How is the process that occurred in the dialysis tubing different from the osmosis that occurs in cells?

Q: present in the beaker? (hint: 1 mole Cl: 1 mole AgCl, 1 mole Cl: 1 mole NaCl, 1 mole Cl: 1 mole KCI)…

A:

Q: Shown below is one of the chair conformations of trans-1-bromo-3-methylcyclohexane, a disubstituted…

A:

Q: What is the bond angle and hybridization at the triple-bonded carbon atom in the following compound?…

A:

Q: What types of intermolecular forces are present in this compound? O London dispersion, dipole-dipole…

A: The attraction forces between the different molecules are known as intermolecular forces. In general…

Q: Please draw a more stable resonance form for each of the following, and explain why it is more…

A:

Q: 3-chloro-6,7-dimethyloct-1-ene and (E)-1-chloro-5,6-dimethylhept-2-ene are primary and secondary…

A: Unimolecular nucleophilic substitution reaction (SN1): This reaction proceeds in two steps. The…

Q: 5. a student What would the collects 45.0mL of 1/₂ gas at 19°c and 104. zela. volume of this amount…

A: Given that -  Volume of H2 gas = 45.0 mL  Temperature = 19°C = 292 K  Pressure = 104 kPa…

Q: 0 B, A, C o A, C, B O C, B, A O C, A, B Н Н Н Н -C H H с. Н H C Н Н с T Н (A) о (В) -Ö-H Н (C) H C Н…

A:

Q: Activity 4.1. Identifying the geometry of compounds Directions: Complete the following table Formula…

A: Lewis structure represent arrangement of electrons in a species. It follows octet rule.

Q: Consider the reaction PO + DONG PODONG, determine the reaction order for each component and the rate…

A: The rate law of a reaction can be given by the change in concentration of product to the change in…

Q: H8. The enthalpy of vaporization of benzene, C6H6(l) is 33.9 kJ/mol at 298 K. How many liters of…

A: Given

Q: explain why the intensity of the colours of the three complexes, which can be measured by their…

A:

Q: In his experiment, Jireh wanted to determine the molar mass of his unknown sample. Based on his…

A:

Q: Which of the following is NOT standard temperature or pressure? 760 Torr 101.3 kPa 760 atm 273.15 K

A: Standard temperature and pressure are standard set of condition for experimental measurements to be…

Q: Module 2b: How much NaOH (in g) will * be needed to form a 1000L 100 ppm solution? 10 O 100 O 1000…

A: Given, Note: 1 ppm = 1 mg/L Concentration of the solution = 100 ppm = 100 mg/L Volume of the…

Q: write true if the statement if correct and change the bold word/phrase to make it correct the…

A: We have to identify whether the statement is true or not

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: What is the relation between the two molecules shown below? Darvon, a pain-relieving opioid A) The…

A:

Q: Caffeine (CH₁N4O₂) is a weak base that is related to ammonia. For the purposes of this question, we…

A:

Q: 9. Nitric oxide, NO, reacts with hydrogen to give nitrous oxide, N₂O, and water. 2NO+H ------> N,O +…

A:

Q: In his experiment, Ana wanted to determine the molar mass of his unknown sample. Based on his data,…

A:

Q: Which of the following is the most significant resonance structure? H₂CNN H₂CNN H₂ON: II III I O II…

A: Each atom should obey octet rule except H Negative charge can be stalilized by most electronegitive…

Q: 1) 3) 5) Br CN SH OH

A: o NH2 is ortho/para directing o Alkoxide reacts with alkylhalide to produce ether o Na2S reacts with…

Q: Question 8 Assign the R or S configuration for two stereocenters in the following molecules H H CI…

A:

Q: If the half-life of compound FUSHA is 131 years, assuming that a 500g sample of meteorite containing…

A:

Q: Specify the reagent you would use in each step of the following synthesis: H step 1 step 2 Reagents…

A:

Q: a) determine the oxidation state, d electronic configuration and spin-only magnetic moment of…

A: According to Q&A guidelines of Bartleby, we are supposed to answer only the first question out…

Q: OH SH +

A: Here we have to synthesize the following given compounds by multistep reactions.

Q: Consider the reaction PO + DONG → PODONG, determine the reaction order for each component and the…

A:

Q: (c) Another alkene is propene, C.H. Describe the mechanism for the addition reaction of propene with…

A: Given,  The addition reaction of propene (C3H6 ) with Br2 is:

Q: Using Curved Arrow Formalism, what is the reaction of 1-chloro-1-methylcyclopentane treated with…

A: Given in following question reaction write curve arrow machenism 1 chloro 1 methylcyclopentane…

Q: Calculate final Volume 3.0 %% (m/v) CaCl2 solution prepared from 17 mL of a solution that is…

A:

Q: A buffer solution is 0.372 M in NaHC204 and 0.323 M in Na2C₂O4. If K₂ for HC204 is 6.4E-5, what is…

A: [NaHC2O4] = 0.372 M [Na2C2O4] = 0.323 M Ka = 6.4 x 10-5

Q: The skeletal formulae of two compounds with molecular formula CH₁₂O are shown below. a OH OH…

A: Boiling point is the temperature at which vapor pressure of liquid become equal to atmospheric…

Q: name the alkene product obtained on dehydration of each of the following alcohols: 1-Butanol…

A:

Q: In the lab you find a stock solution of nitric acid (HNO3) with no label, and you have been tasked…

A: The prepared solution has a concentration of 0.5 M . This prepared solution is made by using 25 mL…

Q: A sample of xenon gas at a pressure of 0.806 atm and a temperature of 27.7 °C, occupies a volume of…

A:

Q: The reaction below has Kp = 8.90 at 25°C. Br₂(g) + Cl₂(g) = 2 BrCl (g) If a sealed container…

A:

Q: Problem 2. What are products formed from the below reaction? Draw the stereoisomers and name them.…

A: Markonikoffs rule state that positive part goes to that carbon of double bond which have maximum…

Q: 6 Which of the following compounds has both optical and E-Z isomers? A CH₂CH=CHCH₂CH3 B…

A: We have to tell among the given which one has both the optical and E-Z isomers. The given compounds…

Q: explain why [CoBr4]^-2 is green while [Co(NH3)6]^2+ is orange

A: Given,  Explain why [CoBr4]^-2 is green while [Co(NH3)6]^2+ is orange ?

Q: stereochemistry t...docx stereochemistry t....docx stereochemistry t...docx CHEM212 SPECTROSCOPY…

A:

Q: tify the types of strain present in this conformer. "Me" stands for "methyl". HMe -H Me e porsional…

A: Methyl group is composed of one carbon atom and three hydrogen atoms.

Q: (d) Propene can polymerize to form poly(propene). (i) State, with a reason, the atom economy for…

A:

Q: Assign the absolute configuration of the asymmetric carbon in this structure as R or S. Br OS o…

A:

Q: 9. Nitric oxide, NO, reacts with hydrogen to give nitrous oxide, N,O, and water. 2NO+H₂> N₂O + H₂O…

A:

Q: 13. How many stereoisomers does the following structure have? OH HC. CH3 a. 6 Ob.4 О с. 3 Od.2 OH OH

A: Chiral carbon: The sp3 hybridized carbon atom that is attached to the four different types of atoms…

Q: Determine the mass (grams) of a nonvolatile, nonionizing compound that must be added to 1367.8 g of…

A:

Q: 9. A fish company delivers 22 kg of salmon, 05.5 g of crab, and 300.48 mg of oysters to your seafood…

A: Conversion factor used in this question is, 1g=0.001 Kg 1 mg=0.000001 Kg 1 pounds=0.454 Kg

Q: Which of the following is/are correct resonance structure(s) for compound A? 11 O III and IV OI and…

A: During resonance there is only movement of electrons while the position of atom remains constant