For a certain chemical reaction, the standard Gibbs free energy of reaction is 129. kJ . Calculate the temperature at which the equilibrium constant K = ×6.010−25 . Round your answer to the nearest degree.

For a certain chemical reaction, the standard Gibbs free energy of reaction is 129. kJ . Calculate the temperature at which the equilibrium constant K = ×6.010−25 . Round your answer to the nearest degree.

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter17: Chemcial Thermodynamics

Section: Chapter Questions

Problem 17.67QE: What is the sign of the standard Gibbs free-energy change at low temperatures and at high...

See similar textbooks

Related questions

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is - 89.9 kJ. Calculate…

A: Given- ΔG=-89.9KJ=-89.9×103J=-89900J K=2.0×1016

Q: Is change in Gibbs free energy for the melting of ice greater or less than zero? A>0 C.-0 D. It…

A: According to the second law of thermodynamics, the spontaneous nature of the reaction is determined…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is -114. kJ. Calculate…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is 139. kJ. Calculate…

Q: What is the change in 'molar' gibbs free energy? Could you give me an example of the calculation…

A: The change in Gibbs free energy of the system can be expressed in the term of change in enthalpy and…

Q: Ammonia reacts with water in liquid ammonia solution according to the equation: NH3(g) + H2O ⇌ NH4+…

A: Spontaneity of a chemical reaction can be expressed in terms of Gibbs free energy change. Write the…

Q: For a certain chemical reaction, the equilibrium constant K = 5.1 × 10 ° at 10.0 °C. Calculate the…

A: Given temperature is 283 Kelvin

Q: A student determines the value of the equilibrium constant to be 1.5297 x 107 for the following…

A: We know there is relation between ∆G (gibbs free energy ) and the Keq . ∆G = - RT ln (Keq) By using…

Q: Consider the oxidation of a generic metal M into a metal oxide as shown in the reaction. 3 M(s) +…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is – 130. kJ. Calculate…

A: Given: Equilibrium constant, K = 2.6 × 1024 And ΔG0 = -130 KJ = -130000 J.

Q: At 25 °C, the equilibrium partial pressures for the reaction A(g) + 2 B(g) 4 C(g)+D(g) were found to…

A: Given data :

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 3 B(g) = C(g) + 3 D(g) were…

A: We will. Calculate∆G°

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 20.0 °C is…

A: Given :- ∆G° = -108 kJ T = 20.0 °C To be calculated :- value of equilibrium constant…

Q: For a certain chemical reaction, the equilibrium constant K = 1.1 x 10 at 25.0 °C. Calculate the…

A: Here, we have to calculate the value of the standard Gibbs free energy of a reaction at 25.0 ∘C if…

Q: Which one of the following is not equal to zero? A. Standard molar entropy of a perfect crystal…

A: Standard enthalpy of formation of elements and the compounds in their standard state is zero.

Q: Reaction: 2 ICI (g) 17.78 Cb (g). AH (kJ/mole) S° 247.551 116.135 223.066 (J/mole K) A. 0.0123 B.…

Q: For a certain chemical reaction, the equilibrium constant K = ×1.410−6 at 10.0 °C .…

A: Given :- equilibrium constant (K) = 1.4 × 10-6 temperature (T) = 10.0 °C To be calculated :-…

Q: At 25 °C, the equilibrium partial pressures for the reaction 3 A(g) + 2 B(g) = C(g) + 2 D(g) were…

Q: The equilibrium constant of a reaction conforms to the following equation in the temperature range…

A: The equilibrium constant(K) is defined as the ratios of concentration of product to the…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is -58.4 kJ. Calculate…

A: Given standard Gibbs free energy change is -58.4kj

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is -83.0 kJ. Calculate…

Q: For a certain chemical reaction, the equilibrium constant K=1.6X 10^6 at 20.0°C. Calculate the…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is -104. kJ. Calculate…

Q: For a certain chemical reaction, the equilibrium constant K = 2.8 × 10° at 25.0 °C. Calculate the…

A: Answer:- This question is answered by using the simple concept of calculation od standard Gibbs free…

Q: For a certain chemical reaction, the equilibrium constant K = 2.2 x 10" at 5.00 °C. Calculate the…

A: The answer is given as follows -23 kJ is answer

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is -148. kJ. Calculate…

A: Given that, the standard Gibb's free energy (∆Go) of the reaction - 148 kJ and the equilibrium…

Q: 10 For a certain chemical reaction, the equilibrium constant K = 3.4 × 10º at 30.0 °C. Calculate the…

A: The relationship between standard Gibbs free energy change (∆G°) of reaction and equilibrium…

Q: Discuss the spontaneity of each process in the following scenarios, based on the use of the Gibbs…

A: The spontaniety of Reaction depends upon the sign of ∆G value for the reaction . The reaction is…

Q: At 25 °C, the equilibrium partial pressures for the reaction A(g) + 2 B(g) = C(g)+D(g) were found to…

A: Given, A(g) + 2B(g) ⇌ C(g) + D(g) Equilibrium partial pressure for all the above species: PA = 4.22…

Q: For a certain chemical reaction, the equilibrium constant K = 6.2 × 10 10 at 10.0 °C. Calculate the…

A: The relationship between the Gibbs free energy change and equilibrium constant is given by RTln(K)…

Q: – 10 For a certain chemical reaction, the equilibrium constant K = 4.5 × 10 at 5.00 °C. Calculate…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is 117. kJ. Calculate K…

Q: Which of the following species will have the greatest magnitude of change in Gibbs free energy due…

A: The Gibbs free energy is the energy that is present in the system and can be tapped for doing work…

Q: Consider the chemical equation C(s) + 2A(g) S 2B(1) + heat. Be suré to JUSTIFY each answer below.…

A: Since you have posted a question with multiple sub-parts, we will solve the first three subparts for…

Q: Calculate the value of the thermodynamic equilibrium constant K.

