Oleic acid has a melting point of 16 degrees celsius. If you convert the cis double bond into a trans double bond, what would happen to the melting point?

Q: how many lone pairs of electrons are present in CH2CHOH?

A: The solution is as follows :

Q: * Choose the pharmaceutical drug Aspirin and answer the following questions about the drug: * * What…

A:

Q: How many chiral carbons are in 2-bromo-2-chloro-3-methylpentane? (a) 0, (b) 1, (c) 2, (d) 3, (e) 4…

A:

Q: What is meant by the term resonance hybrid?

A: Resonance structures are defined as a set of lewis structures which describes the delocalisation of…

Q: What do you mean by Hydrophobic ?

A:

Q: Strural formula of 3,3 dimethyl-N-phenyl-2-aminohexane

A: In the given question, amine (-NH2) is the only functional group present. Thus, the correct name…

Q: In each of the following classes of organic compounds, write (by express formula) two molecules each…

A: The name of two amino acid molecules with at least one aromatic group and one alkyl group with a…

Q: What type of bond is shown in the following figure between the two monosacarides? CH2OH CH2OH ОН HỌ…

A: The larger carbohydrates are formed by forming bonds between repeating units. The bond formed…

Q: Consider the naturally occurring amino acid, alanine, and its enantiomer.

A: Enantiomer:- These are chiral molecules which forms non- superimposable images of each other. Amino…

Q: give the bond polarity for each type of bond in the molecule for ch3coch3?

A: Bond polarity is the separation of electric charge along a bond, leading to a molecule or its…

Q: Give examples of some carbohydrate derivatives that contain amino groups, amides, or carboxylate…

A: When some reactant is added to any reactant then a new product is formed and the product obtained is…

Q: Draw and Name  the condensed structures of the compounds formed from  propanoic acid and…

A: Condensed structure of Propanoic acid is given by,

Q: How many distinct locations are there for a double bond in a five-carbon linear chain?

A: The change in the position of the double bond in a carbon chain results into positional isomerism.…

Q: Write the condensed structures corresponding to the following names. 1.enanthaldehyde 2.…

A:

Q: Fill in the blanks: Identify the family of the compound. Give the functional group category where…

A:

Q: ОН

A: Given

Q: How come this organic compound has cis/trans nomenclature despite it not having a double bond?

A:

Q: What is the hydroxyl group?

A: Functional group is a group or substituent present in the molecule that determines the property and…

Q: Consider erucic acid whose formula is CH3(CH2)7CH=CH(CH2)11COOH. It is a. Two of the choices are…

A: Omega fatty acids- these are long chain of hydrocarbons in which the fatty acids are attached at the…

Q: 1. Write the structure of the compound 1-amino-4-nitro naphthalene?

A: Structure of the compound 1-amino-4-nitro naphthalene :

Q: A. Draw the condensed structural formula of 2,3-dimethylpentanenitrile.

A:

Q: Which side of the chain should you count from when naming organic compounds? A Left side B Right…

A: Ask that, Which side chain should you count from the naming??

Q: Which of the following compounds is anisole? S-OH OMe NH,

A: anisole is having ether functional group. oxygen is connected between benzene and methyl group.…

Q: Explain the term Hydrophilic ?

A: Surface chemistry represents the chemical process occurring at the interfaces of two surfaces like…

Q: Consider the structure of the amino acid L-alanine. Which functional groups are common to all amino…

A:

Q: Define the following terms:a. functional groupb. R groupc. carboxyl groupd. amino groupe. hydroxyl…

A: Since we only answer up to 3 sub-parts, we'll answer the first 3. Please resubmit the question and…

Q: Draw an 18-carbon saturated fatty acid. Is this a “straightchain” molecule or a “bent” molecule?

A: Fatty acids are composed of a long hydrocarbon chain attached to a carboxyl group at one end.

Q: Explain Compounds Containing a C=O Group ?

A: The functional group composed of a carbon atom double-bonded to an oxygen atom, i.e, C=O is called…

Q: What type of bond is found between two -SH groups and can be found in proteins

A: Given that, Bond present in between two -SH group?

Q: Which of the following is NOT a functional unit of organic compounds? a. monosaccharide b. amino…

A: Monosaccharide : The group of sugar which can not be hydrolyzed into the simpler form is called…

Q: The two carbon atoms in acetylene form two pi bonds. O A. True, hence a double bond B. True, and two…

A: Organic chemical compounds are the compounds containing C-H bonds. Due to carbon's ability to…

Q: For the given molecule, an amino alcohol, how many sigma bonds are present? Select one: O a. six O…

A: single bonds are  commonly known as sigma bonds in covalent compound  in above compound only single…

Q: To Which category does the molecule below belong? A) Protein B) alcohol C) aromatic hydrocarbons D)…

A: a) Protein : Proteins are large polymer molecules formed by the combination of multiple amino acids.…

Q: What is the type of bond between Br4 and C2 and C3

A: In supramolecular chemistry , non - covalent interactions plays a major role.These interactions such…

Q: Draw the condensed structure of acetaminophen?

A: The structure for acetaminophen is drawn as follows,

Q: The main reaction expected to occur when glycine is treated by strong base such as NaOH is, A.…

A: The main reaction that is expected to take place when glycine is reacted with sodium hydroxide has…

Q: Draw the following structures: 1. Propan-1,3-diamine 2.7-Amino-4-methylheptan-2-one

A: Since you have posted questions with multiple subparts, we will solve first three subparts for you…

Q: Identify the functional groups in  compound

A:

Q: Write the condensed structural formula for para-bromobenzoic acid.

A: The condensed structural formula of a chemical compound represents the chemical formula with…

Q: Question 12 of 15 Provide the name of the following nitrogen- containing heterocyclic base. NH₂ d MP…

A:

Q: cis-trans isomers.

A: The correct statement about cis-trans isomers can be funded as

Q: Write an example of alicyclic compound.

A: A compound that has one (or) more carbon rings that are either saturated (or) unsaturated but does…

Q: How do you assign priority in a ring structure when determining if a carbon within the ring is (R)…

A: Assign of priority to the 4 groups in a chiral carbon in a ring is same as the chiral carbon in a…

Q: "Draw" the condensed diagram for the molecule: 2-ethyl-3-hydroxyl-N-isobutylpent-trans-3-enamide

A:

Q: Condensed Formula of 3,4-diethyl- 1,1-dimethyloctane *

A: Given that : We have to write the condensed formula of 3,4-diethyl-1,1-dimethyloctane. Condensed…

Q: Two compounds given below had the following IUPAC name and structural formula 2-aminopropanoic acid…

A: Explanation Isomerism Different compound with same molecular formula called as Isomerism…

Q: In forming base pairs, A always pairs with T, and C always pairs with G, because these pairings…

A: Base pair is the fundamental unit of DNA. They form the building block of double helix structure of…

Q: Fill in the blanks: Identify the functional groups. Cl- OCH3

A: Given: The chemical formula of the following structure is C7H7ClO.

Q: Interpret the meaning of the symbols in the compound name, alpha - D(+) - fructofuranose.

A: Answer - According to the question - Given - A fructose with a furanose ring. Fructofuranose is…