Predict the polymer that would form from the following monomer unit:

Q: The rare earth element gadolinium is often used as a contrasting agent for MRIs. The concentration…

A: The 8 measurements in increasing order are: 1.532 ppm, 1.535 ppm, 1.538 ppm, 1.539 ppm, 1.548 ppm,…

Q: Make a comparison of the strength of MnO4 as an oxidizing agent in acidic and basic solution nE° (V)…

A:

Q: Detail answer in paragraph/essay form: Using Molecular Orbital Theory as a basis, why do…

A: It is based on HOMO and LUMO gap.

Q: Write the reaction described by the following sentence. Two moles of sodium react with one mole of…

A: The amount of reactant reacted and product produced depends on the stoichiometric of the reaction.…

Q: g e. CH3CH2CH(OCH3)CH2CH2CH2OH f. केभ

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: You are studying a sample of granite that is about 2.1 billion years old. You know it contains some…

A: Here granite containing uranium -235 is formed 2.1 billion years old. We have to determine the…

Q: Black Forest Biologicals, a biotech startup, has a promising Alzheimer's drug candidate Compound…

A: Given: data of reaction. Tip : A is limiting reagent

Q: 5. What is the product of the following reaction ради ~ CH₂ LH3 CH3CH2 CH 30 госиз exces) 1. CH30 2.…

A: Given reaction :

Q: Exercise calculate the mean and standard deviation of the following set of analytical data. 15.67,…

A: Mean : It is defined as the average of all the observations. It is expressed as  Mean = {Sum of…

Q: Calculate the acid ionization constant for butanoic acid if a 0.155 M solution is 1.15% ionized.…

A:

Q: cat. H+ excess CH3OH -H₂O O.

A: Here we are required to draw the curly arrow mechanism for the reaction.

Q: 255mL Erlymyer flask weights 114.85g. A small amount of X__liquid is added, and sealed,  and the…

A:

Q: 18. Predict this element based on the image:

A: For a given element : Atomic number = number of electron = number of proton Atomic mass = number of…

Q: 1. An unknown liquid is added to a beaker of water. After a few minutes you discover that unknown…

A: Ionic bonds are mainly formed by 's' block elements and 'p' block elements. Covalent bonds are…

Q: 12 A ribbon diagram of a zinc metallo-beta-lactamase protein is shown. Label the secondary…

A:

Q: 8 Consider the distribution of a solute X between two immiscible solvents: water and ether. X(aq) =…

A:

Q: electrons fill lower-energy orbitals before higher-energy orbitals one electron a single electron…

A: Given  fill in the blanks

Q: 3500 3000 2500 Wavenumbers (cm-1) 2000 1500 1000 500 2918.33 1582.03 1555.10 1328.07 1711.76 1513.85…

A: Stretching peaks are visible.

Q: 4. Differentiate strong bases from weak bases in terms of dissociation.

A: Differentiate strong bases from weak bases in terms of dissociation.

Q: Formula CCL CH₂Br CH₂0 (C central atom) CH₁ CCLF PCL H₂S SiO₂ Lewis Diagram Molecular Geometry Name…

A: we have to complete the given tables

Q: A Chemistry student at Agora is calculating the average atomic mass of Potassium using the following…

A:

Q: 3. A fireproof safe is made of two thin metal boxes, one inside the other, with equal spacing…

A: When smaller box is placed in larger box , some of the volume will remain empty between the boxes.…

Q: g. h. i. OH HBr to HCI Br excess HS:

A: To find out the missing reagent as well as products we have to look out the detail mechanistic…

Q: Which species is formed when the CH3N₂* cation loses a nitrogen molecule? A. H3C B. H₂C: C. H3C. D.…

A:

Q: V. Answer the following problems: 1. As ample of neon of mass 8.00 g occupies 20.5 dm³ at 305K. (a)…

A: Mass of neon (MW = 20.18 g/mol) inside the container = 8.00 g  => Moles of neon (MW = 20.18…

Q: Question: The solubility of Oxygen gas (O2(g)) in water in units of (g O₂/100 g H₂O) is described by…

A:

Q: A solution was prepared by dissolving 2.0 g of material in 1500 mL of water, removing 1 mL of this…

A: Given,  Mass of solute = 2 g Molar Mass of solute = 147 g/mol

Q: 33. An unknown compound, X, is known to possess two groups that ionize as the pH changes. One of…

A: The unknown acid is a diprotic acid, H2A. For H2A, pKa1 = 2.0  We have to find pKa2.

