Suppose myoglobin is prepared with Zn²+ in the place of Fe²+ in the porphyrin. Would you expect this modified myoglobin to bind oxygen? No, because Zn²+ cannot partially transfer an electron to oxygen to form a complex. Yes, because oxygen can form a bond with either Zn²+ or Fe²+. No, because the larger size of Zn²+ will prevent the ion from fitting within the porphyrin ring. Yes, because oxygen binding to myoglobin depends solely on the presence of a distal histidine.
Q: What fraction of estrogen receptors is expected to be free in the presence of an estradiol…
A: To determine the fraction of estrogen receptors that are expected to be free in the presence of an…
Q: Question. Explain the signal transduction mechanism for slow ligand-gated ion channels.
A: Signal transduction mechanisms convert extracellular signals into many cellular responses,…
Q: It is necessary to purify the enzyme before the characterization process?
A: Amazing biological molecules called enzymes catalyze biochemical reactions in living organisms.…
Q: BIOCHEMISTRY Why is 20% FicollPM-‐400 added to Reverse transcription reaction?
A: Non-ionic, highly branched polymer Ficoll PM-400 is used in molecular biology and biochemistry…
Q: 18. What are erythrocytes ghost and how are they prepared
A: Erythrocyte ghosts, also known as membranes or "ghosts," are red blood cell membranes that remain…
Q: 1. Which of the following choices is correct about the active site of an enzyme? A. contains amino…
A: The area of an enzyme where the substrate is bound is called the active site. It is created from…
Q: 89. Briefly explain why all starch molecules are pretty much the same but there are millions of…
A: Biomolecule diversity and complexity fascinate molecular biologists and enthusiasts. Starch and…
Q: Collagen is composed of the collagen triple helix containing 1042 amino acids, How long is the…
A: Structure of Collagen: Collagen is a major structural protein in the extracellular matrix. It is…
Q: Calculate the unknown concentration of the PROTEIN D with an absorbance value of A554 given the…
A: A linear regression analysis will be required to determine the unknown concentration of Protein D.…
Q: 33. How can people with diabetes monitor their blood glucose levels?
A: Diabetes management requires blood glucose monitoring. Understanding blood sugar levels helps…
Q: 367. Describe the two main mechanisms of intercellular communication and know which is the most used…
A: The two main methods of intercellular communication are direct (juxtacrine) and indirect (paracrine,…
Q: The products of the acid hydrolysis of a triacylglycerol (fat) are Select one: a. fatty acids and…
A: When a triacylglycerol (fat) undergoes acid hydrolysis, it is broken down into its constituent…
Q: Drag the terms on the left to the appropriate blanks on the right to complete the sentences. Terms…
A: Nucleotide metabolism is the set of biochemical reactions that involve the synthesis and breakdown…
Q: What is caffeine? what are the positive effects of caffeine? Why do teachers drink coffee, how does…
A: Plant secondary molecules are various groups of biomolecules produced by plants that give them…
Q: Oxaloacetate + ADP + Pi + H+ ---> Pyruvate + ATP + HCO3* kJ/mol kJ/mol kJ/mol kJ/mol Lactate + NAD+…
A: In a general reaction such as:aA + bB ⇌ cC + dDAt equilibrium (steady state), the concentration of…
Q: 2. Draw the condensed structural formula for the triacylglycerol made from 3 saturated fatty acids…
A: In saturated fatty acids, all the carbon-carbon bonds are single bonds, and each carbon atom is…
Q: Glycolysis and Gluconeogenesis are regulated through differential regulation a) What does…
A: Glycolysis and Gluconeogenesis are 2 metabolic pathways that run in opposite directions, with…
Q: The standard reduction potential for (NAD+/NADH) is -0.320 V and the standard reduction potential…
A: a. The standard free energy change (ΔG°) for the Lactic acid dehydrogenase reaction is -26 kJ/mol.d…
Q: 1. Supposed you want to use phosphoglucomutase to breakdown glycogen. You found out that this enzyme…
A: Protein-based biomolecules belonging to the class of enzymes speed up chemical reactions.. Enzymes…
Q: A monoprotic weak acid, HA, dissociates in water according to the reaction HA(aq) → H+ (aq) + A¯(aq)…
A: A weak acid is an acid that undergoes partial dissociation and produces proton and a conjugate base.…
Q: DATA Determine the Molar concentration of your dilutions using the formula M₁V₁ = M₂V2. The initial…
A: Dilution is the process of lowering the concentration of a solute in a solution by adding more…
Q: Calculate the free energy required to move 1 mol of K* ions from inside the cell (where…
A: To calculate the free energy required to move 1 mol of K+ ions from inside the cell to the outside,…
Q: 2. Estimate the pl of a Peptide. Estimate the pl for the following peptide: EHSLRGGA 3. Estimate the…
A: Recall that:Amino acid sequences are written with N-terminal amino acid on the left and C-terminal…
Q: BIOCHEMISTRY If the protein is more hydrophobic, then adding additional charge is not the best…
A: Several excipients can disrupt hydrophobic interactions in hydrophobic proteins without adding NaCl.…
Q: Identify the class of lipid of the following molecule: O 11 CH3-(CH2)18-C-O-(CH2)19-CH3 steroid…
A: Lipids are a diverse group of hydrophobic organic molecules that play essential roles in living…
Q: Q. What is hyperglycemia?
