Ethanol, C2 H5 OH, burns with the oxygen in air to give carbon dioxide and water.C2H5 OH(1) + 302(g) → 2CO2(g) + 3H2O(1)What is the amount (in moles) of water produced from 0.36 mol C2 H5 OH?mol

Answered: Image /qna-images/answer/c1b66a91-7f55-40a4-9067-763d40420955.jpg

Answered: Ethanol, C2 H5 OH, burns with the…

Ethanol, C2 H5 OH, burns with the oxygen in air to give carbon dioxide and water. C2H5OH(1) + 302(9) → 2CO2(g) + 3H2O(1) What is the amount (in moles) of water produced from 0.36 mol C2 H5 OH?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter3: Chemical Reactions

Section: Chapter Questions

Problem 59QRT: Nitrogen monoxide is oxidized in air to give brown nitrogen dioxide. Starting with 2.2 mol NO,...

See similar textbooks

Related questions

Q: 6. 1.50 X 1024 molecules of oxygen are burned in a combustion reaction. What is the mass of O2…

A: Moles of compound from given number of molecules can be calculated as: Number of mole=given number…

Q: Urea, CO(NH2)2, is manufactured on a large scale for use in producing urea-formaldehyde plastics and…

A: 1.00×103 kg of carbon is equivalent to 1.00×106 g of carbon.

Q: Urea, CO(NH2)2, is manufactured on a large scale for use in producing urea-formaldehyde plastics and…

A: Starting with combustion of Carbon

Q: If you had 6 CO2 molecules and 6 H2O molecules…. How many molecules of C2H4 could you produce?

A: 2CO2 + 2H2O = C2H4 + 3O2

Q: References] Aspirin, CH4(0COCH3)CO,H, is produced by the reaction of salicylic acid, C,H4(OH)CO,H,…

A: The mass of salicylic acid and acetic anhydride is 100.0 g. The given chemical reaction is,…

Q: Consider the balanced combustion reaction. 2 C3H13 + 25 0, → 16 CO, + 18 H,0 How many grams of water…

A: Weight of octane = 216gram Molar mass of octane = 114.23gm/mole Molar mass of H2O= 18.01gm/mole

Q: P+6NO P,0 + 3N, How many moles of N, can be produced if 2.24 x 1023 molecules of NO reacts with…

A: The reaction given in the question is as follows: P4 + 6NO → P4O6 + 3N2 Number of molecules of NO…

Q: What is the stoichiometric coefficient for oxygen when the following equation is balanced using the…

A: To get the coefficients, balanced the chemical equation.

Q: by adding water to calcium carbide (CaC2). CaC2(s) + 2H,O(1) → C2H2(g) + Ca(OH),(aq) How many grams…

A: Introduction : Acetylene is produced by the reaction of calcium carbide with water, it is made from…

Q: 6. Methanol (CH3OH, also called methyl alcohol) is the simplest alcohol. It is used as a fuel in…

A: A reaction in which number of atoms on both side of the chemical equation that is left side and…

Q: Aluminium carbide, Al4C3, reacts with water to produce methane. Al4C3(s) + 12H2O(l) → 4Al(OH)3(s) +…

A: Aluminum carbide, Al4C3, reacts with water to produce methane. The balanced chemical reaction is as…

Q: Some industrial plants for acetic acid react liquid methanol with carbon monoxide in the presence of…

Q: For the chemical reaction 2 NaOH + H,SO, → Na,SO, + 2 H,0 how many moles of sodium sulfate will be…

A: Given : 2NaOH + H2SO4 → Na2SO4 + 2H2O Mass of NaOH = 22.4 g To calculate : Number of moles of…

Q: In the following reaction, C5H12(1) + 8 O2 (g) → 6 H20 (g) + 5 CO2 (g), how many moles of water (H2O…

A: From the given equation, we know that 8 moles of O2 give 6 moles of H2O hence 1 mole of O2 give 6/8…

Q: The equation for the reaction between sodium hydrogen carbonate and sulfuric acid at room…

Q: 3) When acetic anhydride is dissolved in water, it forms acetic acid according to the balanced…

Q: A chemist reacted 11.50 grams of sodium metal with an excess amount of chlorine gas. The chemical…

A: Given Mass of Na metal = 11.5 g Percentage yield = 85%

Q: Aluminum carbide, Al4C3, is a yellow powder that reacts with water to produce aluminum hydroxide and…

Q: Diphosphorus pentoxide (P2O5) is produced from phosphorus (P) and oxygen gas (O2). What mass of…

A: This question can be solved on the basis of prior knowledge of the mole concept.

Q: Consider the reaction 3X + 2Y 5C + 4D With excess Y, how many moles of X are needed to produce 23.00…

A: Given we know about the mole mole analysis and find the mole of X Data Y in excess and mole of D is…

Q: Given the reaction: 4NH3 (g) + 5 O2 (g) → 4 NO (g) + 6 H2O (l) When 1.25 mole of ammonia reacts,…

Q: Consider the following equation: Na 0 + H,0 → 2NAOH How many grams of Na,0 are required to produce…

Q: The synthesis of maleic acid anhydride (C4H203) can be accomplished by reacting benzene (C6H6) and…

A: The given reaction for production of maleic acid anhydride is…

Q: 5. The reaction 2C2H2(g) + 502(g) → 4CO2(g) + 2H2O(1) is a a. combustion reaction

A: Combustion reaction is the reaction in which a reactant reacts with oxygen gas to form CO2 and H2O…

Q: 2. 78.24 g of sodium carbonate reacts with 1.54 x 10% formula units of zinc chloride in a double…

A: Using stoichiometry of the balanced chemical reaction, theoretical and actual yield can be…

Q: The reaction for producing glucose in plants, called photosynthesis, is…

A: Given, moles of C6H12O6 = 9.76 molThe reaction for producing glucose in plants is: 6 CO2 + 6 H2O →…

Q: Propane, C3H8, can be used as a fuel in your home, car, or barbecue grill because it is easily…

Q: C4 H10 O3 + ? O2 → 10- Assume that this reaction is a complete reaction. What can be the coefficient…

Q: e. What mass of oxygen gas, O2, from the air is. consumed in the combustion of 702 g of octane.…

A: A combustion reaction is a reaction in which a substance reacts with oxygen gas, releasing energy in…

Q: The fertilizer ammonium sulfate, (NH4)2SO4, is prepared by the rxn of ammonia with sulfuric acid.…

A: Hey, since there are multiple questions posted, we will answer first question. If you want any…

Q: In air, nitric oxide gas reacts with oxygen to produce nitrogen dioxide, which appears brown in…

A: The amount of Nitrogen dioxide formed can be calculated as follows

Q: Calculate the mass of water produced when 7.82 g of methane, CH4, reacts with an excess of oxygen in…

Q: Nitroglycerin (C3H5N3O9) is a powerful explosive. Its decomposition may be represented by 4C3H5N3O9…

A: 4C3H5N3O9 ⟶ 6N2 + 12CO2 + 10H2O + O2 Mass of C3H5N3O9= 2.0x 102 g Molar mass of C3H5N3O9= 227 g/mol…

Q: C4 H10 O3 + ? O2 → Assume that this reaction is a complete reaction. What can be the coefficient of…

A: Hydrocarbon combustion is the chemical reaction where a hydrocarbon reacts with oxygen to form…

Q: Black smokers are found in the depths of the oceans. Thinking that the conditions in these smokers…

A: Given: The mass of CH3SH (methanethiol) is 14.0 g The mass or actual yield of CH3COSCH3…

Q: If exactly 4.089 moles of propanol (C3H8O) is combusted in the presence of excess oxygen what is…

A: Given data: The moles of propanol combusted is 4.089 mol. To calculate: The mass of O2 was used in…

Q: Consider the reaction 3X + 2Y→ 5C + 4D With excess Y, how many moles of X are needed to produce…

A: Reaction: 3X + 2Y → 5C + 4D According to the reaction: 4 mol of D is produced when = 3 mol of…

Q: The balanced equation for the combustion of butane, CaH1o, is shown below. For your convenience, the…

Q: C4 H10 O3 + ?O2 → Assume that this reaction is a complete reaction. What can be the coefficient of…

A: The chemical equations should be balanced in accordance with the law of conservation of mass. This…

Q: Aspirin (C9H8O4) is synthesized by reacting salicylic acid (C7H6O3) with acetic anhydride (C4H6O3)…

A: It is required to calculate the maximum mass of aspirin produced by the reaction of 104 g of…

Q: In the combustion of methanol, 2CH3OH(1) + 302(g) 2CO2(g) + 4H20(g),

A: We have given that 2CH3OH(l) + 3O2(g) → 2CO2(g) + 4H2O(g) How many mole of the excess…

Q: Use the equation 6KI (aq) +8HNO3 (ac) → 6KNO3 (aq) + 2NO + 312 (s) + 4H20 m- If 21.38 mL of 0.787 M…

Q: e. What mass of oxygen gas, 02, from the air is consumed in the combustion of 702 g of octane,…

Q: Based on the balanced reaction: 6 CO2 + 6 H2O→ 6 O2 + C6H12O6, what is the maximum number of grams…

A: 6 CO2 + 6 H2O→ 6 O2 + C6H12O6 molecular mass of CO2 = 44g

Q: how do i do this

A: The given reaction is shown below.

