Give the proper name for each of the following compounds: (d) [Co(H2O)4]SO4   (e) [Co(NH3)4(OH2)2](BF4)5   (f) [Fe(H2O)6]Br2

Q: Rb2[Cr(O)cl5]  what is the oxidation state, coordination number, and are there any isomers for this…

A:

Q: The structure of the coordination sphere of This structure of…

A: We will choose Correct option

Q: Match the crystal field diagrams given below with the following complex ions. [Cr(NH3);Cl]²+…

A:

Q: State the oxidation state and valence shell electron configuration for the transition metals in the…

A:

Q: K4 [Fe(CN)6] O кз [Fe(CN)6] [Ni(CO)4] O [Pt(NH3)4]Cl2 O ООО

A:

Q: 4. Which of the following coordination ions is low spin? CA) [Fe(H,O).J* (B) [Co(H;O)]" (c) [FeF«]*…

A: By using the spectrochemical series , we can see the strong field and weak field ligand . On the…

Q: Determine the charge of the metal center in diaquadibromoplatinum, [Pt(H2O)2Br2] a. Draw the…

A: The given complex is diaquadibromoplatinum, [Pt(H2O)2Br2]. In this complex, the central metal ion…

Q: When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand,…

A: A metal possesses two types of valencies -  primary and secondary. The combining power of a metal…

Q: Determine the charge of the metal center in tetraamminedichloroiron, [Fe(NH3)4Cl2] a. draw the…

A:

Q: Determine the charge of the metal centre in tetraamminedichloroiron, [Fe(NH3)4Cl2] . a.Draw the…

A:

Q: What are the charge and coordination number of the central metal ion(s) in each compound of Give…

A: Coordination complexes are assigned the names according to the set of rules assigned in the…

Q: What is a transition metal in the fourth period from the following list: N, Cu, Ag, Yb?

A: Transition metals are the elements that are placed in the d-block of the modern periodic table.…

Q: Determine the oxidation state of the transition metal in: Cr2O7  Cr=

A: Let ' x ' be the oxidation number of Cr.  Oxidation number of O = -2  2x +(7×-2) =02x-14=02x=14x=7…

Q: 6. Draw CrCl2(OH2)4 + , CrCl(OH2)5 2+, and Cr(OH2)6 3+ by hand indicating the correct 3D geometry.…

A:

Q: Determine whether the following complexes are likely paramagnetic or diamagnetic. A. [Fe(CO)6]2+ B.…

A:

Q: Consider the following compound that obeys the 18-electron rule. Predict the first-row transition…

A: Here we are required to find the metal present in the complex

Q: Determine the oxidation state of each X (2nd row transition metal) and draw the structure of the…

A: GIVEN:-   Determine the oxidation state of each X (2nd row transition metal) and draw the structure…

Q: Platinum(IV) is readily complexed by ethylenediamine. Draw the structuresof both enantiomers of the…

A: Ethylenediamine (en) is a bidentate chelating ligand in coordination compounds with the two donor…

Q: Which of the following is more stable complex and why?[Co(NH3)6]3+ and [Co(en)3]3+

A: Coordination or complex compounds are usually formed by the transition metals and their stability…

Q: 3+ (d) [Cr(OH)2]6* ions are pale blue-green but chromate (Cr,O,) ion is an intense yellow in colour.…

A:

Q: If one mole of PtCl4-5NH3 reacts with AgNO, to produce three moles of AgCl(s), how can the formula…

A: The molecular formula of the given coordination compound is = PtCl4.5NH3 The coordination sphere in…

Q: Determine the charge of the metal center in diaquadibromoplatinum, [Pt(H2O)2Br2]. a.Draw the…

A: Geometrical isomers are the type of stereoisomers in which the species have same molecular formula…

Q: Write the formulas and names for the coordination isomers of[Co(en)3][Cr(ox)3]?

