Answered: given the folowing E^o, s,calculate the…

given the folowing E^o, s,calculate the standard cell potential for Ag I Ag^+II Cu^2+ I Cu if Vu^2+(aq)+2e-->Cu(s) E^o=+0.34 V AG(aq)+e^--->Ag(s) E^o=+0.80 V

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter18: Introduction To Electrochemistry

Section: Chapter Questions

Problem 18.4QAP

See similar textbooks

Related questions

Q: Q.1 (a) Calculate the emf of the cell Zn|Zn*2 (0.001M)||Ag* (0.1M)| Ag The standard potential of Ag…

Q: 5. For the following reaction at 25 °C, 5FE2+ *(aq) + MnO4 (aq) + 8H"(aq) = 5Fe*(aq) + Mn²*(aq) +…

A: Given : [Fe+2] = 0.50 M [Fe+3] = 0.10 M [MnO4-] = 0.025 M [Mn+2] = 0.015 M pH = 7.00 => [H+]…

Q: Ag | AgCl (sat’d) |NaCl (0.1 M) || KI (x M) | 12(s) | Pt

Q: Cr2O7 2- (aq) + 14H+ 6e- ---> Cr3+(aq) + 7H2O(l) Ered = 1.33V Cu2+(aq) + 2e- --> Cu(s) ?°red =…

A: For the given cell reaction the reduction potential of the electrodes is as follows: Cr2O7 2- (aq) +…

Q: Calculate the electrode potentials of the following half-cells. (a) HC1(3.50 M) H₂(0.950 atm).Pt (b)…

A: calculate the electrode potentials of given rxn

Q: 4) The Zn/Cu battery operates using the following redox reactions: + 2e → Cu) E° = 0.34V Cua Zn + 2e…

A: Zn2+(aq) + 2e- -> Zn(s) Eo = -0.76 Cu2+(aq) + 2e- -> Cu(s) Eo = 0.34…

Q: For the galvanic (voltaic) cell Fe(s) + Mn2*(aq) – Fe²*(aq) + Mn(s) (E° = 0.77 V at 25°C), what is…

Q: The following cell used to determine the concentration of AsO4 3- in one solution had the potential…

A: The schematic cell representation is : SCE || Ag3AsO4 (sat),AsO43- (xM),| Ag Oxidation takes place…

Q: 5. If you constructed a galvanic cell using an electrode X+IX connected to a standard copper…

A: In the cell or galvanic cell , if two standard half-cell electrode are connected then the resultant…

Q: Use the standard reduction potentials shown here to answer the questions. A copper, Cu(s), electrode…

A: Given data : E cell = 0.052 V

Q: at a temperature of 25 ° C the galvanic element Pt | ClO3- 0,001M, Cl- 0,01M pH = 3 || Mn2 + 0.0001M…

Q: :Using the following data .7 Fe3+ +3e- Fe E° = -0.036 V Fe2+ +2e-- Fe E° = -0.447 V The standard…

Q: Calculate the cell potential for the galvanic cell in which the reaction Cd(s) + Cu²* (aq) =…

Q: Ag/A9CI is a commonly used reference electrode in a laboratory, which can be represented as Ag/AgCl…

Q: The standard potential for the reduction of AgSCN(s) is+0.09 V. AgSCN(s) + e- ---->Ag(s) +…

A: Given that the standard potential for the reduction of AgSCN is +0.09 V. The standard reduction…

Q: at 25 ° C, the galvanic element Pt | MnO4- 0.1M, Mn2 + 0.1M, pH = 1 || Ag + 0.0001M | Ag has the…

A: Welcome to bartleby !

Q: Consider the following standard electrode potentials: Ag*(aq) + e E→ Ag(s); E° = 0.80 V Mn2*(aq) +…

A: Under standard state condition, E°cell = Ereduction - Eoxidation = 0.80 V…

Q: Calculate the standard potential, E°, for this reaction from its AG° value. X(s) + Y+(aq) x++(aq) +…

Q: If the concentration of Ag+ is 0.0115 M, the concentration of H+ is 0.355 M, and the pressure of H2…

A: The galvanic cell formed will be such that the standard cell potentialof the cell is positive.…

Q: For the galvanic (voltaic) cell Fe(s) + Mn2 (aq) - Fe2 (aq) + Mn(s) (E° = 0.77 V at 25°C), what is…

Q: What is the molar concentration of Fe3+(aq) if the cell potential was -0.3792 V and the molar…

A: According to Nernest equation- Ecell = Estdcell - 0.0591/n * log [Product/Reactant] n = No of…

Q: Calculate the electrode potentials of the following half-cells.(a) Ag+(0.0436 M)|Ag(b) Fe3+(5.34 ×…

Q: Q5/ A:Calculate the emf of the cell. Zn/Zn*(0.001M)//Ag*(0.1M)/Ag The standard potential of:(Ag/Ag")…

A: Please find your solution below : EMF of a cell is defined as the maximum potential difference…

Q: 8. Consider an electrochemical cell with upper electrode immersed in 1.0M Cu2+and silver electrode…

A: Cell potential of the cell at standard conditions i.e. 1.0 M concentration solutions is calcuated…

Q: Given the following standard reduction potentials: MnO4 (aq) + 8H*(aq) + 5 e - - Mn2*(aq) + 4 H20()…

A: The expression of Nernst equation is shown below: E =E0cell -0.0591n log Q Where; Ecell= cell…

Q: At 300 K, the standard electrode potential for Ag* | Ag electrode is 0.8 V, and the solubility…

Q: What is the cell potential (E0) for a galvanic cell formed from the following two half-reactions?…

Q: Calculate the cell potential for a cell at 29oC with a Cu2+ concentration of 0.017 M and a Zn2+…

A: Oxidation is lose of electrons. Reduction is gaining of electrons.

Q: Given the standard potentials EΘ (Cu2+,Cu) = +0.340 V andEΘ (Cu+,Cu) = +0.522 V, calculate EΘ…

A: The relationship between the change in free energy (∆G0) and the electrode potential (E0) in the…

Q: Using the following standard reduction potentials, Fe"(ag) +--Fe (ag) Ca"(ag)• 2eCd(s) E+0.77 V…

A: The standard electrode potential is the tendency of an electrode to lose or gain the electron at…

Q: 1. Write the anodic, cathodic and net cell reactions, calculate the EMF of the electrochemical cell…

A: Given: Standard reduction potential of CD = -0.40 V Standard reduction potential of Mg = -2.37 V…

Q: Calculate the standard cell potential of the following cell at 25°C: Pb(s) | Pb?+ (ag) || Cu2+ (ag)…

A: In a galvanic cell, oxidation takes place in anode and reduction takes place in cathode. Non…

Q: where the half-cells are Ag|AgNO3(aq) and Ni|Ni(NO3)2(aq), and the electrode potentials are as…

A: Standard cell potential (Eo) is the EMF of the cell when the concentrations of electrolytes is 1M ,…

Q: Consider the following electrochemical cell in which X is an unknown metal: Pt | Cl-(1 M) | Cl2( 1…

A: Here, in the given cell notation, first of all the notation has to be understood. Pt | Cl- (1 M) |…

Q: What is the expected standard cell potential for the following unbalanced reaction under basic…

A: In the given cell reaction, ferrous ion is oxidized to ferric ion. The oxidation state of iron…

Q: 26. Given the following electrode (reduction) potentials: Ag* + e --> Ag; E° = 0.80 V Zn2+ + 2e -->…

Q: Calculate

A: In this question, we want to calculate the standard cell potential of the cell Reaction. Here you…

Q: An SHE electrode has been assigned a standard reduction potential, E°, of 0.00 volts. Which of the…

Q: Calculate AG° for the following cell reaction: TI(s) | TI* (aq) || Ni²+ (ag) | Ni(s) From AG°,…

Q: The reaction 2Ag+(aq) + Cu(s) → 2Ag(s) + Cu2+(aq) was used in a galvanic cell. E°=0.46 V for this…

A: Given the chemical reaction as follows,2Ag+(aq)+Cu(s)→2Ag(s)+Cu2+(aq)E°=0.46 Vthe concentrations of…

Q: Q2:/ Calculate the emf of the cell. Zn| Zn*(0.001M) || Ag^(0.1M) | Ag The standard potential…

Q: The standard electrode potential (E°) for Daniell cell is + 1.1 V. Calculate the AG° for the…

A: The conversion of chemical energy into electrical energy is carried out by using an electrochemical…

Q: Pb2+ + 2e– → Pb ε° = –0.13 V Cu2+ + 2e– → Cu ε° = +0.34 V If the Pb2+ and Cu2+ are each 1.0 M,…

A: This problem is based on Nerst Equation For which, first we need to calculate the E°cell E°cell =…

Q: Calculate AGº for the following cell reaction: TI(s) | TI* (aq) || Pb3* (aq) | Pb(s) From AG°,…

A: Cell Reaction : 2 Tl (s) + Pb2+ (aq) -----> 2 Tl+ (aq) + Pb (s) Since for any reaction, the…

Q: 6. The above diagram shows a Galvanic constructed from Ag|AgNO3(aq) and Ni|Ni(NO3)2(aq) half-cells…

A: The half cells in the galvanic cell are Ag | AgNO3 (aq) and Ni | Ni(NO3)2 (aq). The standard…

Q: 1. Consider a cell buffered at pH 2.00 and consists of Fe2+(aq) (0.004 M), Fe3+(aq) (0.070 M) and…

A: Redox reactions in electrochemistry are characterized as chemical processes in which electrons…

Q: 2+ 2+ Based on the reaction, Sn + Cu²+ ↔ Sn² + Cu (in acidic medium) Calculate the following values:…

A: Here we are required to find the equilibrium constant and emf of cell at non standard condition

Q: Consider the following reduction potentials. Ag*(aq) + e → Ag(s) E° = + 0.80 V Sn2*(aq) + 2 e…

A: Metal having high reduction potential acts as cathode and metal having low reduction potential acts…

Q: What is the potential at 25 ° C of a cell made up of the semi-cells Zn / Zn²- and Cu / Cu²- where…

A: Welcome to bartleby !

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

100%

given the folowing E^o, s,calculate the standard cell potential for Ag I Ag^+II Cu^2+ I Cu if

Vu^2+(aq)+2e-->Cu(s) E^o=+0.34 V

AG(aq)+e^--->Ag(s) E^o=+0.80 V

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
From the standard potentials Ag2SeO4(s)+2e2Ag(s)+SeO42-E0=0.355V Ag++2eAg(s)E0=0.799V calculate the solubility product constant for Ag2SeO4.
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+