Give the reduction organic products of the following organic molecules (shown below) treated by sodium borohydride (NaBH4) in aqueous acidic solution of hydrochloric acid. (1) 0 (2) OH LOH
Q: None
A: First, let's understand the equation we are using:ΔH°(T2) = ΔH°(T1) + ΔCp × (T2 - T1) This equation…
Q: 2. In an ionic compound with the formula unit X(NO3)2, which of the following is likely to be the…
A: To determine the likely identity of X in the ionic compound X(NO3)2, we need to understand the…
Q: I. Short Answer (24 pts total) 1. For each molecule or ion circle the appropriate letter to indicate…
A: 1. 1. AAN 2. A 2. Ordering: 1. NCH 2. 3. Dr 2.1 3. Because pyrrole's conjugate acid, pyrrole, has a…
Q: The non-polar molecule among the following is CI CI C H H Type here to search Εί prime video CI…
A: A molecule is considered polar if it has a net dipole moment, meaning that it has a positive charge…
Q: The titration of 63.00 mL M HI solution required 46.35 mL of 0.242 M NaOH to reach the endpoint.…
A: In the given reaction, NaOH reacts with HI to form NaI and H2O. The stoichiometry of the reaction is…
Q: 12 . What is the expected pH of a 0.015 M solution of boric acid (assuming 100% dissociation) ?
A:
Q: could you answer this?
A: 1. Inert Pair Effect:The inert pair effect refers to the phenomenon where the outermost ns²…
Q: (d) 2-chloro-2-methylpropane (e) 3-methyl-2-butanol 5.2 All the structures shown here have the…
A: Question 5.2 Answer: (c) and (d) are the same molecule Question 5.3Answer:
Q: Draw the major substitution products you would expect for the reaction shown below. If substitution…
A: Step 1: The structure 1 can be drawn as chair conformation 2. But in 2 , Cl is in equatorial…
Q: Kinetics tial energy d reaction: C+D his Potential energy (kJ) 2) On the graph below, draw a…
A: Step 1:Potential energy diagram is given belowPotential energies of the products are higher than…
Q: Draw the mechanism for the following reaction. synthesis of 4-chlorobenzoic acid from 4-chlorobenzyl…
A: I apologize, as an AI language model, I do not have the capability to generate or manipulate images…
Q: None
A: Let's analyze the given reaction to predict the products:CH3-N(CH3)-CH2-C(OH) +…
Q: None
A: To calculate the solubility product (K_sp) for NaCl at 25 °C, we use the Gibbs free energies of…
Q: None
A: First we need to balance the equation.B5H9(g) + O2(g) → B2O3(g) + H2O(g) To 2B5H9(g) + 12O2(g) →…
Q: Please answer in tipping format
A: Step 1:Sulphur dioxide gas is mixed with oxygen gas to give sulfur trioxideSulphur dioxide =…
Q: Draw a structural formula for the major product of the reaction shown. Br₂ -CH2CH3 H₂O
A: Step 1: Step 2: Step 3: Step 4:
Q: None
A:
Q: 2. Predict the product and draw the mechanism for the following reaction. You can write…
A:
Q: A solution of a substance with a molar absorptivity of 167 M-1cm²¹ gives a transmittance of 4.26% in…
A: The Beer-Lambert law, also known as Beer's law, is an equation that relates the attenuation of light…
Q: Please don't provide handwritten solution ...
A: Le Chatlier Principle: If a dynamic equilibrium is disturbed due to a change in the conditions, the…
Q: Draw the Lewis structure for Sio. Be sure to include all resonance structures that satisfy the octet…
A:
Q: Please don't provide handwritten solution ....
A: Ozonolysis is a method of organic chemistry where the unsaturated bonds of alkenes, alkynes, or azo…
Q: QUESTION The rate law for the following reaction is rate = k[F][CIO₂]. What is the value of k based…
A: Step 1:Step 2:
Q: What is Fourier transform? (FTIR) Find the energy of the medium intensity midrange infrared region.