Q: Nitrogen and hydrogen combine at a high temperature, in the presence of a catalyst, to produce…

A: In this reaction, 1 mole nitrogen gas react with 3 mole hydrogen gas to form 2 mole ammonia.

Q: Silicon has three isotopes: Silicon-28, Silicon-29, and Silicon-30. Which isotope is the most…

A: •So basically this question is based on mass of elements calculated from their isotopes and their…

Q: Question 4 What are the stereochemistries of the two double bonds in the structure below? orlo Bond…

A: Now we have to calculate the E/Z stereochemistry of the given double bonds as follows

Q: 2) Express the equilibrium constant for the following reaction. 2 CH3C1(g) + Cl2 (g) 2 CH2Cl2 (g) +…

A: At equilibrium, the rate of the forward and the reverse reaction is the same and the concentration…

Q: Consider the reaction: C(s) + 1/2O₂(g) = CO(g) Write the equilibrium constant for this reaction in…

A:

Q: 1. Consider a solution (20 ppm atrazine, Methanol), (fw atrazine 215.68) a. What is the…

A: 1) Parts per million (ppm): It is defined as the parts of solute in one million parts of solution.…

Q: Consider the following reaction: 2HI(g) → H₂(g) + 12 (9) If 2.13 moles of HI(g), 0.501 moles of H₂,…

A:

Q: Gaseous ethane (CH₂CH3) reacts with gaseous oxygen gas (0₂) to produce gaseous carbon dioxide (CO₂)…

A: Ethane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: 1. The molar solubility of a soluble salt increases appreciably with increasing ionic strength of…

A: #1: Due to the increase in ionic strength, the dissociated ions obtained from the soluble salts are…

Q: QUESTION 5 Identify the reaction type.   2 Al + 3 Cu(NO3)2 → 3 Cu + 2 Al(NO3)3       single…

A:

Q: Energy in the reaction center comes from

A: Given : reaction centre

Q: An experiment followed the decomposition of nitrogen dioxide to nitrogen monoxide and oxygen gas.…

A: To check the order of the reaction, let's assume the reaction is 1st order.  The rate equation for…

Q: What is the resulting pH if 2.0 mL of a 100 mM HCl solution is added to 100 mL of a 10.0 mM solution…

A: HCl is strong acid and phosphoric acid is weak acid with the formula H3PO4. H3PO4 is a tribasic…

Q: A student ran the following reaction in the laboratory at 448 K: PC15 (9) PC13 (g) + Cl₂ (g) When…

A:

Q: mechanism that explains the formation of the following product. In your mechanism, explain the cause…

A: In this question, we have to explain the steps in the given mechanism.

Q: Calculate the volume, in milliliters, of 0.170 M NaOH that must be added to 403 mL 0.0479 M…

A: Using Henderson hasselbalch equation we can figure out the volume of NaOH solution required.

Q: In an experiment, from a 500.0-mL stock solution of an analyte, student uses 25.0 mL aliquot and…

A: Given concentration of final solution = 0.33 M

Q: Can oxalix acid and oxalate form a buffer? If not, what would be the species of a buffer if it would…

A: Oxalic acid, H2C2O4(aq) is a diprotic weak acid with pKa1 = 1.27 and pKa2 = 4.28  The dissociation…

Q: OH 0.

A: Chiral center is carbon that have four different atoms or groups of atom attached. Chiral center is…

Q: 8. A compound contains 40.0% C, 6.71% H, and 53.29% O by mass. The molecular weight of the compound…

A: There are many ways to express a molecule such as empirical formula, molecular formula etc. The…

Q: If 9.09 mol of nitrogen react with excess hydrogen, how much ammonia will be produced, in grams?…

A:

Q: A 10.00 ml sample of a solution of acetic acid in water was titrated to the endpoint by the addition…

A: Molarity is defined as moles of solute present in one litre of solution.  The reaction between…

Polymers

Polymers are naturally occurring or synthetically produced large molecules or compounds which are made up of series of repeating units called monomers. They are joined together by chemical bonds. The term polymer is coined from Greek roots meaning 'many parts' and are found almost everywhere from the plastics bags to the rubber of our tires to our DNA strands.