Gaseous methane (CH) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). If 1.01 g of carbon dioxide is produced from the reaction of 1.1 g of methane and 2.4 g of oxygen gas, calculate the percent yield of carbon dioxide. Be sure your answer has the correct number of significant digits in it.

Gaseous methane (CH) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). If 1.01 g of carbon dioxide is produced from the reaction of 1.1 g of methane and 2.4 g of oxygen gas, calculate the percent yield of carbon dioxide. Be sure your answer has the correct number of significant digits in it.

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 38QAP: If common sugars arc heated too strongly, they char as they decompose into carbon ¡md water vapor....

See similar textbooks

Similar questions

The element magnesium reacts with the element oxygen to form a white solid compound, magnesium oxide. When a sample of magnesium that weighs 24.30 g reacts with oxygen, it is found that the magnesium oxide produced weighs exactly 40.30 g. (a) Calculate the mass of oxygen in the magnesium oxide. (b) Calculate the mass of magnesium oxide that could be produced from 40.0 g magnesium.
When corn is allowed to ferment, the fructose in the corn is converted to ethyl alcohol according to the following reaction C6H12O6(aq)2C2H5OH(l)+2CO2(g)(a) What volume of ethyl alcohol (d=0.789g/mL) is produced from one pound of fructose? (b) Gasohol can be a mixture of 10 mL ethyl alcohol and 90 mL of gasoline. How many grams of fructose are required to produce the ethyl alcohol in one gallon of gasohol?
If common sugars arc heated too strongly, they char as they decompose into carbon ¡md water vapor. For example, if sucrose (table sugar) is bated, the reaction is :math>C12H22O11(s)12C(s)+11H2O(g) at mass of carbon is produced if 1.19 g of sucrose decomposes completely?
Gaseous methane CH4 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . If 17.3g of carbon dioxide is produced from the reaction of 7.70g of methane and 39.3g of oxygen gas, calculate the percent yield of carbon dioxide. Be sure your answer has the correct number of significant digits in it.
Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . If 3.49g of carbon dioxide is produced from the reaction of 1.7g of hexane and 9.7g of oxygen gas, calculate the percent yield of carbon dioxide.Be sure your answer has the correct number of significant digits in it.
Gaseous methane CH4 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . If 1.10g of carbon dioxide is produced from the reaction of 0.80g of methane and 2.2g of oxygen gas, calculate the percent yield of carbon dioxide.Be sure your answer has the correct number of significant digits in it.
Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . If 1.76g of water is produced from the reaction of 1.72g of hexane and 11.7g of oxygen gas, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it.
Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . What is the theoretical yield of water formed from the reaction of 79.3g of hexane and 213. g of oxygen gas? Be sure your answer has the correct number of significant digits in it.
Gaseous methane (CH4) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H2O). If 2.59g of water is produced from the reaction of 6.58g of methane and 14.4g of oxygen gas, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it.
Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O. If 4.48g of water is produced from the reaction of 4.31gof hexane and 21.4g of oxygen gas, calculate the percent yield of water.Be sure your answer has the correct number of significant digits in it
Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . If 10.6g of water is produced from the reaction of 26.7g of butane and 46.9g of oxygen gas, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it.
Gaseous ethane CH3CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . If 26.6g of carbon dioxide is produced from the reaction of 10.2g of ethane and 63.6g of oxygen gas, calculate the percent yield of carbon dioxide. Be sure your answer has the correct number of significant digits in it.