The distribution constant for compound A between an organic solvent and water is 65. Calculate the concentration of compound A remaining in the aqueous layer after extraction of 50 mL of a 5 X 10-3 M aqueous solution of compound A with the following quantities of the organic solvent: (a) Two 25 mL portions (b) Four 12.5 mL portions
Q: None
A:
Q: Chemistry
A: Step 1: Firstly Born Haber cycle is constructed then using the given data, lattice enthalpy of s…
Q: Chemistry
A: For IUPAC name of phenols, identify the substituents and alcohol group. Start the numbering in the…
Q: Chemistry
A: Given: [ClCH2CO2H]=0.50M;[ClCH2CO2−]=0.50MpH=2.87;Vbuffer=100.0mL;molOH−=0.010molStep 1: Write…
Q: None
A: Thank you.
Q: For each of the following molecules how many signals would be expected in the HNMR spectra? spectra.…
A:
Q: None
A: To solve for the new pressure P2 when the temperature changes from T1 to T2, you can use the ideal…
Q: Give detailed Solution with explanation needed..don't give Handwritten answer..don't copy the answer…
A: Step 1: Step 2:When two atoms of different electronegativity are bonded to each other through…
Q: -A02 A SPECTROSCOPIC STUDY: SMART WORKSHEET CHLORO-COMPLEX STOCK SOLUTIONS MASS AND VOLUME Mass of…
A: Step 1: Identify the mass and volume details from the worksheet.Mass of green chloro-complex used to…
Q: Give detailed Solution with explanation needed in detailed. Don't give Handwritten answer. don't use…
A: To determine which acid, 0.1 M HCl or 0.1 M H2SO4, would require more volume to neutralize 30 mL of…
Q: please fill out this table with step by step explanation
A:
Q: esc 1 Given the following reactions N2 (g) + O2 (g) → 2NO (g) AH=+180.7 kJ 2N2O (g) → O2 (g) + 2N2…
A:
Q: Draw the major product formed when 1,3-hexadiene reacts with this acid. Do not include any…
A: Step 1: Information: As we know that diene is the molecule that containing two carbon carbon…
Q: Predict the Intermediate and Mechanism. Predict the esterification intermediate resulting from the…
A: Step 1:Detailed mechanism with arrow pushing:1. Protonation of the carbonyl: [ \text{R-C(=0)-Cl…
Q: A particular carborane has the following mass percentages: 67.09%B and 21.30%C.What is the empirical…
A: Step 1: Recall that carborane contains the elements carbon (C), boron (B), and hydrogen (H). Assume…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: In the given question we have to explain why the number of atoms of Aluminium and magnesium is same…
Q: 3. 3.1 State possible errors in the reactions given below. OH 1. CH3CH2MgCl 2. H₂O* 3.2 NH2 NH2 Cl₂…
A: The first reaction is CH3CH2MgCl + H₂O -> OH. This reaction is incorrect because the Grignard…
Q: 7. Explain how you could tell them apart, both by mass spectrometry and by infrared spectroscopy. IR…
A: Mass spectrometry (MS) is a technique used to identify and quantify substances by separating ions…
Q: What is the volume of 0.789 moles of gas that exerts 1.15 atm of pressure at 376 K? R=0.08206…
A: In this problem, we are given the following variables:Number of moles (n): 0.789 molesPressure (P):…
Q: 2 3 points Order the following elements to form the name of the branched alkane shown below. START 1…
A: Thank you.
Q: How many moles of iron (III) hydroxide are produced when 5.0 m= moles of sodium hydroxide react with…
A: The given balanced chemical equation is FeCl3 + 3NaOH -> Fe(OH)3 + 3NaCl. This equation tells us…
Q: Please correct answer and don't use hend raiting
A: To calculate the pH and the concentration of all the chemical species in a solution of 0.300 M of a…
Q: Give detailed Solution with explanation needed...don't give Handwritten answer. Don't copy the…
A: Given: 89Sr;81SrStep 1: Write the AZ notation of the beta particle.−1 0e Step 2: Determine the…
Q: 7(a) The saturated calomel electrode (SCE) is a reference electrode based on the reaction between…
A: The balanced overall cell reaction can be obtained by combining the half-cell reactions. The…
Q: Suppose a 250. mL flask is filled with 0.50 mol of H2 and 0.60 mol of 12. The following reaction…
A:
Q: please step by step solution with explnation.