Q: What number of mole and mass of silver oxide, Ag2O, is required to produce 17.85 g of silver…

A: The given reaction shows that the reacting ratio of Ag2O to AgC10H9N4SO2 is 1:2.Find the number of…

Q: Cyclopentane, a hydrocarbon, has a molar mass of 70.13 g/mole. If the combustion of 0.5600g…

Q: DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: 2Cg…

A: The balanced reaction given is Given : Mass of chloral i.e C2HOCl3 taken = 470 g And mass of…

Q: For the reaction C + 2H2 → CH4, how many moles of hydrogen are needed to make 103.9 grams of…

A: In chemistry, one mole can be defined as quantity containing particles equivalent to 6.023 × 1023…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

100%

Ethanol, C2 H5 OH, burns with the oxygen in air to give carbon dioxide and water.
C2H5 OH(1) + 302(g) → 2CO2(g) + 3H2O(1)
What is the amount (in moles) of water produced from 0.36 mol C2 H5 OH?
mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1:- the values given in the question

VIEW

Step 2:- Calculation of number of moles of water produced using mole to mole conversion

VIEW

Step 3:- Answer

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

4.108 Elemental analysis is sometimes carried out by combustion of the sample. For a hydrocarbon, the only products formed are CO2 and H2O. If a 1.36-g sample of an unknown hydrocarbon is burned and 2.21 g of H2O is produced along with 4.07 g of CO2, what is the empirical formula of the hydrocarbon?
Nitrobenzene, C6H5NO2, an important raw material for the dye industry, is prepared from benzene, C6H6, and nitric acid, HNO3. C6H6(l)+HNO3(l)C6H5NO2(l)+H2O(l) When 21.6 g of benzene and an excess of HNO3 are used, what is the theoretical yield of nitrobenzene? If 30.0 g of nitrobenzene is recovered, what is the percentage yield?
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
The reaction of methane and water is one way to prepare hydrogen for use as a fuel: CH4(g) + H2O(g) CO(g) + 3 H2(g) If you begin with 995 g of CH4 and 2510 g of water, (a) Which reactant is the limiting reactant? (b) What is the maximum mass of H2 that can be prepared? (c) What mass of the excess reactant remains when the reaction is completed?
Using the following reaction (depicted using molecular models), large quantities of ammonia are burned in the presence of a platinum catalyst to give nitric oxide, as the first step in the preparation of nitric acid. Suppose a vessel contains 5.5 g of NH3. How many grams of O2 are needed for a complete reaction?
Nitrogen monoxide is oxidized in air to give brown nitrogen dioxide. Starting with 2.2 mol NO, calculate how many moles and how many grams of O2 are required for complete reaction. Calculate what mass of NO2, in grams, is produced.
Methyl salicylate (oil of wintergreen) is prepared by heating salicylic acid, C7H6O3, with methanol, CH3OH. C7H6O3+CH3OHC8H8O3+H2O In an experiment, 2.50 g of salicylic acid is reacted with 10.31 g of methanol. The yield of methyl salicylate, C8H8O3, is 1.27 g. What is the percentage yield?
Quinone, which is used in the dye industry and in chemical photography, is an organic compound containing only C, H, and O. Determine the empirical formula if 0.105 g of the compound gives 0.257 g CO2 and 0.0350 g H2O when burned completely.
A sample of sandstone consists of silica, SiO2, and calcite, CaCO3. When the sandstone is heated, calcium carbonate, CaCO3, decomposes into calcium oxide, CaO, and carbon dioxide CaCO3(s)CaO(s)+CO2(g) What is the percentage of silica in the sandstone if 18.7 mg of the rock yields 3.95 mg of carbon dioxide?
4.110 Write the balanced chemical equation lot the combustion of ethane, C2H6, and answer these questions. (a) How many molecules of oxygen would combine with 14 molecules of ethane in this reaction? (b) If 13.0 mol of oxygen is consumed in a reaction, how many moles of water are produced? (e) How many grams of ethane are burned if 4.201022 molecules of CO2 are produced?
4.44 Industrial production of hydrogen gas uses the reaction shown below. If 1.00 metric ton of propane reacting with excess water yields 270 kg of H2, what is the percentage yield? C3H8(g)+3H2O(l)3CO(g)+7H2(g)
Urea is used as a fertilizer because it can react with water to release ammonia, which provides nitrogen to plants. (NH2)2CO(s) + H2O() 2 NH3(aq) + CO2(g) (a) When 300. g urea and 100. g water are combined, calculate the mass of ammonia and the mass of carbon dioxide that form. (b) Calculate the mass of the excess reactant that remains after reaction.