ОН OH H₂SO4 Na2Cr2O7

Q: d) 1,1-dimethylcyclopentane can exist as geometric isomers. Fals T

A: Given Question 8 part d). 1,1-dimethylcyclopentane

Q: Question 15 How many moles of O2 will be produced by the decomposition of 32.0 grams of hydrogen…

A: Given, 2H2O2 ---> 2H2O + O2 mass of H2O2 decomposes = 32.0 g moles of O2 produced = ? Note: Molar…

Q: For the reaction below the partial pressure of NO₂ is 0.24 atm and the partial pressure of N₂O4 is…

A:

Q: Write a balanced chemical equation based on the following description: aqueous potassium phosphate…

A: Aqueous potassium phosphate reacts with Aqueous nickel (ll) bromide to produce solid nickel (ll)…

Q: 15 mL of 0.1 M BaCI2(aq) is mixed with 10 mL of 0.1 M AgNO3 (aq). What are the concentrations of the…

A: We know Concentration=Number of molesVolume of solution in liters we will first find the…

Q: Question 14 How many grams of Pbl2 will precipitate from the reaction of 14.0 mL of 0.190 M Pb(NO3)2…

A: Introduction According to Avogadro's constant, a mole is the volume of a chemical compound that…

Q: Determine the pH of a solution with a hydrogen ion concentration of 0.000101mol/L.

A: Hydrogen ion concentration is an important parameter of an aqueous solution. The concentration of…

Q: 1. Rank the following compounds in order of increasing boiling points (#1 is lowest, #5 is highest)

A: Answer:- This question is answered by using the simple concept of boiling point which depends on the…

Q: How many grams of Ag₂CO3 will precipitate when excess K₂CO3 solution is added to 65.0 mL of 0.746 M…

A:

Q: Write the equilibrium constant expression, K, for the following reaction: If either the numerator or…

A: Given reaction:- 2SO3(s) <==> 2SO2(g) + O2(g)

Q: Carbohydrate Practice: if you need a reference, read Chap 24, sections 24.6-24.8 1. What is the…

A: R/S nomenclature help to find out the stereochemical relationships of the stereoisomers. After…

Q: Question 22 What is the theoretical yield (in grams of NaCl) when 0.750 mol of sodium reacts with…

A:

Q: Can you help me with NH3 and H2O, Cl2 and Br2, Mg2+ and H2S, H2S and HBr, pentane and butane?

A: There are various types of intermolecular bonding such as hydrogen bonding, dipole- dipole, London…

Q: Hydrogen is manufactured on an industrial scale by this sequence of reactions: CH4 (g) + H₂O(g)…

A: For any reaction: aA + bB ⇔cC + dD The equilibrium constant is given by: K=CcDdAaBb

Q: Consider the following reaction: 2NH3(9) N₂(g) + 3H₂(9) If 1.54x10-3 moles of NH3(g), 0.549 moles of…

A: The equilibrium constant is  Kc tell about the Concentration of ratio of products and reactant  The…

Q: 6. Identify the following reaction types (e.g. condensation, addition, etc.). Y dilute NaOH OH Conc.…

A: we have to determine the type of reaction shown

Q: For the reaction Br2(g) +5F2(g) → 2BrFs (g) the system at equilibrium at a particular temperature is…

A:

Q: doesn't change anything or compromise the data. 6. A titration may be done on any reactive pair of…

A: Molarity: Molarity is the number of moles of solute per one liter of solution. The symbol for…

Q: A solution contains 0.397 M HA (K₂ = 8.08. 10-6) and 0.719 M NaA. What is the pH of this solution?…

A:

Q: The rate at which a certain drug is eliminated by the body follows first-order kinetics, with a half…

A:

Q: Students in a chemistry lab are making the compound cobalt (II) carbonate. It can be made by…

A:

Q: Graduated Cylinder Density = x ±s for Class Data: Diet cola Graduated Cylinder Pipet Pipet Buret…

A: Density regular cola= Graduated cylinder=1.0102±0.0448    Pipet=1.0009±0.0650  Buret= =1.0481±0.0771…

Q: An ore containing magnetite, Fe3O4, was analyzed by dissolving a 1.5419-g sample in concentrated…

A: The question is based on the concept of quantitative analysis. we need to identify mass percentage…

Q: Derivation The Arrhenius equation can be written as: k = Ae Consider a reaction with some activation…

A: Effect of catalyst on rate of reaction :-  A catalyst increases the rate of reaction by decreasing…

Q: Which substance is reduced in the reaction below? Na2SO4 +4 C→→ Na2S + 4CO a. CO O b. Na2S O C. S O…

A: In this question, we will identifying reduced substance in the given reaction equation. You can see…

Q: Intermolecular forces are the combination of attractive and repulsive electrical forces between…

A: Intermolecular forces are the attractive or repulsive forces that exist between molecules, rather…

Q: Give the structure of the molecule that is consistent with each set of spectral data given below:…

