QUESTION 13 A fictitious electrochemical cell has anode A and cathode B with a standard cell potential of 1.68 V. Currently the concentration of A+ is 0.625 M and the concentration of B 4+ is 0.0725 M. If 4 moles of electrons are transferred, what is the cell potential under these non-standard conditions? 1.29 V 1.47 V 1.69 V 0.841 V 1.07 V

QUESTION 13 A fictitious electrochemical cell has anode A and cathode B with a standard cell potential of 1.68 V. Currently the concentration of A+ is 0.625 M and the concentration of B 4+ is 0.0725 M. If 4 moles of electrons are transferred, what is the cell potential under these non-standard conditions? 1.29 V 1.47 V 1.69 V 0.841 V 1.07 V

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 105QAP: Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a)...

See similar textbooks

Similar questions

Calculate the theoretical potential of each of the following cells. Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Pt|Cr3+(2.00 10-4M),Cr2+(1.50 10-3 M)||Pb2+ (5.60 0215 10-2M)|Pb (b) Hg|Hg22+(2.00 10-2 M)||H+(1.50 10-2 M),V3+ (2.00 10-2M),VO2+(3.00 10-3M)|Pt (e) Pt|Fe3+(3.00 10-2 M), Fe2+ (4.00 10-5M)||Sn2+ (3.50 10-2M), Sn4+ (5.50 10-4 M)|Pt
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Zn|Zn2+(0.50M)Cd2+(0.020M)|Cd (b) Cu|Cu2+(0.0010M)H+(0.010M)|H2(1.00atm)|Pt
Which of the changes below will increase the voltage of the following cell? Co|Co2+(0.010M)H+(0.010M)|H2(0.500atm)|Pt (a) Increase the volume of COCl2 solution from 100 mL to 300 mL. (b) Increase [H+] from 0.010 M to 0.500 M. (c) Increase the pressure of H2 from 0.500 atm to 1 atm. (d) Increase the mass of the Co electrode from 15 g to 25 g. (e) Increase [CO2+] from 0.010 M to 0.500 M.
A metallurgist wants to gold-plate an object with a surface area of 17.21 in2. The gold plating must be 0.00200 in. thick (assume uniform thickness). (a) How many grams of gold (d=10.5g/cm3) are required? (b) How many minutes will it take to plate the object from a solution of AuCN using a current of 7.00 A? Assume 100% efficiency.
For each of the following half-cells, compare electrode potentials calculated from (1) concentration and (2) activity data. (a) HCI(0.0200 M),NaCI(0.0300 M)|H2(1.00 atm),Pt (b) Fe(CIO4)2(0.0111 M),Fe(CIO4)(0.0111 M)|Pt
What is the voltage of a concentration cell of Fe2+ ions where the concentrations are 0.0025 and 0.750 M? What is the spontaneous reaction?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Consider a battery made from one half-cell that consists of a capper electrode in 1 M CuSO4 solution and another half—cell that consists of a lead electrode in 1 M Pb(NO3)2 solution. (a) What are the reactions at the anode, cathode, and the overall reaction? (b) What is the standard cell potential for the battery? (c) Most devices designed to use dry-cell batteries can operate between 1.0 and 1.5 V. Could this tell he used to make a battery that could replace a dry-cell battery? Why or why not. (d) Suppose sulfuric acid is added to the half—cell with the lead electrode and some PbSO4(s) forms. Would the cell potential increase, decrease, or remain the same?
You have a concentration cell with Cu electrodes and [Cu2+] = 1.00 M (right side) and 1.0 104M (left side). a. Calculate the potential for this cell at 25C. b. The Cu2+ ion reacts with NH3 to form Cu(NH3)2+ by the following equation: Cu2+(aq)+4NH3(aq)Cu(NH3)42+(aq)K=1.01013 Calculate the new cell potential after enough NH3 is added to the left cell compartment such that at equilibrium [NH3] = 2.0 M.
What is wrong with the following statement: The best concentration cell will consist of the substance having the most positive standard reduction potential. What drives a concentration cell to produce a large voltage?
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
What is the voltage of a concentration cell of Cl ions where the concentrations are 1.045 and 0.085 M? What the spontaneous reaction?