A: Hyperglycemia is high blood sugar. It mostly affects diabetics but can also affect non-diabetics. It…
Q: Which of the proteins: the CAP or the lac repressor, does the eukaryotic nuclear receptor for the…
A: There are steroid hormones (compounds with characteristic sterol rings). Steroid hormones can be…
Q: BIOCHEMISTRY Does a hand warming product that is worn inside the gloves undergo a chemical…
A: Yes, many gloves-worn hand warming products release thermal energy and warmth through a chemical…
Q: Can you explain to me why choice E is the correct answer and break down why the other options are…
A: Resting potential is the membrane potential when the neurons are not sending electrical signals,…
Q: Ice floats because of the electronegativity of oxygen that withdraws electron density from the…
A: 70% of a living cell is made up of water. A water molecule is made up of two hydrogen atoms…
Q: 15. Which of the following amino acid residues would most likely be buried in the interior of a…
A: Protein Folding is a process by which a simple peptide chain is folded to get a functional 3-D…
Q: Presentation about Atherosclerosis -molecular aspect -molecular effects -enzyme effect -general…
A: Introduction:Brief overview of atherosclerosis as a common cardiovascular disease.Importance of…
Q: 12. Receptor immobalization on surfaces for developing bio-sensors
A: Immobilizing receptors on surfaces is essential to developing biosensors, which detect and quantify…
Q: A. If 200 mls of 0.02 M NaoH is added to 800 mls of 0.15 M phosphoric acid buffer at pH 8.2, what is…
A: The phosphoric acid buffer pH is at 8.2. So, it will be H2PO4- that will be acting as the weak acid…
Q: Please give answer Define polymer and monomer.
A: Polymer:The Large and very high molecular weight molecules that consist of chains of small molecule…
Q: Question 8 of 15 Which cell organelles are not enclosed by phospholipid bilayer? Select the correct…
A: A phospholipid bilayer is a fundamental structural component of cell membranes, including those…
Q: Which of the following molecules' production is likely to be subject to feedback inhibition in a…
A: Tryptophan synthesis is typically regulated by feedback inhibition in bacteria. This process is…
Q: GIVE ANSWER DISCUSS THE SOURCE OF THE INPUTS (WHERE DO THEY COME FROM) AND WHAT OCCURS WITH THE…
A: Attention-Grabbing: It should capture the audience's attention and entice them to continue reading…
Q: 55. State characteristics or demographics of persons affects with Alzheimer's disease?
A: The progressive neurological disorder Alzheimer's disease affects cognition, memory, and behavior.…
Q: 6. A quantitative amino acid analysis reveals that bovine serum albumin (BSA) contains 0.58%…
A: Amino acids, such as glycine, tryptophan, and alanine are organic molecules that contain an amino…
Q: Sulfur Containing Amino Acid Hydroxy Containing Amino Acid
A: The human body is made up of protein. The biological catalyst enzymes, hair, bone, and muscle are…
Q: Which of the following is not a characteristic of an isoprene unit? Alternate triple bonds Five…
A: Details
Q: Would you expect to find serine and lysine on the inside or outside of the tertiary
A: Amino acids are known as the building blocks of proteins. They contain an amino group (NH3), a…
Q: 125. Choose between the light dependent reaction or the Calvin cycle steps of photosynthesis
A: Plants, algae, and some bacteria use photosynthesis to convert sunlight into life-sustaining energy.…
Q: cyanogen bromide for c trypsin will cleave b what thing will be cleave site a and d?
