Answered: Provide the CORRET name for the…

Provide the CORRET name for the incorrectly named compounds, and explain why the names given are incorrect: 2-ethylpropane 1, 3 – dimethylpentane 2-dimethylbutane 3-methylbutane

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter20: Organic Chemistry

Section: Chapter Questions

Problem 2ALQ

See similar textbooks

Related questions

Q: IUPAC Name Condensed Structural Formula Zigzag line Structural Formula 7. 2,5-dimethyl-3-hexene 8.…

A: Draw the structural diagram

Q: The following names are incorrect. Write the structural formula that agrees with the apparent name,…

Q: What is the correct IUPAC name for the following organic molecule? a.…

Q: Given each of the IUPAC names provided, draw the corresponding structure.(a)…

A: Since we answer only up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: Which of the following names are correct and which areincorrect? If incorrect, write the correct…

A: a. 2,3-Dibromocyclobutane Incorrect name. Correct name will be 1,2-Dibromocyclobutane b.…

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

A: Hi there, As there are multiple subparts, we are answering first 3 subparts. if you need further…

Q: Given each of the IUPAC names provided, draw the corresponding structure. (a)…

Q: 1. 2. 3.

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

A: In organic chemistry the name of any organic compound is given by the IUPAC nomenclature. There are…

Q: Which of the following is an incorrect IUPAC name for a cycloalkane? 3,3-dimethyl-cyclopentane…

Q: Isomers are molecules that share the same formula and have a different shape to the molecule the…

A: ->Isomers are compounds having the same molecular formula but different properties due to…

Q: The following names are incorrect: State why each name is wrong and give the correct name…

A: Rules to write the structure of the compound from the given IUPAC name: The name of the longest…

Q: Are the following names correct or incorrect? If they areincorrect, give the correct name.a.…

A: Are the following names correct or incorrect? If they are incorrect, give the correct name. a.…

Q: Draw a structure corresponding to the following IUPAC name:…

A: Structure of a compound, IUPAC named 4-methyl-1-(2, 2-dimethylpropyl)cyclohexane

Q: . What is the IUPAC name of the following compound? CI a) 3-Ethyl-2-methyl-4-chloropentane b)…

Q: 1. What is the correct IUPAC name for 2-propylpentane (For Alkene and Alkyne Naming, follow this…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: What is the IUPAC name of this molecule? a. 1-chloropentane b. 2-chloro-1-ethylethane c.…

A: IUPAC is nomenclature in organic chemistry. It is a method of naming organic chemical compounds. It…

Q: What is the IUPAC name for the compound shown? CI H3C, CH3 H3C CH3 CI The IUPAC name is: CI O…

A: We have to predict the correct IUPAC nomenclature of given structure.

Q: Explain why each of the following is an incorrect IUPAC name. Write the correct IUPAC name for the…

A: In order to write iupac name we have to follow some rule 1) first select longest carbon chain 2)…

Q: Draw the Skeletal Formula of the following compounds. The parent chain should be drawn in STRAIGHT…

A: Skeletal formula include the structure of the compound from the given IUPAC name.

Q: Explain why each of the following is an incorrect IUPAC name. Write the correct IUPAC name for the…

A: Hii there, As there are multiple sub parts posted. we are answering first-three sub parts . If you…

Q: Given each of the IUPAC names provided, draw the corresponding structure. (a) 1-ethoxypropane; (b)…

A: (a)

Q: A student was given the following list of structural formulas of several compounds and was asked to…

Q: CH3 H3C CH3 CH3 H3C

A: Given : Structure of the compound. To find : IUPAC name of the following compound. Solution : As we…

Q: The correct IUPAC name for the following compound is CH2 H2 H3C. CH3 H3C CH3 a.…

A: Answer

Q: Draw the open structures of the molecules named below according to the IUPAC naming system.…

A: Introduction : We need to tell the structures of following molecules . Since, isopropoxy can be…

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

Q: The following names are incorrect: State why each name is wrong and give the correct name…

A: Organic compounds are named in accordance with IUPAC nomenclature. According to the nomenclature,…

Q: Provide the IUPAC name for the following compound: O3-methyl-2-propylpentane…

A: To provide the IUPAC name for the following compound. Rules for naming a compound in IUPAC are:-…

Q: Give the correct IUPAC name of the following compound: ... A 2,5-Dimethyl-3-propylheptane B…

A: Write the IUPAC name of the given structure ----

Q: What is the IUPAC name of the following compound? CH;CH2C(CH3)½CH2CH(C>H5)2…

A: Rules for naming the organic compound is as follows; Choose the longest continuous carbon chain.…

Q: Select the correct IUPAC name for (see image) a) 3-ethyl-2,4,5-trimethyloctane b)…

Q: Organic Compound IUPAC name If incorrect... Correct (v) or provide reason(s) for your answer and a…

Q: Given each of the IUPAC names provided, draw the corresponding structure. (a)…

A: (a)

Q: Give the IUPAC name for the following compound: Multiple Choice (1R,3R)-1-ethyl-3-methylcyclohexane…

A: Answer 2 Introduction: IUPAC nomenclature: IUPAC stands for International Union of Pure and Applied…

Q: What is the correct IUPAC name for the compound below? A) 2,2,4-trimethylpentane B)…

Q: What is the IUPAC name of this compound? CH 3 CH 2 CH 2 CH 2 CH 2 CH 2 CH 3 heptane butane octane…

