For the following reaction, 0.549 moles of sulfur dioxide are mixed with 0.192 moles of oxygen gas.sulfur dioxide(g) + oxygen(g) → sulfur trioxide(g)What is the formula for the limiting reagent?What is the maximum amount of sulfur trioxide that can be produced?moles

The limiting reagent is reactant which is used up in the reaction completely.

or the following reaction, 0.549 moles of sulfur dioxide are mixed with 0.192 moles sulfur dioxide(g) + oxygen(g) –→ sulfur trioxide(g) That is the formula for the limiting reagent? That is the maximum amount of sulfur trioxide that can be produced? moles

or the following reaction, 0.549 moles of sulfur dioxide are mixed with 0.192 moles sulfur dioxide(g) + oxygen(g) –→ sulfur trioxide(g) That is the formula for the limiting reagent? That is the maximum amount of sulfur trioxide that can be produced? moles

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 159CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Related questions

Q: What is the lowest possible sum of the coefficients in the overall balanced equation? (assume all…

Q: One way to collect zinc is to react solid zinc (II) oxide with carbon, which produces solid zinc and…

A: The number of moles of any substance can be calculated by dividing its mass and molar mass, the…

Q: or the following reaction, 13.2 grams of chlorine gas are allowed to react with 59.6 grams of sodium…

A: First of all, find the limiting and excess reagent and then according to stoichiometry, calculate…

Q: For the following reaction, 0.126 moles of iron are mixed with 0.429 moles of oxygen gas. iron(s) +…

Q: Use the References to access important values if needed for this question. For the following…

Q: For the following reaction, 0.308 moles of hydrogen gas are mixed with 0.189 moles of ethylene (C2…

Q: How many molecules (not moles) of NH3 are produced from 5.01x10-*g of H2? Express your answer…

A: Given: Mass of H2 = 5.01×10-4 g. Balanced chemical reaction is given by,

Q: The illustration to the left represents a mixture of oxygen ( red ) and fluorine ( green )…

Q: For the following reaction, 0.431 moles of calcium hydroxide are mixed with 0.302 moles of…

Q: How many conversions are needed to go from mole (X) of the given to particles of the find ?

A: A question based on mole concept that is to be accomplished.

Q: he following chemical equation has NOT been balanced. Na + H2O --> NaOH + H2 How many grams of…

A: The balanced chemical reaction is as following:- 2Na + 2H2O → 2NaOH + H2

Q: If 30. g of a 67% by mass solution of potassium hydroxide reacts with 20. g of aluminum nitrate,…

Q: For the following reaction, 0.431 moles of benzene (C6 H6) are mixed with 0.381 moles of oxygen gas.…

Q: The illustration to the left represents a mixture of nitrogen ( blue ) and hydrogen ( light blue )…

A: Given: Moles of nitrogen gas = 2 mol Moles of hydrogen gas = 7 mol

Q: Nitrogen (N2) can be reacted with hydrogen (H2) to form ammonia (NH3). Given the following…

A: In a given chemical reaction, the estimation of quantitative or measurable relationships of the…

Q: In the lab, a student generates 0.450 g of a product in an experiment. The student then calculates…

A: Given :- product obtained from an experiment = 0.450 g Theoretical yield of product = 0.398 g To…

Q: true, sometimes true, or never true: “In a chemical reaction between two reactants, the limiting…

Q: Diborane is produced when hydrogen gas reacts with boron as shown by the chemical equation below.…

A: The preparation of diborane is represented by the following relation: 2B+3H2→B2H6.

Q: Consider the reaction between sulfur dioxide gas and oxygen gas to form sulfur trioxide gas. If…

A: The balanced equation is 2SO2(g) + O2(g) ——> 2SO3(g)

Q: When 3.05 moles of CH 4 are mixed with 5.03 moles of O 2 the limiting reactant is?

A: Interpretation- To determine the limiting reagent when 3.05 moles of CH4 are mixed with 5.03 moles…

Q: For the following reaction, 0.284 moles of zinc oxide are mixed with 0.586 moles of water. What…

A: Moles of ZnO : 0.284 moles Moles of H2O : 0.586 moles

Q: A compound containing only C, H, and O is massed (0.01068 g) and then combusted to yield CO2…

A: The molar mass of CO2 is 44.0 g/mol. The mass of one mole of carbon atoms is 12.0 g, so 44.0 g of…

Q: [References] Use the References to access important values if needed for this question. For the…

A: The balanced reaction taking place is CH4 + CCl4 -----> 2 CH2Cl2 Hence from the above reaction…

Q: A piece of paper is lit with a match and covered with a jar. What is the limiting reactant? How can…

A: when a piece of paper is lit with a match and covered with a jar then oxygen is limiting reagent.

Q: The illustration to the left represents a mixture of nitrogen ( blue ) and oxygen ( red ) molecules.…

Q: In one experiment, 0.871 mol of NO is mixed with 0.506O2. Determine which of the two reactants is…

A: Given, Number of moles of NO = 0.871 mol Number of moles of O2 = 0.506 mol Limiting reactant = ?…

Q: For the following reaction, 0.540 moles of iron are mixed with 0.170 moles of oxygen gas. iron (s)+…

Q: For the following reaction, 0.214 moles ofphosphorus () are mixed with 0.402 moles of chlorine gas.…

A: Given that, moles of P=0.214 mol moles of Cl2= 0.402 mol then,

Q: The illustration to the left represents a mixture of xenon ( brown ) and fluorine (green) molecules.…

Q: Aqueous sulfuric acid (H,SO4) will react with solid sodium hydroxide (NaOH) to produce aqueous…

A: Given : mass of H2SO4 = 42.2 g mass of NaOH = 17.0 g The reaction taking place is NaOH (aq) + H2SO4…

