Give handwritten Answer Predict and calculate the effect of concentration changes on an equilibrium system.Some PCI5 is allowed to dissociate into PCI3 and Cl₂ at 523 K. At equilibrium, [PCI5] = 0.143 M, and [PCI3]= [Cl₂] = 8.45×10-² M. Additional PCI5 is added so that [PC15] new 0.235 M and the system is allowed toonce again reach equilibrium.PCI5(g) =PC13(g) + Cl₂(g) K = 5.01x10-² at 523 K(a) In which direction will the reaction proceed to reach equilibrium? [(b) What are the new concentrations of reactants and products after the system reaches equilibrium?[PCI5] =[PCI3] =[Cl₂]ΣΣΣ

Answered: Image /qna-images/answer/11a80359-361f-4047-ab8f-be9c9b22bf6f.jpg

Predict and calculate the effect of concentration changes on an equilibrium system. Some PCI5 is allowed to dissociate into PCI3 and Cl₂ at 523 K. At equilibrium, [PC] = 0.143 M, and [PCI3] [Cl₂] = = 8.45x10-2 M. Additional PCI5 is added so that [PCI5]new = 0.235 M and the system is allowed to once again reach equilibrium. PCI5(g) =PC13(g) + Cl₂(g) K = 5.01x10-2 at 523 K = (a) In which direction will the reaction proceed to reach equilibrium? (b) What are the new concentrations of reactants and products after the system reaches equilibrium? [PCI5] = [PCI 3] = [Cl₂] M M M

Predict and calculate the effect of concentration changes on an equilibrium system. Some PCI5 is allowed to dissociate into PCI3 and Cl₂ at 523 K. At equilibrium, [PC] = 0.143 M, and [PCI3] [Cl₂] = = 8.45x10-2 M. Additional PCI5 is added so that [PCI5]new = 0.235 M and the system is allowed to once again reach equilibrium. PCI5(g) =PC13(g) + Cl₂(g) K = 5.01x10-2 at 523 K = (a) In which direction will the reaction proceed to reach equilibrium? (b) What are the new concentrations of reactants and products after the system reaches equilibrium? [PCI5] = [PCI 3] = [Cl₂] M M M

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 62QRT

See similar textbooks

Similar questions

A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
Kc = 5.6 1012 at 500 K for the dissociation of iodine molecules to iodine atoms. I2(g) 2 I(g) A mixture has [I2] = 0.020 mol/Land [I] = 2.0 108 mol/L. Is the reaction at equilibrium (at 500 K)? If not, which way must the reaction proceed to reach equilibrium?
Equilibrium exists between butane and isobutane when [butane] = 0.020 M and [isobutane] = 0.050 M. An additional 0.0200 mol/L of isobutane is added to the mixture. What are the concentrations of butane and isobutane after equilibrium has again been attained?
Hydrogen and carbon dioxide react at a high temperature to give water and carbon monoxide. H2(g) + CO2(g) H2O(g) + CO(g) (a) Laboratory measurements at 986 C show that there are 0.11 mol each of CO and H2O vapor and 0.087 mol each of H2 and CO2 at equilibrium in a 50.0-L container. Calculate the equilibrium constant for the reaction at 986 C. (b) Suppose 0.010 mol each of H2 and CO2 are placed in a 200.0-L container. When equilibrium is achieved at 986 C, what amounts of CO(g) and H2O(g), in moles, would be present? [Use the value of Kc from part (a).]
Write the equilibrium constant expression for each reaction in terms of activities, simplifying where appropriate. a C(s)+O2(g)CO2(g) b P4(s)+5O2(g)P4O10(s) c 2HNO2(g)+3Cl2(g)2NCl3(g)+H2(g)+2O2(g)
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
At 503 K the equilibrium constant Kc for the dissociation of N2O4, N2O4(g)NO2(g) has the value 40.0. (a) Calculate the fraction of N2O4 left undissociated when mol of this gas is heated to 503 K in a 10.0-L sealed container. (b) If the volume is now reduced to 2.0 L, calculate the new fraction of N2O4 that is undissociated. (c) Calculate all three equilibrium concentrations.
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
For the system SO3(g)SO2(g)+12 O2(g)at 1000 K, K=0.45. Sulfur trioxide, originally at 1.00 atm pressure, partially dissociates to SO2 and O2 at 1000 K. What is its partial pressure at equilibrium?