Q: Write IUPAC and common names for ethers.
A: The IUPAC name of an organic compound is written on the basis of the certain rules laid down by…
Q: Give the IUPAC name for each ketone. C-CHCH,CH3 b. a.
A: A molecule or compound has many names. Different naming systems exist in the world. Among these…
Q: Write the chemical equation showing reactants, products and catalysts needed (if any) for the…
A: IUPAC is known as International Union of Pure and Applied Chemistry. IUPAC is used for the naming of…
Q: What is the product of a reaction between 1-bromoethane with ammonia? A. acetonitrile B. ethanamine…
A: Applying concept of nucleophilic substitution reaction.
Q: Why is H3C-O-SiH3 ether a weaker base than (CH3)3O?
A: due to Pπ-Pπ back bonding
Q: Draw and name all phenols with the formula C7H8O.
A: All are phenol with the formula of C7H8O
Q: Draw the products formed when each alcohol is dehydrated with H2SO4. Use the Zaitsev rule to predict…
A: Alcohols on dehydration forms alkene Zaitsev rule used to predict more stable product during…
Q: Give the IUPAC name for each alcohol HỌ CH3 (CH),CHCH,CHCH,CH3 CH̟CH,CH,OH CH,CHCH,CH,CH3 b. а. Но.…
A: Note: According to our guidelines we are supposed to answer only one question. Kindly repost other…
Q: Why is H3C-O-SİH3 ether a weaker base than (CH3)3O?
A:
Q: Give the IMPAC name for each compound. 1. COOH COOH 2. Br 3. CH3 CHz COOH
A: Given we know about the iupac naming rule
Q: 1. An amine is characterized by what functional group? a. -CO2CH3 b. -NH2 d. -CHO e. -OH c. -CO2H 2.…
A:
Q: Give a systematic (IUPAC) name for each diol. ) HO¬(CH2)8¬OH
A: First note the structure of given diol.
Q: Draw the products formed when propan-2-ol [(CH3)2CHOH], the main ingredient in rubbing alcohol, is…
A: The given compound is propan-2-ol. The given reagent is NaH, H2SO4 and Li+-N[CH(CH3)2]2. Since we…
Q: Give the structure corresponding to each IUPAC name. 2,4 dimethyl- 2 hexanol
A: The given compound is 2,4-dimethyl-2-hexanol.
Q: What products are formed when benzoic acid (C 6H 5COOH) is treated with each base: (a) NaOH; (b) Na…
A: When carboxylic acid compound reacts with mile alkalis then it forms salts and show considerable…
Q: 1. a secondary alkyl halide with molecular formula C4H9l 2. trans-1,2-cyclopentanediol 3. tert-butyl…
A:
Q: (d) 1-Propanol (e) 2-Propanol (f) CH3CH2CH(CO,H)2
A: (d) When 1-propanol it treated with phosphorus pentachloride, then initially chloropropane is formed…
Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…
A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…
Q: Give the IUPAC name for each the following compound: a. CH;CH2CH,C(CH3)2CH2COOH b.…
A:
Q: sodium 2-butoxide 2-butanol
A: The given alkyl halide on reaction with sodium 2-butoxide undergoes elimination reaction to give…
Q: give any two methods by which we can prepare ethers?
A: Ethers can be prepared by dehydration of alcohols.Alcohols on dehydration in the presence of protic…
Q: What is the IUPAC name of the following compound? CH;CH=CCH,CH,OH A 5-Hydroxy-3-phenylpent-2-ene B…
A:
Q: NH2 aniline trans- H. cinnamaldehyde OH 3-methylcyclohexanol CH3 diphenylmethane ethyl acetate H3C…
A: In the given question we have to identify the functional group in the following compound. 1-…
Q: When trans-2-chloro-1-cyclohexanol is treated with a base, cyclohexene oxide is the product.…
A: “Since you have asked multiple question, we will solve the first question for you. If you want any…
Q: Which compounds are acetals? || OH II IV O , I, II O I,I O II, I, IV O II, IV
A:
Q: g. 2-pentanol h. benzene i. 2-butanol 2-cyano-2-pentanol benzyl alcohol 2-butanone-semicarbazone
A:
Q: a. 1-Methylcyclopentanol b. trans-2-Methylcyclopentanol
A:
Q: 2. IUPAC name of the structure CH3CH2C o- is: a. isopropyl cyclooctanoate. b. cyclooctyl propanoate.…
A: In the naming of esters, the parent chain is taken as the chain containing carbon with double bond…
Q: 1. Name the following ether. 2. Name the following thiol. C C-C-C-C-0-C-C C d C-C-C-C-C-S-H C-C-C-C…
A: Here we have to write the IUPAC name of the following compounds.
