Question 7 The cell notation for the Galvanic cell is A(SYA²*/B2(s)/B¯ The Standard Reduction Potential are as follows: E°A2+/A = -0.403 V; E'B2/B" = 0.5355 V Calculate the standard cell potential If the A ions have a concentration of 0.010 M and the B ions have a concentration of 0.020 M, calculate the electromotive force (EMF) of the cell. The Gibbs Free Energy of the cell

Question 7 The cell notation for the Galvanic cell is A(SYA²*/B2(s)/B¯ The Standard Reduction Potential are as follows: E°A2+/A = -0.403 V; E'B2/B" = 0.5355 V Calculate the standard cell potential If the A ions have a concentration of 0.010 M and the B ions have a concentration of 0.020 M, calculate the electromotive force (EMF) of the cell. The Gibbs Free Energy of the cell

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 105QAP: Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a)...

See similar textbooks

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Calculate E° for the following cells: (a) Pb|PbSO4Pb2+|Pb (b) Pt|Cl2|ClO3O2|H2O|Pt (c) Pt|OH|O2ClO3,Cl|Pt(basic medium)
The cell Ag|AgCl(sat’d)||H+(a = x)|glass electrode has a potential of —0.2094 V when the solution in the right-hand compartment is a buffer of pH 4.006. The following potentials are obtained when the buffer is replaced with unknowns: (a) —0.2806 V and (b) —0.2132 V. Calculate the pH and the hydrogen ion activity of each unknown. (c) Assuming anuncertainty of 0.001 Vin the junction potential, what is the range of hydrogen ion activities withinwhich the true value might be expected to lie?
Consider the following galvanic cell: a. Label the reducing agent and the oxidizing agent, and describe the direction of the electron flow. b. Determine the standard cell potential. c. Which electrode increases in mass as the reaction proceeds, and which electrode decreases in mass?
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Zn|Zn2+(0.50M)Cd2+(0.020M)|Cd (b) Cu|Cu2+(0.0010M)H+(0.010M)|H2(1.00atm)|Pt
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Cu|Cu+(0.80M)Hg22+(0.10M)|Hg|Pt (b) Cr|Cr3+(0.615M)Ni2+(0.228M)|Ni
What cathode potential (versus SCE) would be required to lower the total Hg(II) concentration of the following solutions to 1.00 10-6 M (assume reaction product in each case is elemental Hg): (a) an aqueous solution of Hg2+? (b) a solution with an equilibrium SCN- concentration of 0.100 M? Hg2+ + 2SCN- Hg(SCN)2(aq) = Kf = 1.8 107 c) a solution with an equilibrium Br- concentration of 0.100 M? HgBr42++ 2e- Hg(l) + 4Br- E0= 0.223 V
Determine the standard cell potential and the cell potential under the stated conditions for the electrochemical reactions described here. State whether each is spontaneous or nonspontaueous under each set of conditions at 293.15 K. (a) Hg(l)+S2(aq,0.10M)+2Ag+(aq,0.25M)2Ag(s)+HgS(s) (b) The galvanic cell made from a half-cell consisting of an aluminum electrode in 0.015 M aluminum nitrate solution and a half—cell consisting of a nickel electrode in 025 M nickel(l) nitrate solution. (c) The cell made of a half-cell in which 1.0 M aqueous bromide is oxidized to 0.11 M bromine ion and a half-cell in which aluminum ion at 0.023 M is reduced to aluminum metal. Assume the standard reduction potential for Br2(l) is the same as that of Br2(aq).
In biological systems, acetate ion is converted to ethyl alcohol in a two-step process: CH3COO(aq)+3H+(aq)+2eCH3CHO(aq)+H2OE=0.581V CH3CHO(aq)+2H+(aq)+2eC2H5OH(aq)E=0.197V (E°' is the standard reduction voltage at 25°C and pH of 7.00.) (a) Calculate G°' for each step and for the overall conversion. (b) Calculate E°' for the overall conversion.