 a 2:2 type of electrolyte?

A: Electrolytes :-  Substances which conduct electricity in aqueous solution due to the presence of…

Q: How many ammonia molecules must react to produce 1.25 kg of ammonium sulfate?

A: The formation of ammonium sulfate will take place when 2 moles of ammonia will react with 1 mole of…

Q: 1.Tin tetrachloride (SnCl4) is formed between a metal and a non-metal but is molecular in nature.…

A: 1) Tin tetrachloride (SnCl4) is formed between metal and non-metal, but it is molecular in nature…

Q: What percentage of the recommended daily dose of calcium (1,150 mg/day) does 1.0 L of your water…

A: The hardness of water in terms of ppm is taken as 66.73 ppm. Further 1 ppm is equal to 1 mg/L of…

Q: The ionic radi of calcium and sodium ions are similar. Which compound has weaker ionic attractions,…

A: Lattice energy :-  The amount of energy released when one mole of an ionic solid is formed from its…

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: Whare are the aluminum oxide and magnesium oxide used?

A: The major uses of specialty aluminium oxides are in refractories, ceramics, polishing and abrasive…

Q: Which ions are responsible for making water hard?

A: There are two types of water, based on the minerals present in the water. Hard water: Hard water…

Q: Maalox and Mylanta are both antacids that contain aluminum hydroxide as their active ingredient.…

A: In a chemical reaction, when number of atoms of each element present in reactants are equal to…

Q: Why is lithium salts mostly hydrated?

A: Among alkali metals lithium has smallest size.

Q: III. Identify the type of intermolecular force of attraction described in each of the following…

A: The attraction forces between the different molecules are known as intermolecular forces. Different…

Q: ed to Question 9 1) Hg(OAc), H,O 2) NABH,/OH

A: The reaction mentioned in the question  is a example of synthesis of alcohols from unsaturated…

Q: determine the chemical formula created when calcium (20) bonds with the polyatomic ion hydrogen…

A: To form an ionic compound cation and anion transfer their charge Ca +2 and HPO4-2 they will form…

Q: determine the chemical formula created when potassium (19) bonds with the polyatomic ion phosphate.

A:

Q: 13. Can a covalent compound like ethanol, CH3OH dissolve in water? Explain. sil 1slom

A: Yes, ethanol and methanol dissolve in water.

Q: What is the energy change when the temperature of 10.1 grams of solid silicon is decreased from 36.2…

A: The energy change of any solid is given by, => Q = mCΔT where m = mass of solid = 10.1 g C =…

Q: H2O 2. HCHO 12)__ Evaporate

A: When aqueous Solution of formaldehyde is evaporated to dryness following product is formed

Q: Phosphorous triiodide polarity

A:

Q: Lithium phosphate, Li3PO4 (Ksp= 2.37 x 10-4) is dissolved in water. What is the maximum amount of…

A: