Given the standard enthalpies of formation for the following substances, determine thereaction enthalpy for the following reaction.2N2H4(g) + 2NO2(g) 3N2(g) + 4H20(g)AHrxn = ? kJSubstanceAH°, kJ/molN2H4(g)+95.4NO2(g)H20(g)+33.1-241.8Select one:a. +1,224.2 kJb. -967.2 kJ/molC. +967.2 kJ/mold. +257.0 kJ/mole. -1,224.2 kJ

Given reaction 2 N2H4 (g) + 2 NO2(g) → 3N2(g) + 4 H2O(g)∑∆H (reactants) =(2 * ∆Hf0(N2H4 (g)) + (2…

Given the standard enthalpies of formation for the following substances, determine the reaction enthalpy for the following reaction. 2N2H4(g) + 2NO2(g)3N2(g) + 4H20(g) AHxn = ? kJ %3D Substance AH, kJ/mol N2H4(g) NO2(g) +95.4 +33.1 H20(g) -241.8 Select one: a. +1,224.2 kJ b.-967.2 kJ/mol C. +967.2 kJ/mol d. +257.0 kJ/mol e. -1,224.2 kJ

Given the standard enthalpies of formation for the following substances, determine the reaction enthalpy for the following reaction. 2N2H4(g) + 2NO2(g)3N2(g) + 4H20(g) AHxn = ? kJ %3D Substance AH, kJ/mol N2H4(g) NO2(g) +95.4 +33.1 H20(g) -241.8 Select one: a. +1,224.2 kJ b.-967.2 kJ/mol C. +967.2 kJ/mol d. +257.0 kJ/mol e. -1,224.2 kJ

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 77E: Give the definition of the standard enthalpy of formation for a substance. Write separate reactions...

See similar textbooks

Similar questions

The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
What is the difference between the enthalpy of reaction and the enthalpy of formation? For what chemical reaction(s) are the two quantities the same?
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
A 250-g sample of water at 20.0C is placed in a freezer that is held at a constant temperature of 20.0C. Considering the water as the system, answer the following questions: a What is the sign of qsys for the water after it is placed in the freezer? b After a few hours, what will be the state of the water? c How will the initial enthalpy for the water compare with the final enthalpy of the water after it has spent several hours in the freezer? d What will the temperature of the water be after several hours in the freezer?
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
Calcium oxide, CaO, is prepared by heating calcium carbonate (from limestone and seashells). CaCO3(s)CaO(s)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation. The Hf of CaO(s) is 635 kJ/mol. Other values are given in Table 6.2.
The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
Sodium carbonate, Na2CO3, is used to manufacture glass. It is obtained from sodium hydrogen carbonate, NaHCO3, by heating. 2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation (Table 6.2).
The octane number of gasoline is based on a comparison of the gasolines behavior with that of 2,2,4-trimethylpentane, C8H18(), which is arbitrarily assigned an octane number of 100. The standard enthalpy of combustion of this compound is 5456.6 kJ/mol. (a) Write the thermochemical equation for the combustion of 2,2,4-trimethylpentane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of 2,2,4-trimethylpentane.
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.