A: The proteases are enzymes that are capable of hydrolyzing peptide bonds in substrate proteins.This…
Q: The antiparallel nature of DNA ensures that identical RNA transcripts will be produced regardless of…
A: DNA is deoxy ribo nucleic acid and consist of two strands that wind around each other like a twisted…
Q: Which of these amino acids is a basic amino acid? (Select all that apply, if necessary.) A. B. C. E.…
A: Amino acids are biomolecules that have an amino group and a carboxyl group linked to the same carbon…
Q: 55. what is the difference between the BIGpharma and biopharma
A: Biopharma and Big Pharma comprise the pharmaceutical industry. Biopharma develops biologics from…
Q: Draw a non-enzymatic mechanism to describe the formation of the imine between retinal and lysine.…
A: Retinal absorbs a photon and this leads to a conformation change. This leads to the formation of an…
Q: How does the concentration of 2,3 BPG affect hemoglobin's P50 for oxygen? select the correct answer…
A: p50 is the partial pressure of oxygen or the oxygen tension when hemoglobin is 50 % saturated with…
Trending now
This is a popular solution!
Step by step
Solved in 3 steps with 1 images
- Certain multi-headed myosins bind cooperatively to actin filaments. The binding interaction is mainly electrostatic in nature, so the presence of additional salt (ions) in solution can interfere with binding; ions will tend to associate with charged residues on the two proteins, blocking electrostatic attractions that would otherwise take place. Briefly describe the expected shape of the binding curve for one of these myosins, and what will happen to the shape when the salt concentration increases.The filaments of skeletal muscle are moved by free energy derived from the hydrolysis of ATP. During sustained muscle contraction ATP levels remain fairly constant, while levels of creatine phosphate fall. Explain why this is so. Under what circumstances is an oxygen debt incurred during muscle contraction?Explain how the overall three-dimensional shape of myoglobin allows it to function as an oxygen-storage molecule
- Myosin II has a duty ratio of 10 percent, and its step size is 8 nm. In contrast, myosin V has a much higher duty ratio (about 70 percent) and takes 36-nm steps as it walks down an actin filament. What differences between myosin II and myosin V account for their different properties?Myoglobin’s oxygen-binding curve exhibits a shape best described as— serpentine. hyperbolic. straight. sigmoidal. bell.You know from experience that skeletal muscle tires quite quickly, especially if there is not enough oxygen. Interestingly, shellfish such as clams can maintain a month-long contraction in the muscle that keeps the shell closed. No oxygen gets in this situation. These muscles have a different version of myosin called paramyosin. Knowing what you know about the cellular mechanism of muscle contraction, propose a hypothesis to explain how paramyosin might work.
- With regard to muscle contraction, which of the following is an INCORRECT statement with regard to the interactions of filaments that occur in the sarcomere? A. When muscles are relaxed tropomyosin blocks binding sites on actin subunits, which keeps cross-bridges from forming. B. The myosin heads conduct a power stroke motion to slide when bound to actin, to move the "thin" filaments towards the center of the sarcomere. C. During contraction, actin subunits are removed from the ends of the "thin" filaments to shorten actin polymers, thus reducing the length of the sarcomere. D. "Thick" filaments are anchored at the M-line, while "thin" filaments are anchored at the Z-line. E. Numerous myosin heads engage with the actin filaments simultaneously, such that there is no back-slipping during the contraction process.The sliding-filament model of skeletal-muscle contraction assumes a sliding or slipping of interdigitating filaments of actin and myosin. Electron micrographs show that during contraction the actin and my-osin filaments remain of constant length while the distance between Z lines shortens. Explain how this happens in terms of the molecular structure of the muscle filaments. What is the role of regulatory pro-teins (troponin and tropomyosin) in contraction?Calmodulin is found in smooth muscle cells and performs a similar function to troponin in striated muscle fibers. However, calmodulin not only gets activated by Ca2+ but also slows the release of Ca2+ from the sarcoplasmic reticulum. How might this difference relate to the different kinds of contractions smooth muscles do in comparison to striated muscles?
- Skeletal muscle cells undergo contractions based on a molecular mechanism involving: 1)the sliding of actin and myosin filaments past each other without any change in filament length 2) the shortening of actin filaments following direct interaction with myosin 3) dynamic instability of microtubules 4)noneExplain how the structure of myoglobin changes upon oxygen binding.Muscle fibers that have a high number of mitochondria, contain largeamounts of myoglobin, and exhibit low rates of ATP hydrolysis arecalled __________ fibers.a. slow-glycolyticb. fast-glycolyticc. intermediated. fast-oxidativee. slow-oxidative