Give the correct IUPAC name for the following compound: CH3CH2CH2CH2CH2CHCH2CH3 CH2CH2CH3 O 4-ethylnonane O 6-ethylnonane 3-propyloctane O 6-propyloctane

Q: Provide IUPAC names for the following compounds.(a) (CH3)2CHCH2CH3                          (b)…

A: Organic compounds are the compounds which are mainly composed C and H atoms. The branch of chemistry…

Q: Draw the products of the following reactions

A: a) Please find below the reaction mechanism along with the products.

Q: What is the IUPAC name for the following compound? CH2CH3 CH3 CH3CH2CH2CH2CHCHCH2 CHCH3 CH3 CHCH3

A: Select the longest chain of carbon as principle chain. Numbering Naming{ prefix+word root+suffix}

Q: What is the correct IUPAC name for the following structure: CH2=CH-CH3

A: Given : Compound  To find : IUPAC name Solution : Alkenes are unsaturated Compounds. Alkenes are…

Q: CH3 CH₂CHCH₂CH₂CH =O

A: Rule of IUPAC-   1) Longest chain as parent chain. 2) Numbering start from those side where more…

Q: Draw each molecule based on its given name а. ethyl 2-chlorobutanoate b. acetonitrile c.…

A:

Q: (CH3);CCH=CCH(CH;)2

A: Common name is the name of the compound, that is generally used. IUPAC name is the name of the…

Q: What type of alcohol is (S)-2-methylbutan-1-ol? o primary secondary o tertiary o quaternary

A: A primary alcohol is an alcohol in which the hydroxy group is bonded to a primary carbon atom. A…

Q: CH3-C=CH2 CH3-CHz- CH CH;

A: To give IUPAC name to any organic compound we must follow some rules given by IUPAC.

Q: What is the common name of the following compound? CH3 CH;CH2CHOCH3

A: The compound given is,

Q: Give the IUPAC name for the following chemical structure. H2N `NH2 1,2-Diamidepentane…

A: This is an diamine compound which contains the two amino groups. Amino group is produced by the…

Q: What is the IUPAC name of the following substance? CH2CH2CH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: H CH3O CH₂CH3 H (h) Br (i)

A: g) 2-methoxy-3-ethyl-oxirane  h) 3-Bromo oxitane  i) 1,3-dioxane

Q: What is the IUPAC name of the following substance? CH3CH2

A: The continuous chain is number in a way that the functional group (here double bond) gets the lowest…

Q: Give the correct IUPAC name for the following compound: CH3CH2CH2 CH3CCH2CH2 CH2CH3 CH3CH2…

A: We have a structure of compound, we have To decide the correct IUPAC nomenclature of the given…

Q: Give the correct IUPAC name of the following compound: ... A…

A: Common rules for IUPAC naming -  1) Identify longest carbon chain. It is called parent chain. 2)…

Q: 1. Draw structures corresponding to the following names: (a) Bromoacetone (b) (S)-2-Hydroxypropanal…

A: Bromoacetone: We know that acetone is a three-carbon ketone, and its structure is as follows: In…

Q: Give the IUPAC name of the compound below. CH3CH2CHCH2CHCH3 CH3 CH2CH3

A: Select the longest carbon chain  Assign number to each carbon according to the lowest locant rule…

Q: What is the IUPAC name of the following compound? CH3CH2CH2C-H

A: In this question, we will name the compound by according to IUPAC rule.  You can see below.

Q: NO2 HN" a) H3C- CH3 + NO2 b) + H;C CH3 →

A:

Q: What is the IUPAC name for the following compound? CI CH3CH2CH = CHCHCH2CHCH3 CH2CH3

A: IUPAC name of the organic compound is composed of the following three components:Root name = depends…

Q: Provide the IUPAC name for CH3(CH₂CH3)CH(CH₂CH3)CH3

A: The IUPAC name consists of prefix + word-root + suffix. Word root: It is the basic unit of the name.…

Q: What group does the following organic compound belong? OH CH3CHCHCH2CH3 CH2CH2CH3

A: Note : Since you have posted multiple questions, we are entitled to answer the first only as per the…

