The following problem requires TWO reaction steps in a row. 1. Starting with the given substrate and conducting the first reaction step described, provide the COMPLETE CORRECT CONDENSED STRUCTURAL FORMULA for the MAJOR substrate product of the first reaction. 2. THEN, use the major substrate product of reaction step 1 as the substrate of reaction step 2. Conducting the second reaction step described, provide the COMPLE
The following problem requires TWO reaction steps in a row.
1. Starting with the given substrate and conducting the first reaction step described, provide the COMPLETE CORRECT CONDENSED STRUCTURAL FORMULA for the MAJOR substrate product of the first reaction.
2. THEN, use the major substrate product of reaction step 1 as the substrate of reaction step 2. Conducting the second reaction step described, provide the COMPLETE CORRECT CONDENSED STRUCTURAL FORMULA for the FINAL MAJOR substrate product after reaction step 2 is complete. Remember the reaction rules!
Start with condensed structural formula
CH3-CH2-CH(OH)-CH(CH3)-CH3
and react it first with H2SO4 and high heat, to produce a major substrate product. Then, take that major substrate product, and use it as the substrate of the next reaction, by reacting it with HBr, to produce the FINAL MAJOR substrate product.
The complete correct condensed structural formula for the major substrate product after reaction step 1 is ___________ .
The complete correct condensed structural formula for the final major substrate product (after reaction step 2) is ____________ .
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