Q: Tell whether the given compound is an alcohol, a phenol or an ether. Give the IUPAC name of each a.…
A:
Q: A) Diethyl Ether + Methylene Chloride B) Diethyl Ether + Water O C) Water + Dodecanol D) Methylene…
A: The solubility of a compound depends on the nature of the solute and the solvent. If the nature of…
Q: Identify A, B, and C, three intermediates in the synthesis of the pain reliever and anesthetic…
A: Please find below the reaction.
Q: A -NH2 NAOCH3 D Nacl
A:
Q: A PCC hexanal C D PCC 2-methylnonane 2-methyl-4-nonanol
A:
Q: Draw the structure of a compound tting each description:a. an aldehyde with molecular formula…
A: Note: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question…
Q: b. (2E)-but-2-enal c. Ortho-bromobenzaldehyde d. 2-ethylhexan-3-ol e. (3Z)-4-hydroxypent-3-enoic…
A: Since you have posted multiple questions, we will solve the first question for you. To get remaining…
Q: Give the IUPAC name for each compound. a. Он OH он он d.
A: a. First, number the carbon atoms that form the longest chain starting from the high priority side.…
Q: 2. What is the IUPAC name of the compound below? CH,CH2CH(CH3)h CH3CH2CH,CHCHCH3 ÓH A.…
A: Since you have posted multiple questions, we are entitled to answer the first only. 22) The compound…
Q: a. 2-Chloro-1-propanol or 3-chloro-1-propanol b. p-nitro phenol or p-aminophenol
A:
Q: Name the following compound. CH;-CH;-CH,-ċ-o-CH;-CH; A) ethyl propyl ether B) ethyl propanoate C)…
A:
Q: Draw compounds containing the following. A. A primary alcohol B A tertiary nitrile C. A secondary…
A: Alcohol - mean contains OH group Nitrile - contains CN group Thiol - contains SH group
Q: 1. Write the IUPAC name of the following а. CH3-CH-O-CH2-CH3 CH3 b. CНЗ-СH-CH2-SH CH3 c.…
A: 1. a. The above molecule is an ether. For the Iupac nomenclature the general name is alkoxy alkane.…
Q: Qul between. How do you Can dis tiguish (a) -Buty ne * 2-Butyne (b) 1-Butanol tur-butanol r…
A: I have given chemical tests to distinguish given compounds.
Q: Write IUPAC and common names for ethers.
A:
Q: Draw the products formed when phenol (C6H5OH) is treated with each set of reagents. a. [1] HNO3,…
A: The products formed when phenol is treated with given set of reagents has to be given.
Q: What are the major products of the reaction of ethyl benzoate with hydrochloric acid and water? a.…
A: Hydrolysis -it is a chemical reaction in which hydronium ion and hydroxide anion of water reacts…
Q: f two molecules of a 1-butanol undergo a condensation reaction, the product of the reaction must be…
A: Given -> 1-butanol
Q: OH OH OH CH2-CH-CH-CH-CH - COOH compound A CH3-CH2- CHz- CHz-CH, -COOH compound B
A: Solubility is used to measure the maximum amount of a chemical compound to dissolve into the given…
Give a systematic (IUPAC) name for each
(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OH
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 2 images
- Draw the products formed when phenol(C6H5OH) is treated with each reagent. Give an explanation. d. (CH3CH2)2CHCOCl, AlCl3 j. product in (d), then NH2NH2, – OHDraw and name all phenols with the formula C7H8O.Draw the products formed when phenol(C6H5OH) is treated with each reagent. Give an explanation. a. HNO3, H2SO4 h. product in (a), then Sn, HCl
- What product is formed when benzene is treated with each organic halide in the presence of AlCl3?Draw the structure of a compound fitting each description: a.an aldehyde with molecular formula C4H8O b. ketone with molecular formulab C4H8O c. a carboxylic acid with molecular formula C4H8O2 d. an ester with molecular formula C4H8O2Draw the products formed when phenol (C6H5OH) is treated with each set of reagents. a. [1] HNO3, H2SO4; [2] Sn, HCl b. [1] (CH3CH2)2CHCOCl, AlCl3; [2] Zn(Hg), HCl c. [1] CH3CH2Cl, AlCl3; [2] Br2, hν d. [1] (CH3)2CHCl, AlCl3; [2] KMnO4
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?
- Define the Reaction of Ethers with Strong Acid ?Draw the structure of the major products if the given compound (Compound A) reacts with BH3:THF, then, H2O2, NaOHDraw the structure of a molecule that fi ts each description: a. a 2 ° alcohol of molecular formula C 6H 12O b. a cyclic ether with molecular formula C 5H 10O c. a 1 ° alkyl halide with molecular formula C 5H 11Cl