In a calorimetry experiment, O.0242 g of calcium metal are added to 20.7 mL of 0.405 M hydrochloric acid, initially at 20.32°C, in an insulated container. What is the final temperature of the solution after the reaction? (Assume the density and specific heat of the acid solution are the same as those of water, 1.00 g/mL and 4.184 J g1°c-1 respectively, and neglect the heat capacity of the container.)

In a calorimetry experiment, O.0242 g of calcium metal are added to 20.7 mL of 0.405 M hydrochloric acid, initially at 20.32°C, in an insulated container. What is the final temperature of the solution after the reaction? (Assume the density and specific heat of the acid solution are the same as those of water, 1.00 g/mL and 4.184 J g1°c-1 respectively, and neglect the heat capacity of the container.)

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter12: Thermodynamic Processes And Thermochemistry

Section: Chapter Questions

Problem 14P

See similar textbooks

Similar questions

In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
Nitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
Consider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
When 50.0 g of 0.200 M NaCl(aq) at 24.1 C is added to 100.0 g of 0.100 M AgNO3(aq) at 24.1 C in a calorimeter, the temperature increases to 25.2 C as AgCl(s) forms. Assuming the specific heat of the solution and products is 4.20 J/g C, calculate the approximate amount of heat in joules produced.
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
Nitrogen gas is confined in a cylinder with a movable piston under a constant pressure of 9.95 104 Pa. When 695 J of energy in the form of heat is transferred from the gas to the surroundings, its volume decreases by 1.88 L. What is the change in internal energy of the gas?
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?