Explain the bond between M and H2 in organometallic compounds using orbital overlap.   Don't copy paste.

Q: Draw a stepwise mechanism for the following reaction.

A:

Q: Which of the following molecules absorbs a longer wavelength of UV light?

A: There is a direct relation between the wavelength and the absorbance of the wavelength of the UV…

Q: Which of the following is considered as chiral molecule? Br CH3 H3C CH3 А В. Br- H CI H H3C CI

A: A chiral molecule is non-superimposable with its mirror ​image. Chiral carbon has four different…

Q: How many chiral centers are in this compound? A) 3 B) 4 C) 5 D) 6

A: Carbon atoms that are attached to four different substituents are called chiral carbons. Carbon…

Q: What are the peak positions, bond types and functional groups?

A: The interaction between electromagnetic radiation and compound is called " spectroscopy "  Types…

Q: A. How many hydrogen atoms are present on each carbon atom? B. How many sp, sp², sp³ hybridize…

A:

Q: Which one of these compounds are cis-trans isomers? Br F a b

A: None of these compounds are cis-trans isomers.

Q: CH3CH2CH2CH2CH3

A: Bond-Line Notation - In Bond- Line notation, a carbon atom is shown by ,at every point where two or…

Q: Is i-Propyl bromide polar or non-polar? Why?

A:

Q: Circle each chiral center in the molecule below. CH2OH O. OMe

A: The chiral center is an 'sp3' hybridized center (tetrahedral atom) which is attached to four…

Q: Draw the Mo diagram of the C=O bond in a ketone

A: The MO diagram is used to locate the electrons present in bonding orbital, non-bonding orbital and…

Q: CI Br .CI Cl H-C CH3 Br CI How many chiral carbons are in this molecule? O 3 O 2 O 1

A: If carbon is attached to four different group then carbon atom is called as chiral carbon

Q: CH2OH OH ОНОН a) How many anomeric carbon atoms are present in this structure?

A: D-ribose is a simple sugar and ribose also used in RNA the molecular formula of D-ribose C5H10O5.…

Q: For the compounds shown, use the R/S configuration given in the compound name to finish drawing the…

A: b. The structure of (s)-1-chloro-2-propanol is as follows: The RS nomenclature is explained as…

Q: which exhibit hidrogen bonding  CH2O NH3 CH3OH C2H6

A: H bond occurs between H attached to an adjacent electronegative atom and another electronegative…

Q: what is the name of the compound?  Identify the configuration of the double bond.

A:

Q: Which compounds are more stable? (SP Hybridized Vehicles) (SP2 hybrid vehicles) (SP3 Hybridized…

A: The energy order of the three hybrid orbitals are : sp < sp2 < sp3

Q: For  highlighted carbon atom , identify which atomic orbitals are used to form each σ bond and which…

A: The atomic orbitals of the carbon atom forming  one double bond always undergo sp2 hybridization.…

Q: Name the organic structure CH3CH2CH2 CH3 %3D Br H

A: The IUPAC name of the following structure is as follows:

Q: Please draw the Z and E isomers of 1,3-dichloro-2-methylbut-2-ene Thank you

A:

Q: 3. ( S Draw the skeletal structure (like the structure in Question 1) for C6H5CO₂CH3.

A: 3) The skeletal structure of an organic compound is the sequence of atoms that are bonded together…

Q: 11. Which of the following compounds show cis-trans isomerism? Draw the cis and trans isomers of…

A: There are following requirements for cis trans isomerism, in the given Organic Compound -  (1)…

Q: Please identify the correct ring flipped structure of compound XYZ.

A: We have to predict the structure on the ring flip.

Q: J. Write the Conderised for mula of the ft. 1) &, 2 di methyl cyclo pentanecarbaldehyda , 2 Chloro…

A: We need to write condensed  formulae of given compounds.    Note : The question contain multiple…

Q: 3. Complete the following chemical reactions by providing the missing reactants and products in the…

A: Here are the mechanisms for all the reactions

Q: CH3 H CH3 CI c=C CI c=c< c3D H H H

A:

Q: 2. Based on the shape of the molecule, what bond angles would you expect between the carbon atoms in…

A: Cyclobutane is 4 carbon cyclic alkane.

Q: а. (CНз)2СHCH2CI b. Br La CI

A: Methyl halide ( CH3X) : halogen (X) attached to methyl group.  Primary (1°) halide: halogen attached…

Q: Circle the functional group(s) listed below that are not found in chanoclavine I. amine alkene amide…

A:

Q: 3. Which of the following compounds exists as cis-trans isomers? Draw the structures of those that…

A:

Q: Which of the following molecules contain the same functional groups? CH;CH(NH2)CH; CH;CH2CH2NH2…

A: Note: As per our guidelines, we are supposed to answer only one question when multiple questions are…

Q: Draw the skeletal structure of: 2-fluorohexanedial

A: Skeletal formula is represention of molecular formula or molecules in there structural form.

Q: Please draw the 3d structure of psylocibin (C12H17N2O4P), with labeled molecular geometry and angles

A: A question based on molecules that is to be accomplished.

Q: Identify the functional group in the following compounds CN `NH2 он NH

A: The organic compound is formed by two main elements, carbon, and hydrogen. The specific group of…

Q: Illustrate H-bonding among three molecules of propan-2-ol.

A:

Q: Whats the kekule structure for C3H7NO3

A: Kekule structure is a Lewis structure structure in which the bonded electron pairs between the two…

Q: If you were to install an amine functional group in the equatorial position at carbon #3 of the…

A: Given is methyl cyclohexane and we are going to add amino group at C3 in equatorial facing.

Q: 5. Determine the number of t bonds in the molecule shown HO Tt bonds но- CH2CH2NH2

A: In double bond π bond = 1  In triple bond π bond = 2

Q: 2. How many chiral carbon atoms are in the following compound? CH:(OH)CH(OH)CH(OH)CH(OH)CH;OH a) 1…

A: A chiral carbon atom or asymmetric carbon atom is one whose four valencies are occupied by four…

Q: 2) Determine the IHD of each molecule: a) C6H1205C12 b) C4H1ÓN6B14

A:

Q: Does this molecule have both cis and trans isomers?

A:

Q: H H OH H н он н H-C-C- C-H H-C-C-c-H H H H H H H

A:

Q: Which of the following is electron deficient molecule? a   C2H6 b   SiH4  c   B2H6 d   PH3

A: Molecule a) has 2 carbons present in 1 C-C. 1 C atom is bonded to 3 hydrogen atoms. Each bond…

Q: Why can't molecules with the following formulas exist? CH5 C2H6N C3H5Br

A: For a molecule to exist it must be stable and it is stable only when it attains the maximum of…

Q: ОН YHO, ОН H. O, ОН NH2 This is the molecule commonly known as Doxorubicin. Doxorubicin is used in…

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: How many chiral carbon atoms do each of the following molecules 2) contain? LOCH3 OH ОН HO, b) c) ÓH

A: Interpretation: We have to assign the number of chiral carbon atoms.

Q: Name the compound whose .structure is shown below H3C CH3 H3C

A: option 1  COMPOUND  1. Total number of carbon in the chain is 5 (5&gt; pent) 2. At carbon number…

Q: (a) (CH3)2CHCH2Cl classify the compound as a methyl, primary, secondary, or tertiary halid

A: The IUPAC name of the given compound is 1-chloro-2-methylpropane.

Q: What is the bond angles of NO2CH3?

A: The complete structure of NO2CH3 is, The geometry of around N atom is trigonal planar as the…

Stereochemistry and Isomerism

Stereochemistry deals with the three-dimensional structure and properties of molecules. It explains the arrangement of atoms and their manipulation within a molecule in a 3D structure. Stereochemistry can be dealt with all types of molecules. Based on the stereochemistry of a molecule, the physical and chemical properties of the molecules vary.