termine E°, AG" , and K for the overall reaction from the balanced half-reactions and their standard reduction potentials. 4 Fe3+ + 2H,0 2 4 Fe²+ + O, + 4 H+ Fe3+ + e-= Fe2+ 0, + 2 H* + 2 e¯ H,0 E° = 0.771 V E' = 1.229 V

termine E°, AG" , and K for the overall reaction from the balanced half-reactions and their standard reduction potentials. 4 Fe3+ + 2H,0 2 4 Fe²+ + O, + 4 H+ Fe3+ + e-= Fe2+ 0, + 2 H* + 2 e¯ H,0 E° = 0.771 V E' = 1.229 V

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 54E: The equation G = nF also can be applied to half-reactions. Use standard reduction potentials to...

See similar textbooks

Related questions

Q: For the cell shown, the measured cell potential, Ecell, is -0.3657 V at 25 °C. Pt(s) | H₂(g, 0.777…

A: Given-> 2H+(aq) + 2e- ------> H2(g) E°= 0.00 V Cd2+(aq) + 2e- -------> Cd(s) E°= -0.403 V…

Q: The following standard reduction potentials have been determined for the aqueous chemistry of…

A: In3+ (aq) + 2 e- --> In+ (aq) E° = - 0.444 V -----a In+ (aq) +…

Q: Balance the following reaction and then determine the equilibrium constant K for the reaction at…

A: Anode half reaction : T+ → T2+ + e- ...eq 1 Cathode half…

Q: Calculate the standard free energy change in kJ given the standard reduction potentials for the half…

A: Lower the value of standard reduction potential, then the given electrode acts as anode and higher…

Q: Calculate the cell potential given the standard reduction potentials for the half reactions of the…

A: Please find your solution below :

Q: For the cell shown, the measured cell potential, Ecell, is –0.3613 V at 25 °C. Pt(s) | H,(g, 0.771…

A: This question can be solved using Nernst equation. Please refer to the attached picture for the full…

Q: For the cell shown, the measured cell potential, Ecell, is –0.3601 V at 25 °C. Pt(s) | H, (g, 0.857…

A: For an electrophilic cell, Ecell = -0.3601V T = 25°C The balanced reduction half-reactions for…

Q: For the reaction: Pd2+ + Ni → Ni²+ + Pd , AG° is –239 kJ/mole. What is the standard reduction…

A: The tendency possessed by ions to get reduced in any reaction is termed as its "standard reduction…

Q: The cell potential of the following cell is determined using an unspecified concentration of acid.…

Q: Calculate the standard free energy change in kJ given the standard reduction potentials for the half…

A: An electrochemical cell consist of both oxidation and reduction occur

Q: The cell potential of the following cell is determined using an unspecified concentration of acid.…

Q: The measured cell potential, Ecell, for the cell shown is –0.3549 V at 25 °C. Calculate the H*…

A: If standard reduction potential values of two half cells are given then the half cell with less…

Q: The cell potential of the following cell is determined using an unspecified concentration of acid.…

Q: Use standard reduction potentials to calculate the equilibrium constant for the reaction: Hg2+(aq) +…

A: Given reaction: This reaction occur in room temperature as in question…

Q: For the cell shown, the measured cell potential, Ecell, is -0.3657 V at 25 °C. Pt(s) | H₂(g, 0.777…

A: Ecell = 0.3657 V PH2 = 0.777 atm The balanced reduction half reactions 2 H+ (aq) + 2 e- ----->…

Q: The cell potential of the following cell is determined using an unspecified concentration of acid.…

Q: For the cell shown, the measured cell potential, ?cell is −0.3723 V at 25 °C25 °C. Pt(s) |…

A: Half-cell reactions: H2(g) + 2e- → 2H+(aq) E0 = 0.00V Cd2+(aq) + 2e_ → Cd(s) E0 = -0.403V…

Q: For the cell shown, the measured cell potential, Ecell, is –0.3669 V at 25 °C. Pt(s) | H, (g, 0.713…

Q: [3] Given the Standard Reduction Potentials at 25°C, Mn++2e Mn E° =-1.185V and Hg+2e - Hg E° =…

A: 1- When the standard reduction potential is negative that means it is an oxidation half reaction and…

Q: Use standard reduction potentials to calculate the equilibrium constant for the reaction: Hg2*(aq) +…

A: In this question determine E°cell. ∆G° = -nFE°cell also ∆G° = -2.303 RT log K

Q: For the cell shown, the measured cell potential, ?cell, is −0.3723 V at 25 °C. Pt(s) | H2(g,0.773…

A: [ H+] = 0.091 M

Q: Consider the following redox half-reaction at 25 °C: MnO4 (aq) + 8 H* (aq) + 5 e¯ → Mn²* (aq) + 4…

Q: Pt(s) Br (aq) (x M) | Br21) || BrO3¯(aq) (0.43 M), H*(aq) (1.00 M) | Br2(1) | Pt(s)

Q: Calculate the standard free energy change in kJ given the standard reduction potentials for the half…

A: Answer : - 61.57 KJ

Q: Based on the half-reactions and their respective standard reduction potentials below, which addition…

A: Redox reactions are those in which oxidation and reduction processes occur at the same time. It…

Q: Using the following standard reduction potentials, Fe"(ag) +--Fe (ag) Ca"(ag)• 2eCd(s) E+0.77 V…

A: The standard electrode potential is the tendency of an electrode to lose or gain the electron at…

Q: The above cell shows the standard half-cell potentials as follows: 4+ 3+ Pu*t + e → Pu' E° = 0.97V…

