Iron and water react to form iron(III) oxide and hydrogen, like this: 2 Fe(s)+3 H,O(g)-Fe,03(s)+3 H,(g) At a certain temperature, a chemist finds that a 3.9L reaction vessel containing a mixture of iron, water, iron(III) oxide, and hydrogen at equilibrium has the following composition: compound amount Fe 4.37 g H,O 2.75 g Fe,0, 4.17 g H2 2.03 g Calculate the value of the equilibrium constant K, for this reaction. Round your answer to 2 significant digits. K = 0 回国国回

Iron and water react to form iron(III) oxide and hydrogen, like this: 2 Fe(s)+3 H,O(g)-Fe,03(s)+3 H,(g) At a certain temperature, a chemist finds that a 3.9L reaction vessel containing a mixture of iron, water, iron(III) oxide, and hydrogen at equilibrium has the following composition: compound amount Fe 4.37 g H,O 2.75 g Fe,0, 4.17 g H2 2.03 g Calculate the value of the equilibrium constant K, for this reaction. Round your answer to 2 significant digits. K = 0 回国国回

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 60QRT

See similar textbooks

Similar questions

At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
A mixture of 0.0565 mol phosphorus pentachloride, PCl5, and 0.0800 mol helium gas, He, was placed in a 1.000-L flask and heated to 250.0C. The phosphorus pentachloride decomposes at this temperature to give phosphorus trichloride, PCl3, and chlorine gas, Cl2. The helium gas is inert. PCl5(g)PCl3(g)+Cl2(g) What is the partial pressure of helium in this equilibrium mixture at 250.0C? At equilibrium, the total pressure is found to be 6.505 atm. What is Kc for the dissociation of PCl5?
12.101 An engineer working on a design to extract petroleum from a deep thermal reservoir wishes to capture toxic hydrogen sulfide gases present by reaction with aqueous iron(II) nitrate to form solid iron(II) sulfide. (a) Write the chemical equation for this process, assuming that it reaches equilibrium. (b) What is the equilibrium constant expression for this system? (c) How can the process be manipulated so that it does not reach equilibrium, allowing the continuous removal of hydrogen sulfide?
At 500C, k for the for the formation of ammonia from nitrogen and hydrogen gases is 1.5105. N2(g)+3H2(g)2NH3(g)Calculate the equilibrium partial pressure of hydrogen if the equilibrium partial pressures of ammonia and nitrogen are 0.015 atm and 1.2 atm, respectively.
12.103 Methanol, CH3OH, can be produced by the reaction of CO with H2, with the liberation of heat. All species in the reaction are gaseous. What effect will each of the following have on the equilibrium concentration of CO? (a) Pressure is increased, (b) volume of the reaction container is decreased, (c) heat is added, (d) the concentration of CO is increased, (e) some methanol is removed from the container, and (f) H2 is added.
The following two diagrams represent the composition of an equilibrium mixture for the reaction A2 + B2 2AB at two different temperatures. Based on the diagrams, is the chemical reaction endothermic or exothermic? Explain your answer using Le Chteliers principle. (A atoms are red and B atoms are green in the diagrams.)
. Gaseous phosphorus pentachloride decomposes according to the reaction PCl5(g)PCl3(g)+Cl2(g)The equilibrium system was analyzed at a particular temperature, and the concentrations of the substances present were determined to be [PCl5]=1.1102M,[PCl3]=0.325M. and [Cl2]=3.9103M. Calculate the value of K for the reaction.
You place 0.600 mol of nitrogen, N2, and 1.800 mol of hydrogen, H2, into a reaction vessel at 450C and 10.0 atm. The reaction is N2(g)+3H2(g)2NH3(g) What is the composition of the equilibrium mixture if you obtain 0.048 mol of ammonia, NH3, from it?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?