A: The equilibrium constant can be written as the ratio of concentration of products to the…

Q: Hydrogen gas burns in an atmosphere of bromine gas to produce hydrogen bromide gas according to the…

Q: Classify the formation of methane from its elements in their reference states as exergonic or…

A: The formation of methane from its elements in their reference states can be given by the following…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 20.0 °C is 86.1 kJ.…

A: Given, standard Gibbs free energy, ΔG° = 86.1 kJ temperature, T = 20°C = 20 + 273 K = 293…

Q: For a certain chemical reaction, the equilibrium constant K = ×8.410−4 at 15.0 °C .…

A: Given : K = 8.4 x 10-4

Q: For a certain chemical reaction, the equilibrium constant K = 2.2 × 10 °at 25.0 °C. Calculate the…

A: Please have a look on the solution:

Q: At 25 °C, the equilibrium partial pressures for the reaction 2 A(g) + 2 B(g) = C(g) + 3 D(g) were…

A: The equilibrium constant can be calculated as follows:…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 30.0°C is 73.3 kJ.…

A: To solve this problem we will use the given formula to calculate the equilibrium constant as given…

Q: At 25 ∘C25 ∘C, the equilibrium partial pressures for the reaction 3A(g)+4B(g)↽−−⇀2C(g)+3D(g)…

A: The reaction given is 3 A (g) + 4 B (g) ------> 2 C (g) + 3 D (g) Given : equilibrium partial…

Q: For a certain chemical reaction, the equilibrium constant K = ×7.7106 at 5.00 °C .…

Q: For a certain chemical reaction, the equilibrium constant K 2.2 x 10" at 5.00 °C. Calculate the…

A: Given data contains, The value of equilibrium constant K is 2.2×104. Gas constant R is 8.314…

Q: a certain chemical reaction, the standard Gibbs free energy of reaction is -133. kJ. Calculate the…

A: Gibbs Free Energy : For a general reaction given below : A + B ⇌ C + D Let;s say the equilibrium…

Q: The entropy change for a reaction is -21.0 J/K. If delta H is -10.0 kJ/mol, calculate Keq at 100o C…

Q: Standard Gibbs free energy/Gibbs free energy solution Standard Gibbs free energy. Gibbs free energy…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction is – 149. kJ. Calculate…

Question

For a certain chemical reaction, the standard Gibbs free energy of reaction is

129.

. Calculate the temperature at which the equilibrium constant

×6.010−25

.

Round your answer to the nearest degree.

Definition Definition Transformation of a chemical species into another chemical species. A chemical reaction consists of breaking existing bonds and forming new ones by changing the position of electrons. These reactions are best explained using a chemical equation.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Determine the standard Gibbs free energy change, rG, for the reactions of liquid methanol, of CO(g), and ofethyne, C2H2(g), with oxygen gas to form gaseous carbondioxide and (if hydrogen is present) liquid water at298 K. Use your calculations to decide which of thesesubstances are kinetically stable and which are thermodynamically stable: CH3OH(), CO(g), C2H9(g), CO2(g),H2O().
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
Billions of pounds of acetic acid are made each year, much of it by the reaction of methanol with carbon monoxide. (AssumeT= 298 K.) CH3OH() + CO(g) CH3COOH() (a) By calculating the standard Gibbs free energy change, rG, for this reaction, show that it is product-favored. (b) Determine the standard Gibbs free energy change, rG,for the reaction of acetic acid with oxygen to form gaseous carbon dioxide and liquid water. (c) Based on this result, is acetic acid thermodynamicallystable compared with CO2(g) and H2O()? (d) Is acetic acid kinetically stable compared with CO2(g)and H2O()?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the decomposition of phosgene? COCl2(g)CO(g)+Cl2(g)
The equilibrium constant for a certain reaction increases by a factor of 6.67 when the temperature is increased from 300.0 K to 350.0 K. Calculate the standard change in enthalpy (H) for this reaction (assuming H is temperature-independent).
Another step in the metabolism of glucose, which occurs after the formation of glucose6-phosphate, is the conversion of fructose6-phosphate to fructose1,6-bisphosphate(bis meanstwo): Fructose6-phosphate(aq) + H2PO4(aq) fructose l,6-bisphosphate(aq) + H2O() + H+(aq) (a) This reaction has a Gibbs free energy change of +16.7 kJ/mol of fructose6-phosphate. Is it endergonic or exergonic? (b) Write the equation for the formation of 1 mol ADP fromATR for which rG = 30.5 kJ/mol. (c) Couple these two reactions to get an exergonic process;write its overall chemical equation, and calculate theGibbs free energy change.
Reword the statement in Question 109 so that it is always true. Criticize this statement: Provided it occurs at an appreciable rate, any chemical reaction for which rG 0 will proceed until all reactants have been converted toproducts.
Predict whether each reaction is reactant-favored or product-favored at 298 K and 1 bar, and calculate the minimum work that would have to be done to force it to occur, or the maximum work that could be done by the reaction. (a) 2 CO2(g) 2 CO(g) + O2(g) (b) 4 Fe(s) + 3 O2(g) 2 Fe2O3(s)
When (if ever) are high temperatures unfavorable to a reaction thermodynamically?