Name each alkane using the ball-and-stick model, and classify each carbon as 1°, 2°, 3°, or 4°.

Q: Indicate whether each statement is true or false. (a) Alkanesdo not contain any carbon–carbon…

A: Hi, since there are multiple sub - part questions posted, we will answer first three sub - parts. If…

Q: 1. Write the correct IUPAC names for the following organic compounds: a) b) c) d) e)…

A: Rules in IUPAC naming for Organic molecules : Select the longest and continuous carbon chain as…

Q: Pentane has a [Select] hexane has a [Select] Butane has a [Select] pentane has a [Select] pentane is…

A: Here we are required to compare the solubility and boiling point of various organic compound

Q: .Which compound is an ester? a) CH3-CH2-0-CH3 b) CH,-CH,-ċ-OH c) CH;-C-CH, d) CH;-C-0-CH,CH3

A: Ester is a functional group in organic compounds formed by the reaction of carboxylic acid and…

Q: Name each alcohol. а. CH, — CH,—CH,—оН CH,-CH3 b. CH, — сH—сH, —сн—сн, OH CH CH3 c.…

A: Alcohols are the organic compound in which at least one Hydroxyl group, -OH is attached with…

Q: Draw 2- methyl propyl

A: -yl subscript is used for the function groups of --alkyl( Cn H2n+1 ).

Q: Classify each alkyl halide and alcohol as 1°, 2°, or 3°. (see attached file)

A: Given alcohols and halides,

Q: Draw a complete structure for each alkene or alkyne. a. CH2 CHCH2CH3 b. CH3C CCH2CH3

A:

Q: Convert propan-2-ol [(CH3)2CHOH] into each compound. You may use any other organic or inorganic…

A:

Q: 1- Give its all structural formulas for all possible derived structural isomers, 2- their IUPAC…

A: The question is based on the concept of structural isomerism. compounds having same molecular…

Q: Name each alkane using the ball-and-stick model, and classify each carbon as 1°, 2°, 3°, or 4°.

A:

Q: For each compound, identify as a 1°, 2,° or 3° alkyl halide.

A:

Q: Classify each alcohol as 1 °, 2 °, or 3 °

A: If the 'C' atom attached to the -OH group is further attached to only one alkyl (R) group, then it…

Q: Classify each alkyl halide as 1°, 2°, or 3°. CH3 c. CHg-C-CHCH3 ČH3 ČI CH;CH2CH,CH,CH2-Br b. d. a.

A: In a primary alkyl halide (1o), the carbon that is attached to the  halogen is directly bonded to…

Q: 6. Name the compound. CH;-C=C-ÇH-CH, CH3 a) 4-methyl-2-pentyne b) 2-methyl-3-pentyne c)…

A: While naming an organic compound, first we need to identify the parent hydrocarbon chain as well as…

Q: Name each alkene and show the configuration about each double bond using the cis,trans system

A: Name of this given alkene is given in step 2

Q: I. Write the IUPAC name of each organic compound. Structure Ç1 NH2-C-CH-C-СН 2-О-СH2-СНЗ 1.…

A: We are authorized to answer three subparts at a time, since you have not mentioned which part you…

Q: For each alkane: (a) classify each carbon atom as 1°, 2°, 3°, or 4°; (b) classify each hydrogen atom…

A: If the carbon is bonded or attached to only one carbon, then the carbon is said to be primary…

Q: Name each disubstituted benzene. Br b. CH;-CH3 a. с. CI `CH;-CH3 Br

A: Given structures,

Q: Draw 2- methylhexane

A: First we will draw parent chain of carbon. Then add branches in the chain to get required molecule.

Q: Draw the structure of each compound using solid lines, wedges, and dashes to indicate the three-…

A: The structure of the compound has to be given,

Q: What is the circled functional group: CI H2 H2 C. CH CH3 H;C H2 O Alkyl halide O Alcohol Thiol…

A:

Q: The general formula for the alkene series is: C nH 2n + 2 C nH 2n C 2nH n - 2 C nH 2n - 2

A:

Q: Give the IUPAC name for each substituted benzene.

A: Since you have posted multiple sub-parts, the answer for first three sub-parts are given below.…

Q: Classify each compound based on whether it contains an aromatic ring or a cycloalkane or cycloalkene…

A: Aromatic ring  Cyclic Planar (all atoms of ring lie in a plane) Follows (4n+2)π Huckel's rule  π…

Q: Provide IUPAC names for each structure below H. CH3 H H.

