Name the following using correct IUPAC nomenclature: A) isopentane B) 2-methylpentane CH3CH2CCH3 C) 2-methylbutane D) pentane CH3 E) 3-methylbutane エー

Q: 2. What is the IUPAC name of the following compound? CH3 a. 2,4-dimethylhexane b.…

A: IUPAC Name of Compound is given below:

Q: A. Give the IUPAC name of the following unsaturated hydrocarbons. 1 2 t 3 H₂C. had 4 CH₂ CH₂

A: We have find out the IUPAC nomenclature of unsaturated compounds. Note -as per our company…

Q: What is the IUPAC name of the following compound? CH 3 1 CH 3- CH2-CH 2-CH 2- CH- CH 3 O…

A:

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

A: Rules for naming the organic compound is as follows; Select the longest continuous carbon chain.…

Q: Select the correct IUPAC name for each unsaturated hydrocarbon. CH,-CH,-CH=CH-CH, Name: O pentene…

A: Since you have posted a question with multiple sub parts, we will solve first three sub parts for…

Q: What is the name of            CH3           || CH3-CH-CH2-CH2-cH3   A. Pentane B.…

A: The IUPAC is the system of assigning the name of the chemical compounds.  The given chemical…

Q: What is the IUPAC name of the following compound? O A butane O B. 4-butene OC 1-butene…

A: The compound has 4 C -atoms in parent chain. So root word is bute And 1 double bond at 1st C-atom.…

Q: CH, CHCHCH, CH, CH,CH,CH,

A:

Q: What is the IUPAC name for the compound shown here? A) 3-ethyl-4-methylpentane B)…

A: IUPAC nomenclature is a naming given to chemical compounds based on certain rules that are given by…

Q: Provide the correct IUPAC name for the compound shown here. H3C H3C CH₂-CH₂ H₂C-CH3 CH3 4

A:

Q: What is the IUPAC name of this molecule? a. 1-chloropentane b. 2-chloro-1-ethylethane c.…

A: IUPAC is nomenclature in organic chemistry. It is a method of naming organic chemical compounds. It…

Q: Which of the following is the correct IUPAC name of the following compound? CH,CH, CH,CH,CH=CH,…

A:

Q: CH3 Но ČH3 The IUPAC name of the compound is

A: We have to predict the iupac nomenclature of given compound.

Q: What is the IUPAC name of the following compound? O A. 2-Ethyl-4-methylpentane O B.…

A: Given here a compound and we are asked to write the IUPAC name for the compound

Q: What is the accepted conventional name of the compound indicated below? CH 5. CH,CH2- -CH3 A.…

A: 5. Given compound,

Q: Give the IUPAC name for the following compound: Multiple Choice R2,3-dimethylhexane…

A: The IUPAC name of the compound can be written on the basis of the main carbon chain, functional…

Q: Which of the following alkane names is correct/possible? A) 1,2-dimethylhexane B) 1-methylnonane C)…

A: According to nomenclature, (A), (B),(C)&(D) all  alkane names are correct and possible.

Q: Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended…

A: IUPAC nomenclature: IUPAC stands for International Union of Pure and Applied Chemistry. The IUPAC…

Q: N coolt COOH CONH2

A: IUPAC rules for naming a heterocyclic compound: 1. The elements other than carbon and hydrogen are…

Q: What is the IUPAC (systematic) name of the following molecule: O A. Sec-butylpentane O B.…

A:

Q: Name: H. NO2 Name: Name: H H.

A: The naming of the organic compounds based on IUPAC nomenclature system.  Generally following rules…

Q: What is the IUPAC name for the compound shown? Br H3C, .CH3

A: We have to predict IUPAC name of given structure.

Q: он CH2 CI

A: Numbering will be anticlockwise becuase Cl is near to OH  it is given by prority order of…

Q: Choose the correct IUPAC name for the following compound: & a) 1,3-dichlorocyclohexane Ob) Oc)…

A:

Q: Organic Compound IUPAC name If incorrect... Correct (v) or provide reason(s) for your answer and a…

A:

Q: NANH2 CH3-I CH3-C=CH H20 C Hg2, H* Question 13: Consider the synthesis scheme in Figure 12. Give the…

A:

Q: 1. Name the following unsaturated hydrocarbons (IUPAC). I would draw out, (T) is triple bond a)…

A: Rules for IUPAC NOMENCLATURE -  1. First of all, mark the longest chain of hydrocarbon containing…

Q: What is the correct IUPAC name for the compound below? A) 2,2,4-trimethylpentane B)…

A:

Q: Provide the correct IUPAC name for the compound shown here. Br Br 1 1 CH3-CH-CH-CH3

A:

Q: A student mistakenly names a compound "3-ethylbutane." What should this compound correctly be…

A:

Q: names of compounds IUPAC

A: The IUPAC naming provides the precise and accurate names of the compound.

Q: The correct IUPAC name for the next compound is: H. H H H. CI CI H Select one: a.…

A: Cyclohexane can be represented in the chair conformation. Cs and trans isomers of cyclohexane can be…

Q: What is the correct IUPAC name for the following compound CH3-CH(CH3)-CH(C2H5)-CH2-CH(CH3)-CH3?…

A: Basic Rule to write IUPAC Name (1)  Select the longest chain  (2)  Numbering start from those side…

Q: why is 4-methylpentane an incorrect IUPAC name?

A: Interpretation: Why 4-methylpentane is an incorrect IUPAC name is to be determined.

Q: CH3 H2 CH H;C CH3 „CH2 H;C The IUPAC name is: fu Of

A: To give the IUPAC name of the given compound, one should follow the following steps. Select the long…

Q: What is the correct IUPAC name of the following compound? D CI NO₂

A: We need to find the IUPAC name of given compound

Q: CH3 CH3 CH3CH2CHCH2CHCH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: What is the IUPAC name for the compound shown? Br H3C, CH3

A: The compound given is having a longest carbon chain of 5 carbons as shown below with no major…

Q: CH3 CH CH2 CH CH3 H3C H2C-CH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: Name this compound according to the IUPAC system: CH3 NH 0-CH3

A: .

Q: correct IUPAC name of the following compounds (a)4-methylhexane (b)1,5-dimethyl-3-ethylpentane…

A: Lets draw the structures according to the  given names .The numbering according to the given name is…

Q: What is the IUPAC name for the compound below? CH2CH3 CH;CHCHCH,CH3 ČH3 O 2-ethyl-3-methylpentane O…

A:

Q: - the correct IUPAC name of the following compound is... CH3 (CH3)2CHCHCH2CH3 (a) 2, 3-dimethyl…

A: Steps to determine IUPAC name: Select the longest carbon parent chain Start numbering from there,…

Q: What is the correct IUPAC name for HBrO(aq)?

A:

Q: Answer the question below: * What is the correct IUPAC name for (CH3))2CH(CH2)3CH3? (a) heptane (d)…

A:

Q: A. Give the IUPAC name of the following saturated hydrocarbons. 1 6 ZON 7 H2N OH NH2 3.

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: What is the IUPAC name for CI-CH2-CH2-CH2-CI I Select one: a. dichloropropane. b.…

A: Option C 1,3 dichloropropane

Q: Which of the following is a correct IUPAC name? 1-methylpentane 2-ethylpentane 3-ethylpentane…

A: The naming of organic molecules takes place according to IUPAC naming system. The first step…

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.