Give the name of the following compounds according to the latest IUPAC nomenclature. (a) NH4[Co(NO)2(NCS)4] (b) [TIC3(NME3)3] (c) [Ru(CN)s]3

Q: The coordination compound [Pt(NH₃)₂(SCN)₂] displays two types of isomerism. Name the types and give…

A: This compound exhibits geometric (cis-trans) and linkage isomerism. The SCN-ligand can bond to the…

Q: Palladium(II) tends to form complexes with coordination number 4. A compound has the composition…

A: The expected complex has a central metal with a coordination number 4. It is given in the question…

Q: Draw the structures and give the stock names of complexes that can satisfy the conditon: 1.…

A: Ionization isomers in coordination complexes are identified by the ligands present outside the…

Q: If you want to use any of the [IrCl(CO)(PPh3)2] and [(η6-C6H6)Cr(CO)3] complexes as a catalyst in…

A: The given compound are organometallic compound. We know if the total electron count of the metal is…

Q: Explain in words how potassium aluminum sulfate is formed via ligand exchange. Indicate clearly the…

A: A ligand exchange reaction is a reaction which involves the substitution of one or more ligands in a…

Q: Explain the differences between weak-field and strong-field metal complexes?

A: Differences between weak-field and strong-field metal complexes:

Q: Carbon monoxide, CO, is an important ligand in coordinationchemistry. When CO is reacted with nickel…

A: Nickel tetracarbonyl is a tetrahedral compound since there are 4 ligands attached to the compound by…

Q: Hexaamminechromium(III) ion, [Cr(NH3)6]°* is a metal complex containing six ammonia ligands i. Using…

A:

Q: When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand,…

A: A metal possesses two types of valencies -  primary and secondary. The combining power of a metal…

Q: In the chemical reaction of Na2CO3 + Pb(NO3)2, the resulting product is ___________?

A: It is an example of double decomposition reaction as precipitation reaction  All salts of nitrate…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which a metal atom or ion forms coordinate bonds with the…

Q: What is the coordination number of the central metal in [Cr(acac)3] ?  The acac ligand can be…

A: Coordination number of the central metal which is Chromium in [Cr(acac)3]  is 6.

Q: Which of the following is the double-toothed l

A: Metal (M) :  electron pair acceptor  Ligand (L) : electron pair donar  Metal and ligand can form…

Q: Consider the compound (C8H8)Ru(CO)3 which is likely to be the best description of the C8H8 ligand ?

A: The stability of any organometallic compound is given by Effective Atomic Number (EAN Rule).…

Q: Hexaamminechromium(III) ion, [Cr(NH3)s]³* is a metal complex containing six ammonia ligands i. Using…

A: A question based on coordination compounds that is to be accomplished.

Q: Apply the concept of crystal-field theory to explain some of the interesting spectral and magnetic…

A: The Crystal Field Theory (CFT) is a theory for the bonding interaction between transition metals and…

Q: Draw the crystal-field energy-level diagrams and showthe placement of d electrons for each of the…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Draw the structures and give the stock names of complexes that can satisfy the conditon: 1.…

A: The given condition is: Geometric isomers of anionic complexes containing hexacoordinated Os4+ and…

Q: 3+ (d) [Cr(OH)2]6* ions are pale blue-green but chromate (Cr,O,) ion is an intense yellow in colour.…

A:

Q: (a) [Cr(II)(H2O)6]2+ and [Cr(III)(H2O)6]3+ display markedly different ligand exchange rates. Which…

A: Introduction : We have to study about ligand for these type of questions .