A: Step 1:The Fourier Transform Infrared (FTIR) spectroscopy is a technique used to analyze the…
Q: (i) 1-Octanol can be synthesized via a reaction sequence that involves the reaction of the…
A: (i) The reaction of the Schwartz's reagent Zr(η^5-Cp)2(H)Cl with 1-heptene results in the formation…
Q: Suppose 0.163 g of lead(II) acetate is dissolved in 300. mL of a 41.0 m M aqueous solution of…
A: Molarity=molesofsolute÷volumeofsolution(L)Moles=mass÷molarmassGiven:Mass of Pb(CH3COOH)2=0.163…
Q: Please correct answer and don't use hend raiting
A: Step 1: Boiling point elevation is given by:ΔT = ((RT2)/ΔHVap) XsolHere, ΔT = Boling point…
Q: Use half-reaction potentials to predict whether the following reaction are spontaneous or…
A: Given: T=298.15K2H2S(g)+O2(g)→2H2O(l)+2S(s)Step 1: Write the half-reaction. Include the H2O,…
Q: Write the systematic name of each organic molecule: H structure O name OH H ☐ O OH OH HO ☐ H OH ☐ S…
A: IUPAC Rules for Nomenclature of organic compounds:1. Locate the longest continuous carbon chain and…
Q: QUESTION 3 a) Propose two suitable chromium reagents and conditions for each of reactions I and II…
A: Step 1: Step 2: Step 3: Step 4:
Q: 7) What is the major product in the following reaction? 1. 03 2. Zn/H₂O H₂C- H Π A) I and II B) 1…
A:
Q: Tooth enamel is composed of the mineral hydroxyapatite, Ca5(PO4)3OH which has a Ksp of 6.8 x 10-37.…
A: The problem is asking for the molar solubility of hydroxyapatite in water. Molar solubility is the…
Q: (a) Give the formal oxidation number and the d-electron count of the transition element and the…
A: In metal complexes, the central transition metal is often surrounded by ligands, which are neutral…
Q: (i) Suggest structures for the reagents and products in the boxes labelled A to H in the reaction…
A: The reaction given involves various reagents and intermediates to produce different products. The…
Q: A substance has a half-life of 2.141 minutes. If the initial amount of the substance was 307.2…
A: The first step is to determine the number of half-lives that have passed. This can be done by…
Q: integrated rate law plot for reactant A with time would give you a linear fit? 8) Given the…
A: First, we need to determine the order of the reaction with respect to reactant A. We can do this by…
Q: Nitrogen dioxide is one of the many oxides of nitrogen (often collectively called "NOx") that are of…
A: The chemical reaction of nitrogen dioxide (NO2) forming dinitrogen tetroxide (N2O4) can be…
Q: Gallium is produced by the electrolysis of a solution made by dissolving gallium oxide in…
A: Step 1:Step 2:
Q: A weather balloon is filled with 138.2 L helium at sea level where the pressure is 1.000 atm at 20.0…
A: Please see the attached image for the solution. If there are queries or if the image is not…
Q: 11) A 520 ml solution contains 0.130 M formic acid (K = 1.80 x 10+) and 0.130 M sodium formate.…
A: First, we need to determine the pH of the initial solution. This is a buffer solution, so we can use…
Q: Plz draw out the full mechanisms for problem 3!
A: Step 1: Step 2: Step 3:Step 4:
Q: Circle which of the following would be soluble in H2O
A: Step 1: Compound 1 , 2,3 can form strong hydrogen bonding with water. So they are very soluble in…
Q: Please give the correct reagents and draw the reactions
A: 1. CuBr(s): This compound is missing from the first equation. It is formed when copper reacts with…
Q: 11) A 520 ml solution contains 0.130 M formic acid (K, = 1.80 x 10) and 0.130 M sodium formate.…
A: First, we need to determine the pH of the initial solution. This is a buffer solution, so we can use…
Q: For each chemical reaction listed in the table below, decide whether the highlighted atom is being…
A: Thank you.
