Answered: How many total atoms are in 0.50 moles…

Science

Chemistry

How many total atoms are in 0.50 moles of CO2? A:3.01 x 10^23 B:6.02 x 10^23 C:9.03 x 10^23 D:1.20 x 10^24

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter5: Stoichiometry

Section: Chapter Questions

Problem 56E: What mass of compound is present in 5.00 moles of each of the compounds in Exercise 52?

See similar textbooks

Related questions

Q: 15. How many O atoms are in 2.00 g Al₂O3 ? Al = 26.98 g/mole, O = 16.00 g/ mole 3.54 x10exp22 O…

Q: How many molecules of carbon tetrachloride are present in 2.04 moles of this compound? _______…

A: Given: 1. Moles of carbon tetrachloride is 2.04 moles 2. Molecules of carbon tetrachloride is…

Q: how many ions or atoms of each element are in 160.5 g of the following substances? a) H2 _?_ x1025…

Q: How many molecules are in 0.200 g CO2? C= 12.01 g/mole and O = 16.00 g/mole

Q: For items 1 and 2: 4NH3 + 302 6H2O + 2N2 1. What is the mole ratio of NH3 to H2O? 2. What is the…

Q: 0.4 moles of calcium carbonate contains how many carbon atoms? A. 1.2 x 1023 B. 4.8 x…

A: The formula of calcium carbonate = CaCO3 Molecular weight of CaCO3 is 100 gm/mol 1 mole CaCO3 =…

Q: 39. Calculate the number of molecules present in each of the following samples. a. 4.75 mmol of…

Q: The number of hydrogen atoms in 0.050 mol of C3H3O3 is A) 3.0 x 1022 H atoms. D) 4.8 x 1023 H atoms.…

A: Interpretation: The number of hydrogen atoms in 0.050 mol of C3H8O3 is to be determined.

Q: How many hydrogen atoms are present in 4.5 moles of C6H6? 1.6 x 1025 H atoms 4.5 x 1023 H atoms 27 H…

A: Solution -

Q: Calculate the number of moles of propane molecules, C3H8 C 3 H 8 , present in a sample containing…

Q: How many molecules of sulfur tetrafluoride are present in 3.45 moles of this compound? molecules…

A: Moles of sulphur tetrafluoride=3.45mol

Q: 41. 0.8 moles of ferrous phosphate contains how many oxygen atoms? A. 3.2 x 1024 B.…

Q: Complete the table. Element Moles Number of Atoms Cr 9.61 × 1023 Fe 1.52 x 10-5 Ti 0.0365 Hg 1.09 ×…

A: We know that , 1 mole = 6.022 × 1023 atoms .....(1)…

Q: For items 3 and 4: SIO2 + 4HF SİF4 + 2H2O 3. What is the mole ratio of HF to SIF4? 4. What is the…

A: Number of moles is calculated by dividing given mass with molecular mass.

Q: B. Calculate the number of moles contained in each of the following samples. 13) 1.06 x 1025 atoms…

A: Since you have posted a question with sub-parts , we are entitled to answer the first three…

Q: How many H atoms are present in 8.3 g of H 2 ? O a. 2.5 x 1024 atoms O b.6.02 x 1023 atoms O c. 10.0…

A: Given Mass = 8.3 g

Q: Given 6Li + N2 0 2 Lİ3N, Determine the number of moles of lithium required to make 46.4 g of lithium…

A: 6Li + N2 = 2Li3N Atomic mass of Li is 6.94 g. Molar mass of Li3N is [ (3×6.94)+14] = 34.83 g. 2…

Q: How many atoms are in 1.50 moles of helium (He)? a 2.50 x 1022 atoms He b 9.03 x 1023 He atoms…

Q: Consider a sample containing 0.750 mol0.750 mol of a substance. How many atoms are in the sample if…

A: The number 6.022 × 1023 indicates the number of atoms or molecules in a mole of any substance is…

Q: How many oxygen atoms are present in 3,0 x 1023 molecules of Ca(NO3)2? A. 6.0 x 1023 B. 1.5…

A: 1 molecule of Ca(NO3)2 have 6 oxygen atoms as NO3 have 3 oxygens and (NO3)2 will have 3 x 2 = 6…

Q: How many moles of phosphate ions are present in a sample that contains 2.13 moles of iron(II)…

Q: How many moles is each of the following? 15.5 g SiO2 0.0688 g AgCl 5.96 g KOH 937 g Ca(C2H3O2)2

A: Number of moles = mass molar mass

Q: What is the mass of 2.2 x 10 ° CO 2 molecules? O a. 1.0 x 10-12 g O b.1.6 x 10-13 g O. 12x 106 g O…

Q: How many moles are equal to 4.5 x 1023 molecules of carbon monoxide? (Round to two decimal places).

A: No of CO molecules = 4.5 × 1023 molecules No fo moles = to be determined

Q: 4.39 x 10^27 P4 O10 molecules = Atoms

Q: 39. Calculate the number of molecules present in each of the following samples. a. 4.75 mmol of…

A: To solve this problem we have to calculate the number of molecules of the given sample .

