I hope you can answer both of the questions. Given the following two standard reduction half-reaction calculate what the standard cell potential(E°) in volts. Report you answer to 3 decimal places.Cr20,2 (ag) + 14H* (a0) + 6e -→2Cr3+(aq) + 7H200 (E°red. = 1.33 V)H2O2 → 02 + 2H+ + 2e- (E°red = -0.682 V)1.201-2.8611.653-1.009O 2.012-1.8342.219-2.476 If a chemist started with only 15.21 grams of K2Cr207 solid and an unlimited amount of H2O2(ag)then what is the maximum amount of work? Report your answer in kJ to 2 decimal places only.O2(g) + Cr3+H2O2(aq) + Cr20,2² (aq)(ag) --58.6766.6756.71-54.4362.1456.41-64.19-60.22

For question 1 First calculate E0cell for given data E0cell = E0cell(cathode) -E0cell(Anode) for…

Given the following two standard reduction half-reaction calculate what the standard cell potential (E°) in volts. Report you answer to 3 decimal places. Cr207 (aq) + 14H* 2Cr3+ (aq) + 7H2O0 (E°red. = 1.33 V) (aq) + 6e - H2O2 - 02 + 2H+ + 2e- (E°red. = -0.682 V) 1.201 -2.861 1.653 -1.009 2.012 -1.834 2.219 0.2476

Given the following two standard reduction half-reaction calculate what the standard cell potential (E°) in volts. Report you answer to 3 decimal places. Cr207 (aq) + 14H* 2Cr3+ (aq) + 7H2O0 (E°red. = 1.33 V) (aq) + 6e - H2O2 - 02 + 2H+ + 2e- (E°red. = -0.682 V) 1.201 -2.861 1.653 -1.009 2.012 -1.834 2.219 0.2476

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 61QAP

See similar textbooks

Similar questions

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
Consider the voltaic cell 2 Ag+(aq) + Cd(s) 2 Ag(s) + Cd2+(aq) operating at 298 K. (a) Calculate the Ecell for this cell. (b) If (cone. Cd2+) = 2.0 M and (cone. Ag+) = 0.25 M, calculate Ecell. (c) If Ecell = 1.25 V and (cone. Cd2+) = 0.100 M, calculate(cone. Ag+).
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.