A: I n the given compound the sigma bond shown by arrow consist of two Carbon atoms. The first C-atom…
Q: dentify the IUPAC name for each of the following alkynes. © 4,6-dimethyl-1-octyne…
A: Let's identify the IUPAC names for each of the given alkynes. Left Structure1. Identify the…
Q: 5. The car you have been driving has a posted fuel consumption of 10.0 L/100 km (city) and 7.1 L/100…
A: The first step is to compare the actual fuel consumption with the posted fuel consumption. The…
Q: The value of AH° for the reaction below is -186 kJ mol-1. H₂ (g) + Cl2 (g) → 2HCl (g) Calculate AH°f…
A: The problem is asking us to calculate the standard enthalpy of formation (ΔH°f) for HCl (g). The…
Q: Be sure to answer all parts. Enter your answer in scientific notation. Thiamine hydrochloride…
A: break down the solution step-by-step:**Step 1: Calculate the pKa value**The pKa value is a measure…
Q: (b) Using diagrams and chemical structures, explain why zinc is a suitable metal in carbonic…
A: Step 1:The detailed answer is given above.Step 2: Step 3: Step 4:
Q: <- Part A The value of AH" for the reaction below is -186 kJ. H2 (g) + Cl2 (g) → 2HCI (g) The value…
A:
Q: 1.09 k cal of energy is added to 45 grams of water at initial tepature of 23.4c what is the final…
A: The problem is asking us to find the final temperature of water when a certain amount of energy is…
Q: MULTIPLE CHOICE QUESTION Which of the following molecules can have cis trans isomers? a Both can…
A: Compound in Figure 1:The first structure consists of a six-membered ring with a double bond, an…
Q: Please explain why for part b) the compounds are eluted in that order. Thank you!
A: Explanations are integrated with the answer given above.
Q: None
A: The reaction is a nucleophilic acyl substitution reaction, where the ethyl anhydride (the reactant…
Q: Give detailed Solution...show work..don't give Handwritten answer
A: The rate-determining step is the slowest step of a chemical reaction that determines the speed…
Q: None
A: a. Given: HNO3(aq)+H2S(g)→NO(g)+S(s)Step 1: Write the…
Q: 4. Predict the product of the following aldol condensation reaction which produces a ẞ-…
A: CH3CH2C−(O)CH2CH3+CH3CH2COCH3→CH3CH2C(OH)CH2CH3CH3CH2C(O)CH3
Q: What type of titration is being performed in this experiment to determine the amount of 12 produced?
A: Detailed Explanation of Iodometric TitrationIodometric titration is a common analytical technique…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A:
Q: Please correct answer and don't use hend raiting
A:
Q: The isotope 65Ga undergoes radioactive decay, with decay constant λ = 0.0456/min. What is the…
A: The half-life of a radioactive substance is the time it takes for half of the substance to decay. It…
Q: Question 16 What is the name of the following polymer? OH OH OH OH OH OH 666666 OH OH OH OH OH OH OH…
A: D-glucose: Option 1 : Amylose (Straight chain polymer of D-glucose) Option 2 : Galactose (not a…
Q: Which of the following is FALSE regarding the FTIR signal of C=O in carbonyl groups? a. Signal…
A: The Fourier Transform Infrared (FTIR) spectroscopy is a technique used to obtain an infrared…
Q: None
A: a. Reaction: Aniline with Br₂ in the presence of FeBr₃Electrophilic Aromatic Substitution (EAS)…
Q: Macmillan Learnin CCI N₂+ 3H 2 NH3 2H, +02 > 2H₂O + Au Which chemical reactions are not possible…
A:
Q: The density of a sample of NH3(g) at a pressure of 1.00 atm is 0.821 g/L. What is the root mean…
A: Step 1:Step 2:Step 3:
Q: Q2) IUPAC Name nous 0 OH soed llet uoy bluoxer-S 10 lonsx ed beau ed bluos doidw supindo
A: The parent chain has 9 carbons with a carboxylic acid group, so nonanoic acid.There is a double bond…
Q: The distribution constant for compound A between an organic solvent and water is 65. Calculate the…
A: The distribution constant (Kd) is a measure of the distribution of a compound between two immiscible…