Q: Both H2O and ethylenediamine (en) have two nonbonding pairs of electrons. Why can en act as a…

A:

Q: The CrF6^4- ion is known to have four unpaired electrons. State and explain whether the fluoride…

A:

Q: i. State TWO (2) characteristics of a o-donor ligand. By using one example, explain how to change a…

A: A sigma-donor ligand is a ligand that acts as a Lewis base donating electrons from a lone pair to…

Q: Give the systematic name of this coordination compound. Na[Au(CN),] systematic name:

A:

Q: Explain why [FeF6]³- is colorless whereas [COF6]³- is colored but exhibits only a single band in the…

A: The ligands which produces greater splitting in d orbitals are known as strong field ligands. The…

Q: Assign oxidation states to the transition-metal ions in the following compounds: TiO2, ZrCl4, VCl3,…

A: Oxidation state indicates the degree of oxidation for an atom in a chemical compound; it is the…

Q: 3.6. Draw all possible isomers, geometrical and optical of the coordination compound…

A:

Q: The values for lmax for complex A and B are 512 nm and 650 nm respectively.  A has the structure…

A: Given S.No. Complex  Imax 1 [Co(NH3)4CO3]NO3 512 nm 2 [Co(NH3)4Cl2]Cl.  650 nm Explain the…

Q: Explain the hybrid type and geometric structure of the K3 [Cr (C204) 3] .3H2O complex with VBT.

A: oxidation number of Cr is +3  in this compound .

Q: Describe the state of hypridisation , shape and the magnetic behavior of the following complexes :…

A:

Q: Metal complex A appears blue (440 nm) and complex B appears red (670 nm). Which has a larger value…

A: When a metal complex appears blue, it absorbs the complementary color orange When a metal complex…

Q: Predict whether the carbonate ligand CO32− will coordinate to a metal center as a monodentate,…

A: A ligand is the one that donates electron to the M centre. If a ligand donate electrons from one…

Q: Pyridine (C5H5N), abbreviated py, Would you expect pyridine to act as a monodentate or bidentate…

A: Ligands are electron rich species. The electrons are donated to the central metal atom. The given…

Q: What is the coordination number of the central metal in [Co(en)3]Cl2 ?  The en (NH2CH2CH2NH2)…

A: The coordination number of Co is calculated below.  The coordination sphere is  [Co(en)3]2+

Q: For the hexacyanoferrate(III) ion, [Fe(CN)6]^3- calculate the crystal field stabilization energy…

A: Given : We have to calculate the CFSE for [Fe(CN)6]3- .

Q: What is the valence electron number and effective atomic number of the [CrCl3 (NH3) 3] coordination…

A:

Q: Explain how experimental determination of the number of geometric isomers of [Co(NH3)4Cl]2+ would…

A: Coordination chemistry is the study of compounds having a central atom attached to certain number of…

Q: [CoF6]3- absorbs 700 nm (red) radiation whereas [Co(H2O)6]3+ absorbs 600 nm (orange) radiation.…

A: The crystal field energy diagram f the given complexes is drawn as follows:

Q: What is the oxidation state of the metal centre in the [Cr(CO3)3(C6H6)] complex?

A: Explanation-       Cr(CO3)3(C6H6)] complex is the name (η 6 -benzene ) tricarbonyl chromium(0).…

Q: 2. It was stated that Co3+ complexes are very stable and the ligands in such complexes are not…

A:

Q: Suppose that you want to determine whether a ligand X is a weak-field or strong-field ligand. Would…

A: Strong field ligand are able to pair the electrons while weak field ligand are not able to pair…

Q: A coordination compound has the following composition (by mass %): 23.53% Co; 42.47% Cl, and 34.00%…

A:

Q: In [Cr(NH₃)₆]Cl₃, the [Cr(NH₃)₆]³⁺ ion absorbs visiblelight in the blue-violet range, and the…

A: In [Cr(NH₃)₆]Cl₃, the [Cr(NH₃)₆]³⁺ ion absorbs visible light in the blue-violet range, and the…

Q: Give the systematic name of this coordination compound. [(en), ]Cl, systematic name:

A: Rules for naming complex compounds :-  In coordination sphere ligands are named fist in alphabetical…

Q: When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand,…

A: Coordination number: When the metal ion in a complex is directly bonded or attached to ligand donor…

Q: Write the Werner's formula of a coordination compound called Sodium diaquatetrachlorocobaltate(Il).

A: Werner's theory tells us that metal have two valencies. They are primary and secondary valency. The…

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.