Give names to the following compounds, and write the skeletal formula for them. 1- CH3CH2CHCHCH2CH3 2- CH2CHCH2CH2CH3 3- CH3CH2CH(CH3)CH2CH2CH3 4- C6H5F 5- CH3CH2C(CH3)2CH3 6- CH3CH2CHOHCH3 7- CH3CH2CH2CC2CH2CC12CH3 8- CH3CH2CH2CCCH2CH3 9- СНЗСH2C(Br)3 10-C5H11NH2

Q: Draw the skeletal structure of the following organic molecules. (i) 4-chloropentanal (ii)…

A: The chemical compounds are named according to the guidelines set by the IUPAC. The parent…

Q: I. Give the nomenclature or structure of the following molecules: CH3 CH3 CH3CHOCHCH3…

A: According to guidelines i can answer only first three sub parts.

Q: Name the following compound CH3 H3C CH3 а. H3C- CH2 .CH3 b. CI H3C. CH3 с.

A: The names of the compound are:             2-methoxypentane

Q: a) Draw structures for the following compounds. (i) (ii) (iii) 3-methylpent-1-ene…

A: IUPAC nomenclature :-  IUPAC (International Union of Pure and Applied Chemistry) nomenclature is…

Q: `NH2 CI H3C || CH3CHCH2CH2CN(CH2CH3)2

A: Given here two compounds and we are asked to write the IUPAC name for them.

Q: Draw structures for compounds that meet these descriptions C2H6O ; one singlet C3H7Cl ; one doublet…

A: Given information's, C2H6O ; one singlet C3H7Cl ; one doublet and one heptet C4H8Cl2O ; two…

Q: Consider the following proposed structures for benzene, each of which is consistent with the…

A: The most stable resonance structure proposed for benzene is the structure (ii). The benzene molecule…

Q: Which of the following compounds will exhibit geometric isomerism? A CH;=CHCH3 B (CH);C=CHCH; C (CH)…

A:

Q: Name the molecule and the functional groups present in the following molecule. CH3 a) CH,c-CH2 CI…

A: Since you have posted a  question with sub-parts , we are entitled to answer the first three…

Q: Name the following compounds: CH₂ (Ь) CH₂CH₂CHSH CH3 CH₂CHSCH₂CH₂ (d) (4) SH сня CHICCHCHCHCHCH CH₂…

A: Given compounds are : Give IUPAC names of these compound = ?

Q: Provide the correct systematic name for the compound shown here. CH3 CH₂CH3

A:

Q: Draw structures for compounds that meet these descriptions a. C2H6O ; one singlet b. C3H7Cl ; one…

A: The NMR spectrum provides the following details about the structure of the molecules: The number of…

Q: Name the following compounds: (b) CH₂CH₂CHSH CH3 CH₂CHSCH₂CH₂ (e) CH3 SH CH3 CH₂CCH₂CHCH₂CHCH₂ CH₂…

A: "To get remaining sub-parts solved please repost the complete question and mention the sub-parts to…

Q: Which of the following compounds exists as cis-trans isomers? Draw the structures of those that do.…

A: Double bonded carbon having both remaining vacancy is satisfied by two different groups ,then it…

Q: a) Give all the isomers represent the following compounds 1- C6H12 2-С4 Н6C12 b) To which group the…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Give the IUPAC name of the following compound: CH3CH2CHBrCHClC(CH3)2CH2CH3

A: There are certain rules to find out IUPAC name: Assigning parent chain for the compound. Longest…

Q: Consider the following hydrocarbons and identify the one which is unsaturated CH3CH2CH2CH2CH3 o…

A: We need to determine the unsaturated hydrocarbon from the given options.

Q: The number of all possible isomers having the molecular formula: C3H7CI is: Select one: O a. 4 O b.…

A: To select all possible number of isomer of C3H7Cl

Q: What is the molecular formula of the structure shown? O C13H26 O C13H28 O C13H27 C13H29

A: Requirement from question:     MF: C13H28

Q: given the information below, provide the molecular representation:  a) the line structure for…

A:

Q: CH3 H3CH2C CH,CH2CH 1. CH3 C=C H CH3

A: IUPAC naming of the given compounds.

Q: I. Describing the different functional groups Directions: Name and classify the following compounds…

A:

Q: Name the following molecules, for which the structure is given. CH,-CH3 CH,=C, CH3

A:

Q: I. Draw the structure or give the systematic name of the following: CH CH;CHCH,CCHCH; ÓH ČH2CH3 2.…

A: Given,  Given IUPAC names of the given compounds = ?

