Many applications of electrochemistry have been in chemical analysis. Suppose a Fe|Fe+ concentration cell is set-up in which the [Fe2*] = 1.0 x 10 M in one compartment but the concentration in the other compartment is unknown. The Ecell was measured at o.024V when the half-cells were connected. (i) Without doing a numerical calculation, is the unknown more or less concentrated than the 1.0 x 10 ² M solution? Justify your answer (ii) Calculate the unknown concentration. (iii) Does your calculated answer agree with your original answer? Why?

Many applications of electrochemistry have been in chemical analysis. Suppose a Fe|Fe+ concentration cell is set-up in which the [Fe2*] = 1.0 x 10 M in one compartment but the concentration in the other compartment is unknown. The Ecell was measured at o.024V when the half-cells were connected. (i) Without doing a numerical calculation, is the unknown more or less concentrated than the 1.0 x 10 ² M solution? Justify your answer (ii) Calculate the unknown concentration. (iii) Does your calculated answer agree with your original answer? Why?

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 115AE: The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making...

See similar textbooks

Similar questions

The following cell was found to have a potential of —0.492 V: Ag|AgCl(sat’d)||HA(0.200 M),NaA(0.300 M)|H2(1.00 atm),Pt Calculate the dissociation constant of HA, neglecting the junction potential.
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
At what pH does Ecell = 0.00 V for the reduction of dichromate by iodide ion in acid solution, assuming standard-state concentrations of all species except H+ ion?
The cell Ag|AgCl(sat’d)||H+(a = x)|glass electrode has a potential of —0.2094 V when the solution in the right-hand compartment is a buffer of pH 4.006. The following potentials are obtained when the buffer is replaced with unknowns: (a) —0.2806 V and (b) —0.2132 V. Calculate the pH and the hydrogen ion activity of each unknown. (c) Assuming anuncertainty of 0.001 Vin the junction potential, what is the range of hydrogen ion activities withinwhich the true value might be expected to lie?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)