Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free energy AG" for the following redox reaction. Round your answer to 3 significant digits. 10CI" (aq)+210, (aq)+ 12H" (aq) → 5Cl, (g)+1, (s)+ 6H,0 (1) C Data Chlorine Cl2(g) 223.1 Cl(g) 121.3 105.3 165.2 cr(g) -227.3 -240.0 153.36 Cr(aq) -167.2 -131.2 56.5 HCI(g) -92.3 -95.3 186.9 HCI(aq) -167.2 -131.2 56.5 CIO2(g) 89.1 105.0 263.7 Cl20(g) 80.3 97.9 266.2 Chromium 23.8 Cr(s) Cr2*(aq) -138.9 -165 cr*(aq) -1971.0 -1139.7 81.2 118.7 Cr203(s) Continue -727.8 50.2 Cro4? (aq) -881.2

Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free energy AG" for the following redox reaction. Round your answer to 3 significant digits. 10CI" (aq)+210, (aq)+ 12H" (aq) → 5Cl, (g)+1, (s)+ 6H,0 (1) C Data Chlorine Cl2(g) 223.1 Cl(g) 121.3 105.3 165.2 cr(g) -227.3 -240.0 153.36 Cr(aq) -167.2 -131.2 56.5 HCI(g) -92.3 -95.3 186.9 HCI(aq) -167.2 -131.2 56.5 CIO2(g) 89.1 105.0 263.7 Cl20(g) 80.3 97.9 266.2 Chromium 23.8 Cr(s) Cr2(aq) -138.9 -165 cr(aq) -1971.0 -1139.7 81.2 118.7 Cr203(s) Continue -727.8 50.2 Cro4? (aq) -881.2

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section17.6: E⁰cell, Gibbs Free Energy, And K⁰

Problem 17.6PSP

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?