A: The IUPAC (International Union of Pure and Applied Chemistry) nomenclature is used to names the…

Q: Which compound corresponds to a saturated hydrocarbon? A) 2-butyne B) cyclooctene C) 3-hexene D)…

A: Saturated hydrocarbons are hydrocarbons in which all the carbons are bonded to other atoms by a…

Q: For each alkene write the correct IUPAC name 2. 3.

A:

Q: Name each Attached alkane using the ball-and-stick model, and classify eachcarbon as 1°, 2°, 3°, or…

A: If carbon is bonded to only one other carbon then it is said to be primary (10) carbon. If the…

Q: Draw 2-methylpropanal

A: Aldehydes and ketones are compounds which incorporate a carbonyl functional group. The carbon atom…

Q: MCQ 23: 2 methyl-2 propan-2-ol is an example of A. primary alcohol B. secondary alcohol C. tertiary…

A: A primary alcohol is an alcohol in which the hydroxy group is bonded to a primary carbon atom. It…

Q: 1. Label each of the following alcohols as primary, secondary, tertiary, or phenolic alcohol and…

A:

Q: Predict the IUPAC Product name and classify carbon with the two functional groups. H+ Ct-OH + CH,…

A:

Q: What is the correct IUPAC name of the structure below? CH,CH3 CH;CH,CHCHCH,CH,CH; ČH3…

A: Dear student since you have asked multiple questions but according to guidelines we will solve 1st…

Q: Which alkyl halide has the highest boiling point?  A. CH3Br B. CH3F C. CH3Cl D. CH3l

A: Which alkyl halide has the highest boiling point?

Q: For each alkane: (a) classify each carbon atom as 1°, 2°, 3°, or 4°; (b) classify each hydrogen atom…

A: (a)The given alkane is  2,2,3-trimethylpentane

Q: Categorize each alcohol below as primary, secondary or tertiary OH H3C CH3 CH3 HO.

A:

Q: For each alkane: (a) classify each carbon atom as 1°, 2°, 3°, or 4°; (b) classify each hydrogen atom…

A: Alkanes: These are the organic compounds that consist of hydrocarbons and there are only single…

Q: group. (c) n-butyl (d) sec-butyl The alkyl group (CH3)2CH- is a(n) (a) tert-butyl (b) iso-butyl (e)…

A:

Q: CH,OH CH,CH,CH,CHCH,CH,

A: Solution is given below in next step  OH group is behaves like function group . In IUPAC  numbering…

Q: Draw the structure that corresponds with each name.(a) 3-ethyloctane (b) 4-isopropyldecane (c)…

A:

Q: 1. Identify each alcohol as primary (1°), secondary (2°), tertiary (3º), allylic or benzylic. Он Он…

A: Concept : Primary alcohol : A primary alcohol is an alcohol which has the hydroxyl (OH) group…

Q: Give iupac name for this diol CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: IWPAC Nomenclature contain & Pant:-   2 Pnefin (substituents) + 1 Pnefin (Cyclic on Acyclic) +…

Q: Write the IUPAC name for each unsaturated hydrocarbon. a (CH3)2CHCH=c(CH3)2 This hydrocarbon is CH3…

A: IUPAC full form is "International Union For Pure and Applied Chemistry". It has given a set of…

Q: Draw a structure for 3-pentanol.  (How many carbons are in pentane?  The "ol" ending indicates the…

A: Given  Name of Compound = 3 - pentanol Structure      = ?

Q: 7 8 10 - The IUPAC name for the compound CH; Br CH3 - C-C- C3H7 (a) 3-bromo-2-methyl -3-propyl…

A: Introduction:  In the IUPAC system, We choose the longest chain of carbon that has the main…

Q: Classify each alkyl halide and alcohol as 1°, 2°, or 3°.

A: Alcohols and alkylhalides can be classified as primary, secondary and tertiary based on the number…

Q: 1. Explain why the propane that is used as a fuel in a barbecue is a gas at room temperature,but…

A: The state of matter depends on the intermolecular forces of attraction that exist between molecules.…

Q: Write down the IUPAC name of the structure shown. HC à OH -CH-CEC-C=CH- -CH-C=0 HC=0 OH

A: During writing iupac name we have to follow some rule

Q: 2. Give the structure corresponding to each IUPAC name. а. 3-ethyl-3-methylhexane b.…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.