Q: Draw the major product of this reaction. Ignore inorganic byproducts. 1. Hg(Cl)2, H2O 2. NaBH4, NaOH…
A: Step 1: Step 2: Step 3: Step 4:
Q: Reaction mechanism
A: Step 1: Step 2: Step 3: Step 4:
Q: When the following skeletal equation is balanced under acidic conditions, What are the coefficients…
A:
Q: Pleaseeeeeee solllllllve parts 3 and 4 please sir, thanks
A: Step 1: Step 2: Step 3: Step 4:
Q: 21. (3 pts each) Draw the structure of the organic product(s) for the following chemical reactions:…
A:
Step by step
Solved in 2 steps with 1 images
- Lipoic acid is required by many microorganisms for proper growth. As a disulfide, it functions in the living system by catalyzing certain oxidation reactions and is reduced in the process. Write the structure of the reduction product.Consider the following structural formulas. OH -осн A в D E (a) Which of the compounds A-E can easily be oxidized? (b) Provide the typical oxidation products for all compounds selected in (a). (c) Explain why the compounds not selected in (a) cannot be easily oxidized.In each of the following reactions, two possible organic products can be formed. Draw both organic products in each case and then circle the one formed in greatest quantity in each case. HC (a) 1) NaH, 2) acid (b) CH,CH,OH (c) CH,CH,OH NH2 (d) O
- Give reasons for the following :(i) Phenol is more acidic than methanol.(ii) The C—O—H bond angle in alcohols is slightly less than the tetrahedral angle (190°28′).(iii) (CH3)3C—O—CH3 on reaction with HI gives (CH3)3C—I and CH3—OH as the main products and not (CH3)3C—OH and CH3—I.Predict the products of the following acid-base reactions. If the equilibrium would not result in the formation of appreciable amounts of products, you should so indicate. In each case label the stronger acid, the stronger base, the weaker acid, and the weaker base: (a) CH3CH=CH2 + NANH2 (d) CH3C=C: + CH;CH2OH → (e) CH3C=C:- + NH¾CI – | (b) CH;C=CH + NaNH2 (c) CH3CH2CH3 + NANH2 → | HASWrite the reagent or draw structures of the starting material or organic product(s) in the following reactions. If more than one product is formed, identify the major product where possible. (a) (b) HO OH OH H2SO4 ? Cl₂ ? FeCl3
- provide the structure of the intermediate and product for the following reaction : (c) H CH,OH/H (C)Bent (D) Trigonal pyramidal 5. A student wishes to prepare ethyl acetate from the reaction of ethanol and acetic acid. To be successful, this reaction requires (A) an acidic catalyst. (C) an oxidizing agent. (B) a basic catalyst. (D) a reducing agent. 6. Which alkyl halide reacts most rapidly with aqueous sodium hydroxide solution? (A) CH₂Cl (B) CH₂I (C) (CH3)3CCH₂Cl (D) (CH3)3CCH₂I 57. How many isomers are there with the formula C6H₁4?Give an IUPAC and common name for each of the following naturally occurring carboxylic acids: (a) CH3CH(OH)CO2H (lactic acid); (b) HOCH2CH2C(OH)(CH3)CH2CO2H (mevalonic acid).
- An unknown hydrocarbon Q has a formula C6H12. Q reacts with osmium tetroxide to give a diol R when oxidized with KMnQ4 in an acidic medium Q gives two products. One product is propanoic acid and the other is ketone S. Provide reaction equations to identify the possible structures of Q, R and S.(c) Arrange the following compounds in order of increasing acidity, and explain the reasons for your choice of order: phenol, cyclohexanol, 2-fluorocyclohexanol, 2-fluorophenol.Write the equilibrium-constant expressions and obtain numerical values for each constant in (a) the basic dissociation of aniline, C6H5NH2. (b) the acidic dissociation of hypochlorous acid, HClO. (c) the acidic dissociation of methyl ammonium hydrochloride, CH3NH3Cl. (d) the basic dissociation of NaNO2. (e) the dissociation of H3AsO3 to H3O+ and AsO33- just answer the letters C, D and E.