For each of the following reactions, will the reaction shift towards the reactants, products,or no shift occur when the following stressors are applied.2HCI(aq) + Mg(s) = MgCl2(aq) + H2(g) + heata. The temperature is increased.b. H2 gas is bubbled into the reaction vessel.c. Mg metal is addedN2 (g) + 3H2(g) = 2NH3(g)a. The vessel of the volume is decreasedb. Nitrogen gas is added to the reaction vesselc. Hydrogen gas is removedheat + A(aq) + 3B(s) = 2C(aq) + 4D(aq)a. Argon gas is bubbled into the systemb. More of solid B is addedc. The temperature is decreased

According to our guidelines, I can only answer first question because you have posted muktiple…

For each of the following reactions, will the reaction shift towards the reactants, products, or no shift occur when the following stressors are applied. 2HCI(aq) + Mg(s) = MgCl,(aq) + H2(g) + heat a. The temperature is increased. b. H2 gas is bubbled into the reaction vessel. c. Mg metal is added

For each of the following reactions, will the reaction shift towards the reactants, products, or no shift occur when the following stressors are applied. 2HCI(aq) + Mg(s) = MgCl,(aq) + H2(g) + heat a. The temperature is increased. b. H2 gas is bubbled into the reaction vessel. c. Mg metal is added

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter18: Principles Of Chemical Reactivity: Entropy And Free Energy

Section: Chapter Questions

Problem 67SCQ

See similar textbooks

Related questions

Q: For the reaction 2CH4(g)⇌C2H2(g)+3H2(g)2CH4(g)⇌C2H2(g)+3H2(g) Kc = 0.160 at 1517 ∘C∘C . What is Kp…

Q: 100 mmol of (NH3), 300 mmol, are introduced into a 2 L container at 127 °C of (H2) and 200 mmol of…

A: Given, Volume of container = 2 L Temperature = 127◦ c = (273+127) = 400 K Pressure = 7.1 bar Amount…

Q: Consider the gas phase reaction: A(g) + 2 B(g) ⟺ C(g) Kp = 2.0 x 108 A reactor is…

A: The equilibrium constant is defined as the ratio of the partial pressure of the products to the…

Q: Water gas, a mixture of H2 and CO, is an important industrial fuel produced by the reaction of steam…

A: a) Below is the expression for equilibrium constant.

Q: The equation ΔG = ΔG˚ + RT ln Q was derived for gaseous reactions where the quantities in Q were…

A: Answer is attached below :

Q: Consider the following gas-phase reaction: NO2(9) + N20(g)=3 NO(g) Using data from Appendix C of…

A: Given Reaction : NO2(g) + N2O(g) ⇌ 3NO (g)

Q: For the reaction 2A(g)+2B(g)⇌C(g)2A(g)+2B(g)⇌C(g) Kc = 54.4 at a temperature of 71 ∘C . Calculate…

A: Chemical equilibrium is the state at which both reactant and product are in equilibrium.

Q: Consider the gas-phase reaction, 2 SO2 + O2 ⇄ 2 SO3, for which Kp = 2.0 at a given temperature. If…

A: The equilibrium reaction given is, => 2 SO2 + O2 ⇄ 2 SO3 Given: Kp of the reaction = 2.0…

Q: -certain nucleotide, N, specifically activates an enzyme according to Enzyme+N + Enzyme – N At 311…

Q: Consider the following reaction at 25 °C: 3 NiO(s) + 2 NH₃(g) → 3 Ni(s) + N₂(g) + 3 H₂O(g) a. If…

Q: Nitrogen and oxygen react at high temperatures.(a) Write the expression for the equilibrium constant…

A: In a reaction a stage where both reactant and product are present, but their change in concentration…

Q: Consider the equilibrium system described by the chemical reaction below. Calculate the value of Qc…

A: Given -> Weight of C = 11.1 gm Weight of H2O = 2.45 gm Weight of CO = 15.3 gm Weight of H2 = 7.55…

Q: NiO(s) + 2 NH₃(g) → 3 Ni(s) + N₂(g) + 3 H₂O(g) ∆So= 348.3 J/K ∆Ho = 85.7KJ ∆Go =−18.093KJ…

A: The equilibrium reaction given is, => NiO(s) + 2 NH₃(g) → 3 Ni(s) + N₂(g) + 3 H₂O(g) Given: ∆So=…

Q: a Calculate AH for the reaction 2K(s) + 2H,0(1) – 2KOH(aq) + H2 (g) Substance and State AH (kJ/mol)…

Q: Given the reaction: SbCl5(g) SbCl3 (g) + Cl2 (g) the delta H=8000 and delta G = 3800 at 25°C.…