Q: Calculate the standard free energy change in kJ given the standard reduction potentials for the half…

A: Cell reaction on the basis of given half cells Y2 (l) + 2 X2+ (aq) → 2 Y- (aq) + 2X3+ (aq)

Q: 1. Write the anodic, cathodic and net cell reactions, calculate the EMF of the electrochemical cell…

A: Given: Standard reduction potential of CD = -0.40 V Standard reduction potential of Mg = -2.37 V…

Q: Calculate the standard cell potential of the following cell at 25°C: Pb(s) | Pb?+ (ag) || Cu2+ (ag)…

A: In a galvanic cell, oxidation takes place in anode and reduction takes place in cathode. Non…

Q: For the cell shown, the measured cell potential, Ecell, is -0.3669 V at 25 C Pt(s) / H2 (g, 0.723…

A: We will use nernesy equation to get the answer

Q: 1. Calculate the cell potential, AG (J), and the equilibrium constant Keq for the following…

A: Calculation of Cell potential of the cell

Q: For the cell shown, the measured cell potential, Ecet, is -0.3715 V at 25 °C. P(s) | H,(g.0.857 atm)…

A: Given- Ecell =-0.3715V PH2=0.857atm Concentration of Cd2+=1.00M

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: Note : As data from table is not clear so i took the reference from standard book.

Q: The measured cell potential, Ecell, for the cell shown is –0.3549 V at 25 °C. Calculate the Ht…

A: Given: E∘cell is -0.3549 V. H2→2H+aq+ 2e- Eo=0.00 V Cd2+aq+ 2e-→Cds Eo=-0.403 V…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: First we would write reduction and oxidation half reactions and use given standard reduction…

Q: A reaction 1 Ag*(aq) + H2 (g) → H* (aq) + Ag(s) Takes place in a cell and the standard cell…

A: Ag+ (aq) + 0.5 H2 (g) ==> H+(aq) + Ag(s)

Q: Calculate E° cll from the tabulated standard reduction potentials for each of the following…

A: In the given reaction MnO4- is getting reduced while Fe+2 is getting oxidised.

Q: Calculate the standard free energy change in kJ given the standard reduction potentials for the half…

A: Interpretation- To calculate standard free energy change in kJ given the standard reduction…

Q: Use standard reduction potentials to calculate the equilibrium constant for the reaction: Hg2+(aq) +…

Q: Determine ?∘E∘, Δ?∘ΔG∘, and ?K for the overall reaction from the balanced half-reactions and their…

A: Given half cell reactions are : Co3++e- ⇌ Co2+ E°=1.92 (i)H3AsO4+2H++2e-⇌…

Q: 3. Consider a galvanic cell for which the anode reaction is Pb(s) → Pb" (aq, 0.10 M) + 2e and the…

A: Given reaction at anode is : Pb (s) -------------> Pb2+ (aq, 0.10 M) + 2e- Given, standard…

Q: The measured cell potential, Ecel, for the cell shown is –0.3573 V at 25 °C. Calculate the H…

A: Standard Emf of the cell is calculated as shown below: E°cell = E°cathode - E°anode

Q: Calculate the standard free energy change in kJ given the standard reduction potentials for the half…

Q: For the cell shown, the measured cell potential, Ecell, is -0.3619 V at 25 °C. Pt(s) | H₂(g, 0.721…

A: Given -> Ecell = -0.3619V Pressure of H2 = 0.721 atm Concentration of Cd = 1.00 M

Q: For the cell shown, the measured cell potential, Ecel, is-0.3621 V at 25 °C. Pt(s) | H, (g,0.853…

Q: Mn(k) | Mn²+(0.2 M) || H+ (pH= ?) | H2 (g, 1.5 atm) | The cell potential of the Pt(k) Cell was found…

Q: What mass of Fe(s) may be deposited from an aqueous FeCl2 solution if a current of 2.50 A is applied…

Q: Calculate the equilibrium constant K for the following reaction at 25°C from standard electrode…

Q: The cell potential of the following cell is determined using an unspecified concentration of acid.…

Question

Determine E°, AG", and K for the overall reaction from the balanced half-reactions and their standard reduction potentials.
4 Fe+ + 2 H,0 2 4 Fe2+ + 0, + 4H*
Fe3+ + e-= Fe2+
10, + 2H+ + 2 e- H,0
E° = 0.771 V
E° = 1.229 V

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
The equation G = nF also can be applied to half-reactions. Use standard reduction potentials to estimate Gf for Fe2+ (aq) and Fe3+ (aq). Gf for e= 0.)
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
In biological systems, acetate ion is converted to ethyl alcohol in a two-step process: CH3COO(aq)+3H+(aq)+2eCH3CHO(aq)+H2OE=0.581V CH3CHO(aq)+2H+(aq)+2eC2H5OH(aq)E=0.197V (E°' is the standard reduction voltage at 25°C and pH of 7.00.) (a) Calculate G°' for each step and for the overall conversion. (b) Calculate E°' for the overall conversion.
Consider the following standard reduction potentials: Tl+(aq)+eTl(s)Ered=0.34VTl3+(aq)+3eTl(s)Ered=0.74VTl3+(aq)+2eTl+(aq)Ered=1.28V and the following abbreviated cell notations: (1) Tl|Tl+Tl3+,Tl+|Pt (2) Tl|Tl3+Tl3+,Tl+|Pt (3) Tl|Tl+Tl3+|Tl (a) Write the overall equation for each cell. (b) Calculate E° for each cell. (c) Calculate G° for each overall equation. (d) Comment on whether G° and/or E° are state properties. (Hint: A state property is path-independent.)
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.