Q: Give IUPAC names for the following compounds.(a)(a) CH3 SHCH3CHCH2CHCH3

A: IUPAC names for the given compound can be shown below

Q: CH3(CH2)4CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2);COOH

A: IUPAC name of the given fatty acid:

Q: OH 1. CH;CH2CH2CHCH2CH3 2. CH3CH2CH2OCH;CH2CH3 3. H2NCCH3 4. CH3C-О- СH2CH-CHз || 5. CH3CCH2CH3

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: CH3 - CH2 - C=CCH2 -CH3

A:

Q: What is the IUPAC name of the following compound? CH2CH3 CH3CH2CHCH2OH

A: We should write the name of the compound considering the IUPAC nomenclature rules. We should…

Q: What is the IUPAC name of the following substance? CH3CH2 CH3CH2 CHCH2C=CCH3

A:

Q: Name the compound with either the IUPAC name, the common name, or both. (CH3)2CHCH2COOH

A:

Q: Give the IUPAC name for each the following compound: a. CH:CH2CH2C(CHa)2CH2COOH b.…

A: Naming of a compound is done according to rules given by IUPAC

Q: Draw the skeletal structure corresponding to each of the following names a) 4-methylheptanenitrile…

A: skeletal structure is the one in which bonds are represented as lines. It just shows the skeletal of…

Q: CH3-CHCH-c-CI CH3 CH3 CH3-CH2-CH2-CH2-C-CI

A: IUPAC name stands for International Union of Pure and Applied Chemistry.  The IUPAC of any organic…

Q: نقطة واحدة Give a common name for each compound (c) CICH2CH20CH3 إجابتك نقطة واحدة Give a common…

A:

Q: What is the IUPAC name of each of the the following? CH2CH3 NHCH CH2CH3

A:

Q: CH3– CH2 -CH2 -C=CH2 CH2CH2CH3

A: Common name - octene. Iupac name -      2- propylpent-1-ene.

Q: Give the IUPAC name for each compound. CH3 CH2CH2CH3 a. CH3 H. CH2CH2CH3

A:

Q: Give the IUPAC name for each of the following compounds:   CH3CH(CH3)CH(OH)CH2CH3

A:

Q: CH3 CH3

A: IUPAC name of given compound is :

Q: What is the IUPAC name of CH₂CH3 CH3CHCHCH₂CH₂CH₂CH₂CH3 3 CH3 O2-ethyl-3-methyloctane…

A:

Q: What is the common name of the following compound? CH3 CH3CHCH20CH3

A: The functional group in the given compound is ether having general formula - R-O-R or R-O-R'  where…

Q: Give IUPAC names for the following compounds. a) CH3CH2C(CH3)2CH3 CH3 CH2CH3 b) CH3CH2CH2CHCH2ĊCH3…

A: We have to name the IUPAC for the given following two compounds as follows in step 2:

Q: Which of the following pairs of molecules are structural isomers of each other? CH3CH2CH2CH2CH3 Br

A: Isomers are molecules with same molecular formula, but their arrangement of atoms will be different…

Q: Give both IUPAC names and common names for the following compounds. (CH3)2CHCH2COONa

A: Given compound,     (CH3)2CHCH2COONa

Q: What is the IUPAC name of the following compound? CH2CH3 CI CH2CH2CH3 Question 6 Name the following…

A: The IUPAC name of the given compound has to be given,

Q: Which type of compound does the following cyclic structure represent? OH O acetal hemiketal O ketal…

A:

Q: 2. Draw the structural formula of following compounds a) 2-chlorobutanal b) 3-bromocyclopentanone

A: There are numerous molecules in organic chemistry. Every molecule has molecular formula as well as…

Q: Draw a structural formula for the major organic product of the reaction shown. CH3CH2 CH,CH2CH3 C=C…

A: Product of following reaction is

Q: What is the IUPAC name of the following compound? CH2CH3 CH3CH,CHCH2OH

A:

Q: Give the IUPAC name for the following molecule. CH3 CH3CH2. CH2CH2CH3 CH3CH2CH2 ČH2CH3

A: The given structure is Newman's projection. The nomenclature can proceed ahead in the following…