Q: a. CH3COCI and CH,CICO,H b. CH CN and CH3CO2NH, c. HCO,CH3 and CH3CO2CH3

A: A chemical test is a quqalitative or quantitative procedure carried out to identify and characterise…

Q: Give the IUPAC names for the following compounds. 1. 2. H3C-C(CH3)2CH=C-CH3 H Br 3. OH Br 4. CI CI

A: Rule of IUPAC-1) Longest chain as parent chain.2) Numbering start from those side where more prior…

Q: (a) CH3CH-C=CCOOH (b) CH3CH(CH3)CHB¡COOH (c) (CH3)½C=CHCOOH

A: Hello. Since your question has multiple sub-parts, we will solve first three sub-parts for you. If…

Q: Give the name for the following compound: H3C- H3C CH3 CH3 CH3 CH3

A: The question is based on the concept of IUPAC naming of the compound.    we have to systematically…

Q: 2. 3. CH 3 애 CH₂ CH3N 대3

A: Names for given molecules are: (1.) 3-Cyclopentene-1-carboxylic acid  (2.) 3-Methylpentanoyl…

Q: wireframe labels Which of the following represent structural isomers of the molecule shown in the…

A: structural isomerism means molecules have same number of atoms, that is their structural formula is…

Q: 1. Draw structural isomers for the following molecular formulas a) C6H14 (5 isomers) b) C3H12 (3…

A: Given,  a) C6H14 b) C5H12

Q: Give the IUPAC chemical name for the compound. Your answer will be marked incorrect if you did not…

A: Since you have posted questions with multiple sub-parts, we are entitled to answer the first 3 only.…

Q: Give the chemical names of the corresponding structures for compounds A and B. NaCN H2 /Ni 140 C…

A: Given an organic reaction. The steps are as follows:

Q: Which of the following molecules contain the same functional groups? CH;CH(NH2)CH; CH;CH2CH2NH2…

A: Note: As per our guidelines, we are supposed to answer only one question when multiple questions are…

Q: drqo two isomers and suggest the type of isomerism shown for each other of the following compound a)…

A: See answers below.

Q: CH3 CH3 CH2 (d) H3C C-c=c -CH3 CH2 ČH3 CH3 (e) co (f)

A:

Q: Give IUPAC names for the following compounds: H2C=CHC=CCH=CH2 (а) CH2CH3 CH3 H2C=HCC=HCC=CCH=ÇC=CH2…

A: We would use IUPAC nomenclature rules. For this first write numbering of carbon atoms and determine…

Q: What are two isomers for each of the following formulas - C2H7N - C4H10 - C3H8O - C4H8

A:

Q: What molecular ions would you expect for compounds having each of the following molecular formulas:…

A: The radial cation is the molecuolar ion.a.CH9Cl In the above molecule the atom Cl has 2 isotopes…

Q: Are the following compounds belong to the same homologous series? Η Η Η Η Η Η Η OH H |||||…

A: The chemical properties of an organic molecule depend mostly on the functional group. Different…

Q: Name the following compounds with functional groups

A: Functional group is a specific group of atoms or bonds within a compound that gives specific…

Q: 11. Draw full structural formulas for all the isomers of C4H8Br2.

A:

Q: Give the complete IUPAC name for each of the following compounds: a. CH3CH2CB12CH3 b. (CH3)3CCI…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Why can't molecules with the following formulas exist? CH5 C2H6N C3H5Br

A: For a molecule to exist it must be stable and it is stable only when it attains the maximum of…

Q: Name the following compounds: CH2 CH3 a) cy CH CH2CHCH2 CH, CHy CH3 b) CH CH3

A: IUPAC nomenclature: (1) Select the longest continuous carbon chain.  (2) Start the numbering from…

Q: 19. Following the rules of nomenclature, name the following compounds: a) H3C CH3 CH3 b) CH3 CH3 H,C…

A:

Q: Give IUPAC names for the following compounds: (а) CH3 (b) CH3 (c) H3C CH3 CH3CHCH2CH2CH3 CH3CH2CCH3…

A: IUPAC nomenclature Identify the longest carbon chain Identify the substituents present and assign…

Q: 1. Name the following compound properly. a) CH но H. H2C CH3 CH3

A:

Q: Write the systematic names of the following alkanes. (a)    CH3CH2CH2CH2CH3(b)    CH3−CH3(c)…

A: Hydrocarbons having no double or triple bond functional groups are classified as alkanes or…