A:

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which there is a metal ion that forms coordinate bonds with…

Q: The structure of the coordination sphere of This structure of…

A: The compound which is asymmetrical in nature can show optical Isomerism due to the rotation of PPL.…

Q: In the solid state, [Fe(CO)5] possesses a trigonal bipyramidal structure. Predict the mass spectrum…

A: Fe(CO)5+→Fe(CO)4+ →Fe(CO)3+ →Fe(CO)2+ →Fe(CO)+ → Fe+ m/z=195       167              139…

Q: Draw the structures and label the type for all the isomers of each ion. a. (Cr(CO),(NH,),+ b.…

A: Isomers are having the same number of atoms of each element but different arrangements of atoms in…

Q: Coordination Number (explain reasoning  create a model of the cation, and draw its projection…

A: Geometric isomers are two or more coordination compounds which contain the same number and types of…

Q: How many geometric isomers does the octahedral coordination compound[Co(NH3)3Cl3] have?

A: Geometrical Isomerism in heteroleptic complexes due to different possible three dimensional spatial…

Q: A coordination compound of ruthenium, [Ru(NH3)4Cl2]Cl, has shown some activity against leukemia in…

A: Generally in a coordination complex, a central metal atom (usually transition metal) is bonded to…

Q: Why is CO a stronger ligand than Cl-?

A: The spectrochemical series is a list of ligands based on the strength of their interaction with…

Q: Which of the following complexes is paramagnetic? O [Fe(CN)6]4- O Fe(CO)5 [Co(CN)6]3- [Co(NH3)62+

A:

Q: Pyridine (CsHgN), abbreviated py, is the molecule N: (a) Would you expect pyridine to act as a…

A: Ligands Ligands in the coordinated complex is the ion or neutral molecule that act as the lewis base…

Q: Cr(CO)6 is stable while Cr(NH3)6 is not.

A: In [Cr (NH3)6]+3, unpaired electrons are present so paramagnetic. In [Co (NH3)6] +3, all electrons…

Q: Indicate the likely coordination number of the metal in each of the following complexes: (a)…

A: Coordination number is the sum of ligand atoms attached to the central atom. That means the ligands…

Q: When cobalt (II) chloride is treated, under certain conditions, with the bidentate ligand,…

A: i) Let the oxidation state of Co be x, the bidentate ligand, NH2CH2CH2NH2, is a neutral species so…

Q: Which of these compounds is expected to be colorless?           (A) K4[Fe(CN)6]          (B)…

A:

Q: Draw the geometrical isomers of complex [Co(en)2Cl2]+. (ii) On the basis of crystal field theory,…

A:

Q: Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?

A:

Q: Consider the following two ligand exchange reactions: [Co(H,0)6] + 6NH, = [Co(H,0) + 3en (Co(en),] +…

A:

Q: y8gngu. Amino acids can act as ligands toward transition metal ions. The simplest amino acid is…

A: Ligands are the electron donating neutral or anionic group that donates the atleast one electron…

Q: A coordination compound has the following composition (by mass %): 23.53% Co; 42.47% Cl, and 34.00%…

A:

Q: Write the IUPAC names of the following coordination compounds: (i) [Cr(NH3)3Cl3] (ii) K3[Fe(CN)6]…

A: Naming of coordination compounds follows certain rules. First name the cation and the anion. The…

Q: In [Cr(NH₃)₆]Cl₃, the [Cr(NH₃)₆]³⁺ ion absorbs visiblelight in the blue-violet range, and the…

A: In [Cr(NH₃)₆]Cl₃, the [Cr(NH₃)₆]³⁺ ion absorbs visible light in the blue-violet range, and the…

Q: [Cr(NH3)2(H2O)2Cl2]+  Coordination Number (explain reasoning  create a model of the cation, and…

A: Compounds having the same molecular but a different arrangement of atoms and different properties…

Q: Give the IUPAC name for this coordination compound. [Cr(H, O),CIJSO4

A: Write IUPAC name of the given coordination compound-

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.