The standard electrode potentials given in your Data Booklet are reported using the standard hydrogen half-cell as the reference half-cell. If the standard reference half-cell used to construct a table of electrode potentials was Zn²+ (aq) + 2e" - Zn(s), the standard electrode potential for Fe2(aq) + 2e → Fe(s) would be Select one: O +0.31V O -0.45V O +0.45V O -0.31V If the standard reference half-cell used to construct a table of electrode potentials was Zn²+ (aq) + 2e - Zn(s), the cell potential for a Fe(s) | Fe²+ (aq) || Cu²+ (aq) | Cu(s) cell would be Select one: O -0.79V O -1.55V +1.55V +0.79V

The standard electrode potentials given in your Data Booklet are reported using the standard hydrogen half-cell as the reference half-cell. If the standard reference half-cell used to construct a table of electrode potentials was Zn²+ (aq) + 2e" - Zn(s), the standard electrode potential for Fe2(aq) + 2e → Fe(s) would be Select one: O +0.31V O -0.45V O +0.45V O -0.31V If the standard reference half-cell used to construct a table of electrode potentials was Zn²+ (aq) + 2e - Zn(s), the cell potential for a Fe(s) | Fe²+ (aq) || Cu²+ (aq) | Cu(s) cell would be Select one: O -0.79V O -1.55V +1.55V +0.79V

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.103QE

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag