The C-O bond is much shorter in phenol than in ethanol. Give reason.

Q: Draw the structure of a molecule that fi ts each description: a. a 2 ° alcohol of molecular formula…

A: Molecular structure describes the location of the atoms. The bonds are shown as solid lines and the…

Q: Draw an isomer of C5H10O that contains an ether

A:

Q: What is the line structure and structural formula of 4,5-dihydroxy-6-methyl-n-heptanal?

A:

Q: H3C CH₂. CH3 Isobutyl alcohol (1 equiv) H30+

A:

Q: 2. Draw all possible the structural formula and give the IUPAC name of the following compounds: a.…

A: Structural formula are the formula of the compounds consisting of the atoms constituting that…

Q: IUPAC Name Bond-line Formula k. 5-ethyl-2-methylcyclohexanol I. 1,2-difluorocyclohexane

A:

Q: condense structural formulA of C4H8O with carbon-carbon double bonded and a hydroxylic group

A:

Q: Give A Summary of Substitution and Elimination Reactions of Alcohols ?

A: Number of functional group is associated with organic compounds which impart specific chemical and…

Q: which reagent could best be used to distinguish betwween cyclohexene and cyclohexanol?

A: Organic compounds are the compounds which are mainly composed C and H atoms. These compounds also…

Q: draw structural formulas for all isomeric alkanes with molecular formula C7H16. Predict which isomer…

A: Total 9 isomers of heptane are possible which are drawn below :

Q: Explain the solubility of alcohols in water and in n-hexane.

A: The formulae of the given compounds are: Water - H2O n-Hexane - C6H14 Alcohols - R-OH (general…

Q: Identify the functional group: -C-C-C- alcohol O ketone O aldehyde O ether

A: Since you have been posted multiple question so i have solved first one for you. If you want to be…

Q: Which kinds of reactions are common to alcohols? Provide anexample of each.

A: The most common reactions of alcohols can be classified as Dehydration, Oxidation, Esterification,…

Q: CH3 CH3 H2O CH OH CH ОН CH `CH3 Acetic acid Isopentyl alcohol Isoamyl alcohol

A:

Q: What is the structure of (s) 1-chloro-2-propanol with wedge and dash bonds

A: Interpretation: The structure of (s) 1-chloro-2-propanol with wedge and dash bonds are to be shown.

Q: Classify each alcohol as primary, secondary, or tertiary

A: The given compound:

Q: For each molecular formula, draw all the possible constitutional isomers of alcohols withthat…

A: The possible constitutional isomers along with IUPAC name for given alcohols using their given…

Q: ) 2-butanol (c) ethylene glycol (d) cyclohexanol

A: Solubility is depends upon force of attraction.  "Like dissolves like" means polar substance…

Q: Draw a cyclic ether with molecular formula C5H10O

A: Given  Molecular formula   = C5H10O  Structure of Cyclic ether = ?

Q: Is it possible to make an ethanol or ethyl alcohol from papaya?

A:

Q: what is the ΔH° of combustion for 1-pentanol

A: The enthalpy combustion is when enthalpy change that occurs  when  one mole of substance is burned…

Q: PBr3 (phosphorus tribromide) converts alcohols into alkyl bromides. Define ?

A: Alcohols are the organic compounds which contain the -OH functional group. The OH group of alcohol…

Q: What alkane, with molecular formula C5H12, forms only one monochlorinated product when it is heated…

A: Since on monochlorination reaction, any 1 H from any 1 carbon is replaced by Cl Hence the structure…

Q: Is this a secondary alcohol ?

A: Given alcohol is

Q: 2-ethylhexanol+HCN

A: Since there are lone pair electrons on O of the alcohol. Hence it will take proton from the HCN acid…

Q: Write the common name of attached Ketones:

A: Nomenclature of following structure:

Q: From their structures, explain why 1-hexanol is more soluble in ether than water and why boric acid…

A: A hydrogen bond is a bonding form between polar molecules in a solution state with a water molecule.…

Q: write a structural formula for   compound. Q.) cis-3-Isobutylcyclohexanol

A: Given compound name,        cis-3-Isobutylcyclohexanol

Q: For each molecular formula, draw all the possible constitutional isomers of alcohols withthat…

A: Isomerism is the property exhibited by compounds that match in terms of molecular formula but differ…

Q: Ethanol, C2H5OH, and propane, C3H8, have approximately the same molar mass, yet ethanol has a much…

A: The temperature at which the vapor pressure of a liquid becomes equal to the atmospheric pressure is…

Q: CH3 Но OH A. Alkene B. Ether C. Ester D. Aldehyde

A:

Q: Write structural formulas for all ketones with the molecular formula C6H12O and give each its IUPAC…

A: Ketones are carbonyl group-containing compounds. It is the functional group with the structure R2C=O…

Q: trans-2-chloro-1-cyclohexanol is treated with a base, cyclohexene oxide is the product

A: a) Please find below the equation for the reaction between trans-2-chloro-1-cyclohexanol and the…

Q: For each molecular formula, draw all the possible constitutional isomers of alcohols withthat…

A: When two or more compounds have different chemical structures but similar chemical formula then they…

Q: Write a condensed structural formula, such as CH3CH3, and describe the molecular geometry at each…

A: (a) The condensed formula of propene is CH3CH=CH2 . Here the first C atom is =CH2 that forms a…

Q: Classify each description as a property of either alcohols, ethers, or both alcohols and ethers.…

A: There are many functional groups present in organic chemistry such as alcohol, aldehyde, ketone,…

Q: Draw structures for the four constitutional isomers of molecular formula C4H10O that contain an OH…

A: Double Bond Equivalent (DBE) = (C+1)-H/2 = (4+1)-10/2 = 5-5 = 0.  So, it is an aliphatic alcohol.…

Q: Give the structures and IUPAC names for all tertiary alcohols of molecular formula C6H10O.

A: Given the molecular formula for 3° alcohols = C6H10O Write IUPAC name and structures.

Q: Give the IUPAC names of all the alcohols that have the formula C 5 H 12 O

A: In this question, the name of all the possible alcohols has to be determined.

Q: An alkene has 8 chain of carbon atoms where the double bond is on the 2nd carbon starting from the…

A: An alkene has :  8 chain of carbon atoms,  2 chlorine at  3rd and 4th carbon atoms,  C2H5 present at…

Q: a primary alcohol has one -OH group, a secondary has

A:

Q: Give iupac name for this diol CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: IWPAC Nomenclature contain & Pant:-   2 Pnefin (substituents) + 1 Pnefin (Cyclic on Acyclic) +…

Q: Which of the following compounds would have the greatest boiling point, and what is the major reason…

A:

Q: Name all unbranched ether and alcohol isomers with formula C5H12O, and write their structural…

A: Introduction: Isomer: Molecules having same formula but different order or arrangement of atoms in…

Q: Arrange the following alcohols by increased boiling point: a.) 1-hexanol, b.) 1-pentanol, c.)…

A: Boiling point of alcohols is directly proportional to molecular mass of alcohols. Boiling point of…

Q: Consider the following six isomeric alcohols: A) (C2H5);COH C) (C2H5)2C(CH3)CH2OH E) (CH-CH-CH)2снон…

A: The alcohol contains a hydroxy (OH) functional group. In the IUPAC name of the alcohol, we use ol…