Q: The molecular formula for paracetamol is C3H,NO2. How many moles of C atoms are present in a 10.0 g…

A: Molecular formula of paracetamol is C8H9NO2 Molecular weight of paracetamol is = 8 carbon atom = 8…

Q: MgCl₂(aq) + Na₃PO₄(aq) → Mg₃(PO₄)₂(s) + NaCl(aq) calculate the moles of MgCl₂ that will be required…

Q: Avogadro’s number is defined as the number of atoms in exactly 12 g of carbon-12. the number of…

A: Which one of the following is correct

Q: 17. Consider the following generalized chemical reaction. 6A +3B → 5C If 5.00 moles of A are reacted…

Q: How many moles of pentane (C 5H 12) are contained in the following number of molecules? a. 5.00 × 10…

A: Hello. Since your question has multiple sub-parts, we will solve the first three sub-parts for you.…

Q: The molecular formula for paracetamol is C3H9NO2. How many moles of C atoms are present in a 10.0 g…

Q: Which one of the following is not equivalent to one mol of the substance? O 8.0 g He O 6.02 x 1023 C…

A: The correct option is:

Q: I. N203 containing 0,6 mole oxygen atoms. II. CO2 containing 6 grams of carbon III. C2H4 containing…

Q: A cylinder of nitrogen gas (N2) weighs 550 grams. How many moles of nitrogen are present in the…

A: Molar mass of N2 = 28.0 g/ mol

Q: Given 6Li + N2 0 2 LI3N, Determine the number of moles of lithium required to make 46.4 g of lithium…

A: As per our company guidelines we are supposed to answer only one question. kindly repost other…

Q: Ethanol has a molecular formula of CH3CH2OH. 1.) What is the molar mass of ethanol? 2.) What is the…

A: 1) molar mass = sum of atomic mass of each atom present in the molecule Since in ethanol we have 2…

Q: B. Calculate the number of moles contained in each of the following samples. 13) 1.06 x 1025 atoms…

A: Number of moles = number of atoms of a particular element/Avagadro's number Avagadro's no. (NA) =…

Q: How many moles are equal to 1.20 x 1024 atoms of sulfur (S)? Round to 2 decimal places. a 0.20 b…

Q: The Haber-Bosch process involves the combination of nitrogen and hydrogen at high temperatures in…

Q: How many bananas are in0.10 moles of bananas? O 3.0 x 1023 O 3.0 x 10 21 O 6.0 x 1022 O 6.0 x 1024

Q: How many moles of each element are present in two moles of the compound? a. CH;COOH b. Al(NO3)3

A: To calculate the number of mole of atoms first of all we calculate the number of atoms of each…

Q: (a) What is the difference between adding subscript 2 to the end of the formula for CO to give CO2…

A: A question based on general chemistry, which is to be accomplished.

Q: Which one of the following is not equivalent to one mol of the substance? O 65.39 g Zn O 55.85 g Fe…

Q: Elements B and N form a binary compound BxNy. When 12 grams of this compound was made from its…

A: Empirical formula of a compound is the simplest positive integer ration of atoms present in the…

Q: 51 Caffeine Caffeine, found in coffee, tea, chocolate, cola beverages is a highly popular stimulant…

Q: Calculate the number of moles of aluminum oxide in 6.83g Al2O3

A: Stoichiometry is mainly based on the calculation of moles and volumes. These two values are used to…

Q: 39. Calculate the number of molecules present in each of the following samples. a. 4.75 mmol of…

A: We know that for 1 mole of any chemical compound/species,there are Avogadro's number of molecules…

Q: how many grams of Ca 3N 2 can be formed

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

100%

How many total atoms are in 0.50 moles of CO2?

A:3.01 x 10^23

B:6.02 x 10^23

C:9.03 x 10^23

D:1.20 x 10^24

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

In a chemical reaction, the total number of atoms present after the reaction is complete is (larger than/smaller than/the same as) the total number of atoms present before the reaction began.
alculate the number of moles of the indicated substance present in each of the following samples. l type='a'> 1.28 g of iron(II) sulfate 5.14 mg of mercury(II) iodide 9.21 µg of tin(IV) oxide 1.26 lb of cobalt(ll) chloride 4.25 g of copper(II) nitrate
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Interconvert between mass, number of molecules, and number of moles.
What mass of compound is present in 5.00 moles of each of the compounds in Exercise 52?
Consider the following diagram, where atom X is represented by a square and atom Y is represented by a circle. (a) Write the equation for the reaction represented by the diagram. (b) If each circle stands for a mole of Y and each square a mole of X, how many moles of X did one start with? How many moles of Y? (c) Using the same representation described in part (b), how many moles of product are formed? How many moles of X and Y are left unreacted?
For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?
Considering your answer to Exercise 79, which type of formula, empirical or molecular, can be obtained from elemental analysis that gives percent composition?
Calculate the number of molecules present in each of the following samples. l type="a"> 4.75 mmol of phosphine, PH3 i>4.75 g of phosphine, PH3 i>1.25102 g of lead(II) acetate, Pb( CH3 CO2)2 i>1.25 X 10 2 moles of lead(II) acetate, Pb( CH3 CO2)2 i>a sample of benzene, C6H6 , which contains a total of 5.40 moles of carbon