A: -> For IUPAC naming following steps are required First of all identify the longest carbon chain…

Q: 4,6-dimethylcyclohexane is incorrect according to IUPAC. Which of the following is the correct…

Q: What is the IUPAC name for the following compound? 3-Ethyl-2,5-dimethyloctane…

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: What is the correct IUPAC name for the following compound CH3-CH(CH3)-CH(C2H5)-CH2-CH(CH3)-CH3?…

A: Basic Rule to write IUPAC Name (1) Select the longest chain (2) Numbering start from those side…

Q: Draw each of the following molecules based on the name given, then decide which are valid systematic…

A: The given molecules are 1,5-dimethyl-3-heptene, 3-propylheptane, 3-methyl-2-pentyne,…

Q: CH3 CH CH2 CH CH3 H3C H2C-CH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: Draw the open structures of the molecules named below according to the IUPAC naming system.…

A: 1) The IUPAC name given is 2-hydroxy-3-pentenal The IUPAC name given is incorrect as the aldehyde…

Q: On a clean sheet of paper, draw acceptable chemical structures for the following compounds. Please…

A: a. 2,3,4-trimethyloctane

Q: For each, draw a structural diagram (ine, conderised or complele) IUPAC Name Condensed Formula…

Q: Write the condensed structural formula for each of the following molecules 3-ethylhexane…

A: Condensed Molecular Formula In condensed molecular formula most of the bonds are omitted and this…

Q: What is the correct IUPAC name for the compound above? a. 2,3,4-trimethylhexane b.…

A: Organic compounds are named as per the guidelines proposed by the International Union of Pure and…

Q: Determine which part/s of the following IUPAC name made them incorrect: locant, parent length,…

A: IUPAC stands International union of pure and applied chemistry. It is for the systematic…

Q: Select the correct IUPAC name for: 5-methyl-5-ethyloctane 3-methyl-3-propylheptane…

A: We would write IUPAC name of given compound using IUPAC rules. Which are given as : 1.) First we…

Q: The names given for the following unsaturated hydrocarbons are incorrect based on IUPAC…

A: 1. 1,6-diethylhept-5-en-1,3-diyne: According to this name the structure of the compound is as…

Question

Provide the CORRET name for the incorrectly named compounds, and explain why the names given are incorrect:
1. 2-ethylpropane
2. 1, 3 – dimethylpentane
3. 2-dimethylbutane
4. 3-methylbutane

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Give the structure corresponding to the following IUPAC name: 6-isopropyl-3,3,7-trimethyldecane ?
Deriving a Structure from a Name Give the structure corresponding to the following IUPAC name: 6-isopropyl3,3,7-trimethyldecane.
For each of the following, state why the given names are incorrect, and then give the correctIUPAC names and write the corresponding structural formulas.a) 2-dimethylbutaneb) 3-chloro-4-methylpentanec) 2-ethylhexaned) 3-isopropylpentanee) 1,1-dimethylbutane
All of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly.(i) 2-bromo-3-ethylbutane (ii) 2,3-diethyl-5-isopropylheptane
Give the complete structures for: 1.) Cis-2-hexene (C6H12) 2.) Acetamide (ethanamide) (C3H6O2) 3.) 1-chloro-3-ethylbenzene (C8H9Cl)
I am confused as to which compound from the following: cyclhexane, ethyne, hept-2-ene, Ch2(CH2)14Ch2OH, dode-1-yne, Ch3Ch2CO2H,Propan-2-ol, Ch3(Ch2)14CO2H; is miscible in water, is an insoluble gas, is a water insosuble solid, is a wter insoluble liquid, is a water insoluble liquid- it burns clean, is a water insuloble liquid-it burns dirty, us water mscible. What do I look for to assign each compound to its coorect characterisitcs.
Provide the structure that corresponds with the IUPAC name 2-iodo-5-methoxyheptane 2,2,4-trimethylhexane 3,4-dimethylhexane 4-hydroxy-3-methylbutanoic acid 2,2,3,3-tetramethyl-4-decene
Condensed structural formula of:1. neopentane 2. n-hexane3. 2-Ethyl-1,4-dimethylcyclopentane4. chloroform5. 2-Bromo-1-chloro-3-ethyl-2,3,5-trimethylheptane
What is the skeletal structure pertianing to the IUPAC name for 4-isopropyl-2,4,5, trimethylundecane?
All of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly. (a) 3-ethyl-4-methylpentane (b) 2-ethyl-3-methylpentane (c) 3-dimethylhexane (d) 4-isobutylheptane (e) 2-bromo-3-ethylbutane (f) 2,3-diethyl-5-isopropylheptane
Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct IUPAC name.a. 2,2-dimethyl-4-ethylheptaneb. 5-ethyl-2-methylhexanec. 2-methyl-2-isopropylheptaned. 1,5-dimethylcyclohexanee. 1-ethyl-2,6-dimethylcycloheptanef. 5,5,6-trimethyloctaneg. 3-butyl-2,2-dimethylhexane
The names given for the following unsaturated hydrocarbons are incorrectbased on IUPAC nomenclature. Provide the correct name.1. 1,6-diethylhept-5-en-1,3-diyne2. 3-methyl-5-ethylcyclohept-5-ene3. 4,4-dimethyl-1-ethylbut-3-en-1-yne