![The distribution constant for compound A between an organic solvent and water is 65. Calculate the concentration of compound A remaining in the aqueous layer after extraction of 50 mL
of a 5 X 10-3 M aqueous solution of compound A with the following quantities of the organic solvent:
(a) Two 25 mL portions
(b) Four 12.5 mL portions](/v2/_next/image?url=https%3A%2F%2Fcontent.bartleby.com%2Fqna-images%2Fquestion%2Fa486c62f-8846-481e-9f3a-63e1715ce151%2F4ddf340b-84b6-4818-a3ef-3017ad53cf64%2Fc5bsqm_processed.jpeg&w=3840&q=75)
Unlock instant AI solutions
Tap the button
to generate a solution
Click the button to generate
a solution
- A mixture of ethanol, benzaldehyde and KMnO4 is mixed together. Would you expect a precipitate to form based on the reactants functional groups?What is the equivalent weight of an organic acid if 44.00 mL NaOH solution (1.000 mL ≎ 1.100 mL HCl ≎ 0.01001 g CaCO3) are required to neutralize 0.5192 g of the organic acid?42.5 mL of 1.3M KOH are required to neutralize 50.0 mL of H2SO4. This sulfuric acid is further used to standardize NaOH solution. 20mL aliquot of the NaOH solution is obtained and 2 drops of phenolphthalein is added. The initial reading on the buret is 13.2 mL. After the titration, the exact normality of the NaOH solution is found to be 1.254N. (a) What is the molarity of H2SO4? (b) How much of the sulfuric acid is used? (c) What is the final reading on the buret?
- Provide a flow chart analogous to separate a diethyl ether solution containing benzoic acid, 2-naphthol (a weak acid), 4-nitroaniline (a weak base), and naphthalenePresent clear/readable and full solutions:A 0.8250 g of soda ash sample was dissolved in distilled H O and diluted to 250-mL using a volumetric flask. A 50.00 mL aliquot portion of the dilute soda ash solution needed 4.50 mL of 0.1200 M HCl to reach the phenolphthalein end point and 10.00 mL to reach the methyl orange end point. What is the %NaHCO (%w/w) present in the soda ash sample? FW NaHCO = 84.01 g/mol (Hint: Use dilution factor)
- I have a 1.2864g sample of maleic acid which was dissolved in enough water to make 100.0 mL of a solution. Then 10.0 mL of the solution was titrated to a phenolphthalein endpoint with 29.39 mL of an unknown sodium hydroxide solution. What is the molarity of the sodium hydroxide solution?A) What is the concentration of benzene (in ppm) in the original solution? B) What is the concentration of hexane (in ppb) in the original solution?12) Organic chemistry subject, please provide the correct solution for the following.
- How to prepare 100 mL of 10% AlCl3Formulate a hypothesis regarding the solubility of aspirin at different pH.The experimentA) Three teaspoons of water (approx. 15 ml) were added to one tablet said to contain 300 mg of aspirin. Fizzingwas observed. Most of the tablet dissolved, but there were some solid particles. By heating the mug in amicrowave for 10 second increments until the water came to the boil (approx. 3x), all of the solid particlesdissolved. The solution was left to cool to room temperature and then placed in a fridge and NOTHINGHAPPENED. Try this yourself if you can spare two aspirin tablets, your results might look different.• Questions to ask:1. What might the fizzing bubbles be?2. Can you give a chemical explanation?3. Can you write a chemical reaction equation with aspirin reacting with something to give a gas and aspirinin another form?4. What might be the formulation (what the manufacturer mixes with aspirin in making the tablet) “trick”for aspirin to improve solubility?5. How does this compare with…why is cyclohexene soluble in H2SO4? please cite reference
![EBK A SMALL SCALE APPROACH TO ORGANIC L](https://www.bartleby.com/isbn_cover_images/9781305446021/9781305446021_smallCoverImage.jpg)
![EBK A SMALL SCALE APPROACH TO ORGANIC L](https://www.bartleby.com/isbn_cover_images/9781305446021/9781305446021_smallCoverImage.jpg)