Q: A student measures out exactly 0.09700.0970 g of salicylic acid and carries out an aspirin synthesis…

A: Find percentage yield of aspirin below

Q: 1.51 g H2 is allowed to react with 10.0 g N2, producing 2.01 g NH3 . Part A What is the theoretical…

Q: For the following reaction, 0.194 moles of methane () are mixed with 0.537 moles of carbon…

A: The reaction taking place can be written as, => CH4 + CCl4 ------> 2 CH2Cl2 Given: Moles of…

Q: If you have 2 moles of pure magnesium, and 2 moles of hydrochloric acid, according to the equation…

A: Given reaction is : According to the reaction, 1 mole of Mg reacts with 2 moles of HCl to produce 1…

Q: 88 The illustration to the left represents a mixture of nitrogen (blue) and oxygen (red) molecules.…

A: we need to fill the boxes, using the given illustration and the balanced equation

Q: The illustration to the left represents a mixture of nitrogen ( blue ) and oxygen ( red ) molecules.…

A: The balanced chemical equation fot the reaction of Nitrogen gas and oxygen gas is, N2 + 2…

Q: For the following reaction, 0.162 moles of carbon (graphite) are mixed with 0.501 moles of oxygen…

A: Given :- Number of moles of C = 0.162 mol Number of moles of O2 = 0.501 mol To be determined :…

Q: Nitrogen dioxide is produced by combustion in an automobile engine. For the following reaction,…

A: A limiting reagent is the reactant that is consumed completely during reaction. To find the limiting…

Q: For the reaction represented by the equation 2H2 + O2 → 2H2O, what is the mole ratio of H2 to H2O?

A: Mole is a standard unit for measuring large quantities of very small entities such as molecules.…

Q: The illustration to the left represents a mixture of xenon ( brown ) and fluorine ( green )…

A: The illustration given is, And the balanced reaction given is,

Q: 8. The illustration to the left represents a mixture of nitrogen ( blue ) and hydrogen ( light blue…

Q: Consider the following unbalanced equation for the combustion of pentane: if a 20.4 g sample of…

A: Given that 20.4 g pentane react with excess oxygen.

Q: For the following reaction, 0.191 moles of carbon monoxide are mixed with 0.541 moles of oxygen gas.…

A: Given Reaction CO(g) + O2(g) → CO2(g) Number of mole of CO = 0.191 mole Number of mole of…

Q: Consider the following balanced reaction between hydrogen and nitrogen to form ammonia: 3H2(g)+N2(g)…

A: Given,20.0 mole of H2,

Q: Fernando is doing his pre-lab homework for Chemistry. He is asked to predict how many grams of CO,…

Q: The illustration to the left represents a mixture of nitrogen ( blue ) and hydrogen ( light blue )…

Q: Consider the mixture of propane, C,Hg, and O2 shown below. (a) Write a balanced equation for the…

A: Limiting reactants are those reactants that are consumed in a chemical reaction. It depends upon…

Q: 2NO(g) + 0,g) - 2NO, (3) In one experiment, 0.861 mol of NO is mixed with 0.500 mol of O,. Determine…

A: Given :- 2NO(g) + O2(g) -----> 2NO2(g) Number of moles of NO = 0.861 mol Number of moles of…

Q: For the following reaction, 0.141 moles of benzene (C6 H6) are mixed with 0.270 moles of oxygen ga…

A: 2C6H6 (l) + 15O2 (g) --->12CO2 (g) + 6H2O (g) THIS WILL BE THE RXN. O2 WILL BE THE LIMITING…

Q: Enter your answer in the provided box. Methanol (CH3OH) burns in air according to the equation…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

For the following reaction, 0.549 moles of sulfur dioxide are mixed with 0.192 moles of oxygen gas.
sulfur dioxide(g) + oxygen(g) → sulfur trioxide(g)
What is the formula for the limiting reagent?
What is the maximum amount of sulfur trioxide that can be produced?
moles

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Calculate the amounts of reactants needed in a chemical reaction to produce a specified amount of product.
Small quantities of ammonia gas can be generated in the laboratory by heating an ammonium salt with a strong base. For example, ammonium chloride reacts with sodium hydroxide according to the following balanced equation: :math>NH4Cl(s)+NaOH(s)NH3(g)+NaCl(s)+N2O(g) at mass of ammonia gas is produced if 1.39 g of ammonium chloride reacts completely?
Consider a reaction represented by the following balanced equation :math>2A+3BC+4D u find that it requires equal masses of A and B so that there are no reactants left over. Which of the following is true? Justify your choice. l type='a'> The molar mass of A must be greater than the molar mass of B. i>The molar mass of A must be less than the molar mass of B. i>The molar mass of A must be the same as the molar mass of B.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Classify each of the following statements as true or false: a Coefficients in a chemical equation express the molar proportions among both reactants and products. b A stoichiometry problem can be solved with an unbalanced equation. c In solving a stoichiometry problem, the change from quantity of given substance to quantity of wanted substance is based on masses. d Percentage yield is actual yield expressed as a percentage of ideal yield. e The quantity of product of any reaction can be calculated only through the moles of the limiting reactant. f rH is positive for an endothermic reaction and negative for an exothermic reaction.
A yield of 3.00gKClO4 is obtained from the (unbalanced)reaction KClO3KClO4+KCl when 4.00 g of the reactant is used. What is the percentageyield of the reaction?
onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of aluminum metal? What mole ratio would you use to calculate the number of moles of product that would be expected if a given number of moles of aluminum metal reacts completely?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Consider the following particulate-level representation of a chemical equation: The white spheres represent hydrogen atoms, the black sphere represents a carbon atom, and the red spheres represent oxygen atoms. a Write a balanced chemical equation representing this reaction. b Write a word description of the reaction on the particulate and molar levels.