A: The measure of the thermodynamic activity of the gas's molecules is known as the partial pressure…

Q: 1. A 50-L reaction vessel contains 1.0 moles N2; 3.0 moles Hz and 0.5 mole NH3. Will more NH3 be…

Q: The following endothermic reaction is found to be at equilibrium at room temperature. NH4HS(s) ⇌…

A: Since you have posted a question with multiple sub-parts, we will solve first three subpartsfor you.…

Q: Consider the equilibrium system described by the chemical reaction below. At equilibrium, a 5.0 L…

A: Given, Moles of CH4 = 1.2mol Moles of H2S = 2.8 mol Moles of CS2 = 0.63 mol Moles of H2 = 0.042 mol…

Q: Write the expressions for Kc and Kp, if applicable, for the following reversible reaction. BaSO4(s)…

A: Write the expressions for Kc and Kp ---

Q: For the following reaction: 2 N205(g) | 4 NO2(g) + 02(g), the value of AG° is -29.0 kJ/mol. What is…

A: The Gibb's free energy at not standard condition can be given by the formula - ∆G = ∆G° + RT ln Q

Q: For the reaction N2(g) + O2(g)–→2NO(g) AH° = 181 kJ and AS° = 24.9 J/K AG° would be negative at…

A: Given, ∆H° = 181 kJ ∆S° = 24.9 J/K

Q: heat + A(aq) + 3B(s) = 2C(aq) + 4D(aq) a. Argon gas is bubbled into the system b. More of solid B is…

Q: Consider the following equilibrium: 2NOCI (g) – 2NO (g) + Cl, (g) AG" = 41. kJ Now suppose a…

Q: Using reaction free energy to predict equilibrium composition D 1/5 Consider the following…

A: Here a reaction vessel is filled with 2.34 atm of NO and 9.71 atm of NOCl at 426°C. The equilibrium…

Q: For the reaction below, the thermodynamic equilibrium constant is K= 1.92x10-3 at 35 °C.…

Q: The following equation represents a reversible decomposition:…

A: Solution : Le Chatelier's principle states that when the chemical reaction system at equilibrium…

Q: X(g) + 2Y(g) = Z(g) ' AH =+175kJmol· sion for Kc for this reaction is: K. = [Z] [X] [Y]* %3D f K,…

A: X(g) + 2Y(g) -----> Z(g) Kc = 2.70mol-2dm6 Equilibrium concentration of X = 0.400moldm-3 Z =…

Q: DISE 8 Phosphorous and chlorine gases combine to produce phosphorous trichloride: c+O P2(g) + 3C12…

A: Given: Partial pressure of P2 (PP2) = 1.5 atm Partial pressure of Cl2 (PCl2) = 1.6 atm Partial…

Q: Consider the gas-phase reaction, 2 SO2 + O2 ⇌ 2 SO3, for which Kp = 2.0 at a given temperature. If…

A: Given, Kp = 2.0 Writing expression for Qc Qc=[SO3]2[SO2]2[O2]

Q: For the reaction 2BRF3(g)Br2(g) + 3F,(g) AH° = 542 kJ and AS° = 269 J/K Kelvin. The equilibrium…

A: Given 3 BrF3(g) → Br2(g) + 3F2(g)∆H° = 542 kJ =542000 J∆S° = 269 J/Kat equillibriumGibbs free…

Q: II.Given the reaction CO(g) + H2O(g) ⇄ CO2(g) + H2(g), Keq = 1.0 at 1100oK. If 2 moles each of CO…

Q: At -13.0 °C the pressure equilibrium constant K, = 5.8 x 10 for a certain reaction. Here are some…

A: Given: Temperature (T1) = -13oC Kp = 5.8 x 105 Constant Pressure molar heat capacity = 2.03 J mol-1…

Q: (5) Use the graph below, schematically describing the change in Gibbs free energy fo chemical…

A: The given graph is:

Q: When wine spoils, ethanol is oxidized to acetic acid as oxygen from the air dissolves in the wine.…

A: The given reaction is : C2H5OH (aq) + O2 (aq) ⇌ CH3COOH (aq) + H2O (ℓ) Value of equilibrium constant…

Q: The combination reaction of sulfur dioxide and chlorine gas is given as : SO2(g)+ Cl2(g).…

A: Reaction quotient is given by the ratio of products and reactants.

