Just need part 4 Consider the reaction 2NI3(s) → N2(g) + 312(g).Part 1Correct!Using standard enthalpies of formation from Appendix D of the textbook, calculate the enthalpy change of this reaction in kJ mol1. AH°F (NI3(s)) = 159 kJ/mol-1.31E2kJ mol-1eTextbook and MediaHintAttempts: 1 of 3 usedPart 2Correct!Calculate the energy change, AU, for this reaction in kJ mol-1 at 16.3 °C.-1.40E2kJ mol-1HintAttempts: 1 of 3 used Part 3Your AnswerCorrect AnswerYour answer is correct.Why is AH for this reaction less negative than AU?AH is less negative than AU for all reactions.Some energy is absorbed because bonds are being broken.Some energy is used expanding the system from zero moles of gas to four.This is true of any reaction involving gases.HintAttempts: 3 of 3 usedPart 4Incorrect. Refer to equation 3-11 and remember the ideal gas law.If 1.00 mole of NI3(s) decomposes, calculate the pV work done (in J) on the surroundings. Use the temperature from part 2.i4.81E3JHintSave for LaterLast saved 1 hour ago.Attempts: 2 of 3 usedSubmit AnswerSaved work will be auto-submitted on the due date. Auto-submission can take up to 10 minutes.

Recall the reaction that will occur here NI3s →12N2g + 32I2g Here 1.00 mole of NI3 (s) is…

Part 4 Incorrect. Refer to equation 3-11 and remember the ideal gas law. If 1.00 mole of NI3(s) decomposes, calculate the pV work done (in J) on the surroundings. Use the temperature from part 2. i 4.81E3 Hint Save for Later Last saved 1 hour ago. Attempts: 2 of 3 used Submit Answer Saved work will be auto-submitted on the due date. Auto- submission can take up to 10 minutes.

Part 4 Incorrect. Refer to equation 3-11 and remember the ideal gas law. If 1.00 mole of NI3(s) decomposes, calculate the pV work done (in J) on the surroundings. Use the temperature from part 2. i 4.81E3 Hint Save for Later Last saved 1 hour ago. Attempts: 2 of 3 used Submit Answer Saved work will be auto-submitted on the due date. Auto- submission can take up to 10 minutes.

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 77E: Give the definition of the standard enthalpy of formation for a substance. Write separate reactions...

See similar textbooks

Similar questions

Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
Methanol (CH3OH) has also been proposed as an alternative fuel. Calculate the standard enthalpy of combustion per gram of liquid methanol, and compare this answer to that for ethanol in Exercise 87.
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.