A: Site  of unsaturation =2Cn+2-Hn/2 Where Cn=Number of Carbon          Hn=Number of Hydrogen

Q: Choose the equilibrium expression for the following reaction. a. CH4 (9) + 2H₂S(9) ⇒ CS₂ (9) + 4H₂…

A: In the given reaction, we have to find equilibrium constant (k). x Reactant -----> y Product…

Q: Use Cahn-Ingold-Prelog rules on the molecule below and highlight the highest priority substituent…

A: Since, According to Cahn-Ingold-Prelog rule- 1) More atomic number having more priority.2) If first…

Q: If Kp is the equilibrium constant for the reaction 2 A (g) + B (g) = 3 C (g). What is the…

A: Given data :  2 A(g) + B(g) <==> 3C(g)    , Kp  another reaction ;  6 A(g) + 3 B(g) <==>…

Q: Ice cubes at 0°C are poured into a glass that initially contains 150 g of liquid water at 20°C. The…

A:

Q: Select any of the following that describe the stereochemistry of the molecule that is shown on the…

A: we have to select the terms that match the stereochemistry of the given structure

Q: Write a procedure How would you analyze a tums or Rolaids tablet? Keyword: Back titration, molarity…

A: This procedure outlines the steps for analyzing a Tums or Rolaids tablet to determine the molarity…

Q: Given the combustion reaction of a sugar. C6H1206(s) + 6 O2(g) → 6 CO2(g) + 6 H₂O(g) Which…

A: The combustion reaction is,  C6H12O6 (s) + 6 O2 (g) => 6 CO2 (g) + 6 H2O (g)  Stoichiometric…

Q: The statements in the tables below are about two different chemical equilibria. The symbols have…

A: A spontaneous reaction always has a negative standard Gibbs free energy change whereas a…

Q: Outline a feasible laboratory synthesis of 2-ethylcyclohexanone (shown below) starting with…

A: The question involves organic synthesis of 2-ethyl cyclohexanone.  we carry out the synthesis using…

Q: If the [S2O32-] is initially 2.49 x 10-4 M, and the reaction takes 170 seconds for the solution to…

A: Given: Initial concentration of S2O32- = 2.49 x 10-4 M Final concentration of S2O32- = 0 M Initial…

Q: i) There are 10 orbitals in the n = 3 energy level. Falsc, 9 False he i) Br has the same number of…

A: Orbital is defined as the three dimensional space where probability of finding an electron is…

Q: 1. Draw cis-cis - 2 - bromo-4-chloro-1-(2-propyl) eyclohexame as the lowest chair. energy

A: Conformational isomers: The conformational isomers are formed by the rotation of a carbon-carbon…

Q: 13. 14. 15. CH3 Br CH3 Br O₂N. H== NaHCO3 OH B OH NH CH3 PdCl3(PPH3)2 (cat) IPA/2M Na₂CO3 heat…

A: Given that, the reactions are shown below We have to give the structure of the product.   N.B.:…

Q: Dopamine is a neurotransmitter that helps control the brain's reward and pleasure centers. Its Lewis…

A: Dopamine is a neurotransmitter and acts as a messanger used to send messages between nerve cells It…

Q: O₂N OH OH Br₂ high temp A reaction does occur! NaOH (1 equiv) Mel (1 equiv) bios oinotluser label E

A:

Q: 7. Why does addition product B predominate at the higher temperature (100°℃)? A. The reaction is…

A: The question is based on the concept of organic reactions. we need to describe the product formation…

Q: Eto act A CH3NH2, H+ The transformation above can be performed with some reagent or combination of…

A:

Q: Give the systematic name for the following coordination compound or complex ion: H₂ Co-C/ H₂ H₂N NH₂

A: Given compound:-

Q: 21) When CH3 Br-C1 (R)-2-chlorobutane reacts with Br2/hv, which of the following is true? CH2CH3 CH3…

A: When an alkane is halogenated, a hydrocarbon derivative is created in which one or more halogen…

Q: Identify the changes in the following system at equilibrium when the volume is suddenly decreased.…

A:

Q: The normal freezing point of a certain liquid X is 6.60 °C, but when 97. g of barium hydroxide…

A: The depression in freezing point is a colligative property and it is given by the formula,  T-Tf…

Q: When propane is burned, the balanced reaction is: C3Hg(l) + 5 02(g) -> 3 CO2(g) + 4 H20(g). If 24.87…

A:

Q: 6. Why does addition product A predominate at the lower temperature (0°C)?

A: A is less stable and B is more stable, the reason is hyper conjugative alpha H present in A is 1 and…

Polymers

Polymers are naturally occurring or synthetically produced large molecules or compounds which are made up of series of repeating units called monomers. They are joined together by chemical bonds. The term polymer is coined from Greek roots meaning 'many parts' and are found almost everywhere from the plastics bags to the rubber of our tires to our DNA strands.