Q: Sulfur dioxide and oxygen react to form sulfur trioxide during one of the key steps in sulfuric acid…

A: Given, the reaction between sulfur dioxide and oxygen producing sulfurtrioxide.volume of tank =125…

Q: 2A+B A2B AG=-75.1 kJ.mol-1 and AG = -31.2 kJ.mol-1 at a temperature of 440 K. Calculate the value of…

Q: What is the ΔS° for the reaction? Given are the S°, in J K-1 mol-1, of each substance in…

Q: Water gas, a mixture of H₂ and CO, is an important industrial fuel produced by the reaction of steam…

A: Answer: These questions are based on Le-chatalier's principle, according to which, on changing any…

Q: Consider the following reaction where K, = 10.5 at 350 K: 2 CH,Cl2 (g) CH4 (g) + CCI4 (g) A reaction…

A: For a particular reaction at constant temperature, the value of equilibrium constant (Kc) always…

Q: Consider the reaction at equilibrium 2KCl(s) + 3O2(g) ⇌ 2KClO3(s). ΔH° for this process is +78.6kJ.…

A: According to Le Chatlier principle, any change in pressure , temperature or concentration is applied…

Q: The standard reaction free energy AG = -910. kJ for this reaction: 6 C(s) + 6H₂(g) + 3O₂(g)…

Q: For the reaction N2(g) + O2(g)→2NO(g) AH° = 181 kJ and AS° = 24.9 J/K AG° would be negative at…

A: ∆H°=181kJ ∆S°=24.9J/K N2(g)+O2(g)->2NO(g) ∆G°=?

Q: In the Haber process, ammonia is synthesized from nitrogen and hydrogen: N2g) + 3H2(g) → 2NH3(g) AG°…

Q: 12O2(g), ΔH = 30.56 KJ mol−1 andΔ S = 66 J K−1 mol−1 at 1 atmosphere pressure. Calculate the…

A: Given, □H = 30.56 kJ/mol □S =66 J/mol-K As we know □G = □H - T□S At equilibrium, □G = 0 T = □H/□S

Question

For each of the following reactions, will the reaction shift towards the reactants, products,
or no shift occur when the following stressors are applied.
2HCI(aq) + Mg(s) = MgCl2(aq) + H2(g) + heat
a. The temperature is increased.
b. H2 gas is bubbled into the reaction vessel.
c. Mg metal is added
N2 (g) + 3H2(g) = 2NH3(g)
a. The vessel of the volume is decreased
b. Nitrogen gas is added to the reaction vessel
c. Hydrogen gas is removed
heat + A(aq) + 3B(s) = 2C(aq) + 4D(aq)
a. Argon gas is bubbled into the system
b. More of solid B is added
c. The temperature is decreased

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
For the decomposition of Ag2O: 2Ag2O(s)4Ag(s)+O2(g)(a) Obtain an expression for G as a function of temperature. Prepare a table of G values at 100 K intervals between 100 K and 500 K. b) Calculate the temperature at which G =0.
A process that is reactant-favored at equilibrium can never be spontaneous. This statement is (a) true (b) false
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
When calcium carbonate is heated strongly, CO2 gas is evolved. The equilibrium pressure of CO2 is 1.00 bar at 897 C, and rH at 298 K is 179.0 kJ/mol-rxn. CaCO3(s) CaO(s) + CO2(g) Estimate the value of rS at 897 C for the reaction.
Monochloroethane (C2H5Cl) can be produced by the direct reaction of ethane gas (C2H6) with chlorine gas or by the reaction of ethylene gas (C2H4) with hydrogen chloride gas. The second reaction gives almost a 100% yield of pure C2H5Cl at a rapid rate without catalysis. The first method requires light as an energy source or the reaction would not occur. Yet G for the first reaction is considerably more negative than G for the second reaction. Explain how this can be so.
5.12. True or false: If all the partial pressures of reactants and products drop by half, the value of Q drops by half. Give an example of a chemical reaction to support your answer.
Use data given in Tables 6.2 and 18.1 to obtain the value of Kp at 2000C for the reaction N2(g)+O2(g)2NO(g) Nitric oxide is known to form in hot flames in air, which is a mixture of N2 and O2. It is present in auto exhaust from this reaction. Are the data in agreement with this result? Explain.
Consider the following relationships: G = 1, H = TS, Q = 1. G = G, K = 1 Which of these relationships is(are) always true for a reaction at equilibrium?
Use data given in Tables 6.2 and 18.1 to obtain the value of Kp at 1000C for the reaction C(graphite)+CO2(g)2CO(g) Carbon monoxide is known to form during combustion of carbon at high temperatures. Do the data agree with this? Explain.
Consider the equation G = G + RT ln(Q). What is the value of G for a reaction at equilibrium? What does Q equal at equilibrium? At equilibrium, the previous equation reduces to G = RT ln(K). When G 0, what does it indicate about K? When G 0, what does it indicate about K? When t G = 0, what does it indicate about K? G predicts spontaneity for a reaction, whereas G predicts the equilibrium position. Explain what this statement means. Under what conditions can you use G to determine the spontaneity of a reaction?