The equation for the reaction between sodium hydrogen carbonate and sulfuric acid at room temperature is represented by the following equation. 2NAHCO;(s) + H2SO4(aq)→ Na,SO,(aq) + 2H2O(1) + 2CO2(g) Calculate the mass of sodium hydrogen carbonate that will produce 24 mL of carbon dioxide when reacted with excess sulfuric acid. [Relative atomic mass: Na = 23.0; H =1.0;C = 12.0;0= 16.0] [Molar volume at room temperature: 24.00L mol-1]

The equation for the reaction between sodium hydrogen carbonate and sulfuric acid at room temperature is represented by the following equation. 2NAHCO;(s) + H2SO4(aq)→ Na,SO,(aq) + 2H2O(1) + 2CO2(g) Calculate the mass of sodium hydrogen carbonate that will produce 24 mL of carbon dioxide when reacted with excess sulfuric acid. [Relative atomic mass: Na = 23.0; H =1.0;C = 12.0;0= 16.0] [Molar volume at room temperature: 24.00L mol-1]

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 164CP: Nitric acid is produced commercially by the Ostwald process, represented by the following equations:...

See similar textbooks

Similar questions

Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Write balanced chemical equations for the following reactions: (a) zinc metal heated in a stream of oxygen gas (b) zinc carbonate heated until loss of mass stops (c) zinc carbonate added to a solution 0f acetic acid, CH3CO2H (d) zinc added to a solution of hydro-bromic acid
Iodine can be prepared by allowing an aqueous solution of hydrogen iodide to react with manganese dioxide, MnO2. The reaction is 2I(aq)+4H+(aq)+MnO2(s)Mn2+(aq)+2H2O+I2(s) If an excess of hydrogen iodide is added to 0.200 g of MnO2, how many grams of iodine are obtained, assuming 100% yield?
Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
MTBE, Methyl tert -butyl ether, CH3OC(CH3)3, is used as an oxygen source in oxygenated gasolines. MTBE is manufactured by reacting 2-methy1propeue with methanol. (a) Using Lewis structures, write the Chemical equation representing the reaction. (b) What volume of methanol, density 0.7915 g/mL, is required to produce exactly 1000 kg of MTBE, assuming a 100% yield?
Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane: 2NH3(g)+3O2(g)+2CH4(g)2HCN(g)+6H2O(g) If 5.00 103 kg each of NH3, O2, and CH4 are reacted, what mass of HCN and of H2O will be produced, assuming 100% yield?